From 0da1dbd09aed3bf2e6d12c2126474c78d5b7fdf0 Mon Sep 17 00:00:00 2001 From: Raincloud Date: Tue, 11 Nov 2025 17:57:28 -0700 Subject: [PATCH 1/4] HOME config --- ...o-overwrite-gitattributes-and-gitignore.md | 329 ++++++++++++++++++ config.json | 4 +- 2 files changed, 331 insertions(+), 2 deletions(-) diff --git a/.specstory/history/2025-11-11_01-50Z-update-configloader-to-overwrite-gitattributes-and-gitignore.md b/.specstory/history/2025-11-11_01-50Z-update-configloader-to-overwrite-gitattributes-and-gitignore.md index ab2ae90..4ac5d1b 100644 --- a/.specstory/history/2025-11-11_01-50Z-update-configloader-to-overwrite-gitattributes-and-gitignore.md +++ b/.specstory/history/2025-11-11_01-50Z-update-configloader-to-overwrite-gitattributes-and-gitignore.md @@ -4560,6 +4560,300 @@ Lines added: 1, lines removed: 1 --- + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + +Lint errors for `zip_sequences.py` + + +| Message | Range | Severity | +|-------|-------|----------| +| Variable "source" is not accessed | 73:9-73:15 | DIAGNOSTIC_SEVERITY_HINT | +| "seq_dir" is not accessed | 186:26-186:33 | DIAGNOSTIC_SEVERITY_HINT | +| Variable "zip_path" is not accessed | 326:18-326:26 | DIAGNOSTIC_SEVERITY_HINT | +| Variable "state_path" is not accessed | 326:28-326:38 | DIAGNOSTIC_SEVERITY_HINT | + + +
+
+ +--- + + + +--- + + +Updated the code to use `0` for auto-calculate instead of `null`: + +1. **DEFAULT_CONFIG**: Changed from `None` to `0` +2. **Logic**: Treats `0` as `None` (auto-calculate), so `0` triggers RAM-based calculation +3. **config.json**: Set to `0` + +Now: +- `"Max7zInst": 0` = auto-calculate based on RAM +- `"Max7zInst": 1` = limit to 1 instance +- `"Max7zInst": 2` = limit to 2 instances +- etc. + +This makes the config clearer: `0` means automatic, and any positive number sets a hard limit. + +--- + +_**User (2025-11-11 01:50Z)**_ + +I think we're just dealing with massive sequences. This is only 1 instance, so even if I had 2x the ram, I would only be able to afford 2! + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + +Large sequences are using far more RAM than estimated. Making the dictionary size configurable and reducing the default to lower per-instance usage: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **read_file** • Read file: config.json + +
+
+ +--- + + + +--- + +_**User (2025-11-11 01:50Z)**_ + +Nope, we're keeping the dictsize as large as possible. I just need to keep in mind my limitations on a per-project basis. + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + +The current setup supports this. Keep the dictionary size at 1GB for best compression, and set `Max7zInst` per project in `.config/config.json` to limit concurrent instances based on your RAM. + +For example: +- `"Max7zInst": 1` - Only 1 concurrent 7z instance (safest for large sequences) +- `"Max7zInst": 2` - 2 concurrent instances (if you have more RAM) +- `"Max7zInst": 0` - Auto-calculate (may still hit limits with very large sequences) + +The dictionary size stays at 1GB for maximum compression, and you control concurrency per project. This lets you tune each project based on sequence sizes and available RAM. + +--- + +_**User (2025-11-11 06:13Z)**_ + +this is on another system. ignore the 7z PATH error. Are there any other relevant errors? + + + +& "R:\Creative\artsy\maya\2025-02 BondingArtifact\Renders\ZipSeqArchv.bat" + +[zip] RAM: 76.7GB available (80% of total), 30.7GB for compression (40%), 8.0GB per job (dict: 1024MB) → RAM limit: 3, requested: None, final: 3 + +[zip] Renders\0_GaslightRender\2024-11-23\GaslightRender_smol -> Renders\_zipped\0_GaslightRender\2024-11-23\GaslightRender_smol.7z + +[zip] Renders\3_background\2025-01-13\background -> Renders\_zipped\3_background\2025-01-13\background.7z + +[zip] Renders\3_background\2025-10-26\3_background_dark -> Renders\_zipped\3_background\2025-10-26\3_background_dark.7z + +[zip] Renders\3_background\2025-10-30\3_background_dark -> Renders\_zipped\3_background\2025-10-30\3_background_dark.7z + +[zip] Renders\4_StartupScreen\2025-02-05\4_StartupScreen_evensrenumbered -> Renders\_zipped\4_StartupScreen\2025-02-05\4_StartupScreen_evensrenumbered.7z + +[zip] Renders\4_StartupScreen\2025-02-08\Shot2Redo_1024 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot2Redo_1024.7z + +[zip] Renders\4_StartupScreen\2025-02-08\Shot3Redo_128 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot3Redo_128.7z + +[zip] Renders\4_StartupScreen\2025-02-09\Shot1 -> Renders\_zipped\4_StartupScreen\2025-02-09\Shot1.7z + +[zip] Renders\4_StartupScreen\2025-02-10\Shot2 -> Renders\_zipped\4_StartupScreen\2025-02-10\Shot2.7z + +[zip] Renders\4_StartupScreen\2025-02-12\Shot3 -> Renders\_zipped\4_StartupScreen\2025-02-12\Shot3.7z + +[zip] Renders\4_StartupScreen\2025-02-13\Shot6 -> Renders\_zipped\4_StartupScreen\2025-02-13\Shot6.7z + +[zip] Renders\4_StartupScreen\2025-02-14\Shot8 -> Renders\_zipped\4_StartupScreen\2025-02-14\Shot8.7z + +[zip] Renders\4_StartupScreen\2025-02-19\StartupScreen_finalfix -> Renders\_zipped\4_StartupScreen\2025-02-19\StartupScreen_finalfix.7z + +[zip] Renders\4_StartupScreen\2025-10-21\Shot4 -> Renders\_zipped\4_StartupScreen\2025-10-21\Shot4.7z + +[zip] Renders\4_StartupScreen\2025-10-24\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\4_StartupScreen_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-24\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\Shot1_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-24\Shot2_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\Shot2_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-24\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\Shot3_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-25\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-10-25\Shot1_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-25\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-10-25\Shot3_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-02\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-11-02\Shot1_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-03\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-11-03\Shot1_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-04\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-11-04\4_StartupScreen_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-04\Shot2_dark -> Renders\_zipped\4_StartupScreen\2025-11-04\Shot2_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-04\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-11-04\Shot3_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-07\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-11-07\4_StartupScreen_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-07\Shot2_dark -> Renders\_zipped\4_StartupScreen\2025-11-07\Shot2_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-07\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-11-07\Shot3_dark.7z + +[zip] Renders\5_goodbye\2025-02-23\219_goodbye_RR1 -> Renders\_zipped\5_goodbye\2025-02-23\219_goodbye_RR1.7z + +[zip] Renders\5_goodbye\2025-02-23\219_goodbye_RR1_evensrenamed -> Renders\_zipped\5_goodbye\2025-02-23\219_goodbye_RR1_evensrenamed.7z + +[zip] Renders\5_goodbye\2025-02-23\219_goodbye_RR2 -> Renders\_zipped\5_goodbye\2025-02-23\219_goodbye_RR2.7z + +[zip] Renders\5_goodbye\2025-02-23\219_goodbye_RR2_evensrenamed -> Renders\_zipped\5_goodbye\2025-02-23\219_goodbye_RR2_evensrenamed.7z + +[zip] Renders\5_goodbye\2025-02-23\219_goodbye_RR3 -> Renders\_zipped\5_goodbye\2025-02-23\219_goodbye_RR3.7z + +[zip] Renders\5_goodbye\2025-02-23\goodbye -> Renders\_zipped\5_goodbye\2025-02-23\goodbye.7z + +[zip] Renders\5_goodbye\2025-02-23\goodbye_test -> Renders\_zipped\5_goodbye\2025-02-23\goodbye_test.7z + +[zip] Renders\4_StartupScreen\2025-02-08\Shot1Redo_1024 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot1Redo_1024.7z + +Sequence sync failed: 7z compression requested but 7z executable not found in PATH. Please install 7z (e.g., via Chocolatey: choco install 7zip) or set zipper to 'zip' in config.json + +Traceback (most recent call last): + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 841, in + + raise SystemExit(main()) + + ~~~~^^ + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 835, in main + + updated = run_zip(args.jobs, verbose=args.verbose) + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 719, in run_zip + + updated_paths.extend(future.result()) + + ~~~~~~~~~~~~~^^ + + File "C:\Python313\Lib\concurrent\futures\_base.py", line 449, in result + + return self.__get_result() + + ~~~~~~~~~~~~~~~~~^^ + + File "C:\Python313\Lib\concurrent\futures\_base.py", line 401, in __get_result + + raise self._exception + + File "C:\Python313\Lib\concurrent\futures\thread.py", line 59, in run + + result = self.fn(*self.args, **self.kwargs) + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 628, in process_zip + + zip_sequence(seq_dir, zip_path, per_job_memory_limit) + + ~~~~~~~~~~~~^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 444, in zip_sequence + + raise RuntimeError( + + ...<3 lines>... + + ) + +RuntimeError: 7z compression requested but 7z executable not found in PATH. Please install 7z (e.g., via Chocolatey: choco install 7zip) or set zipper to 'zip' in config.json + +. was unexpected at this time. + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +The only other error is the batch file syntax error at the end: `. was unexpected at this time.` + +This is a Windows batch file error, not from the Python script. It likely comes from the batch file that calls the Python script. Checking the batch file: + + +--- + + +
+Tool use: **glob_file_search** • Searched codebase "ZipSeqArchv.bat" • **1** result in **1** directory + +Directory: **d:\0 ProjectStructure** (1 file) + +| File | +|------| +| `ZipSeqArchv.bat` | + +
+
+ +--- + + + +--- + + +
Tool use: **read_file** • Read file: ZipSeqArchv.bat + +
+
+ +--- + + + --- @@ -4569,6 +4863,41 @@ Lines added: 1, lines removed: 1 --- +The batch file looks fine. The `. was unexpected at this time.` error is likely a side effect of how the batch file handles the Python error exit. + +The Python script is working correctly: +- RAM detection: 76.7GB available +- Worker calculation: 3 workers (RAM limit) +- Processing sequences as expected +- Only fails when trying to run 7z (PATH issue, which you're ignoring) + +The batch file error is likely from error handling when Python exits with a non-zero code. The script logic appears correct; the only issue is the missing 7z executable. + +To verify, you could temporarily set `"zipper": "zip"` in the config to test without 7z, but otherwise the script is functioning as expected. + +--- + +_**User (2025-11-11 06:13Z)**_ + +threadripper epic + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +Threadripper system with ~96GB RAM. The script is using it well: + +- **76.7GB available** (80% of total) +- **3 workers** calculated from RAM (30.7GB / 8GB per job) +- Processing **36 sequences** concurrently +- CPU at **86%** utilization + +The RAM-based worker calculation is working as intended. With that much RAM, you can run multiple 7z instances in parallel while keeping the 1GB dictionary size for maximum compression. The script should handle large sequences efficiently on this system. --- diff --git a/config.json b/config.json index a08a26c..a326862 100644 --- a/config.json +++ b/config.json @@ -1,6 +1,6 @@ { - "dailyFormat": "daily_YYMMDD", - "structDir": "A:\\1 Amazon_Active_Projects\\3 ProjectStructure", + "dailyFormat": "YYYY-MM-DD", + "structDir": "R:\\Creative\\artsy\\maya\\0 ProjectStructure", "zipper": "7z", "compression": 9, "Max7zInst": 0 From b7ae8880e7a852e4eae12149581d082675501ad2 Mon Sep 17 00:00:00 2001 From: Raincloud Date: Wed, 12 Nov 2025 09:00:46 -0700 Subject: [PATCH 2/4] more 7zinst behavior modification --- ...on-failure-and-memory-allocation-issues.md | 2202 +++++++++++++++++ zip_sequences.py | 230 +- 2 files changed, 2383 insertions(+), 49 deletions(-) create mode 100644 .specstory/history/2025-11-12_01-02Z-compression-failure-and-memory-allocation-issues.md diff --git a/.specstory/history/2025-11-12_01-02Z-compression-failure-and-memory-allocation-issues.md b/.specstory/history/2025-11-12_01-02Z-compression-failure-and-memory-allocation-issues.md new file mode 100644 index 0000000..ab673b2 --- /dev/null +++ b/.specstory/history/2025-11-12_01-02Z-compression-failure-and-memory-allocation-issues.md @@ -0,0 +1,2202 @@ + + + + +# Compression failure and memory allocation issues (2025-11-12 01:02Z) + +_**User (2025-11-12 07:20Z)**_ + +@2025-11-11_01-50Z-update-configloader-to-overwrite-gitattributes-and-gitignore.md + +why did it fail? also, I don't want a setting of 0 to cause 32 instances @ 3gb. It should account for the number of sequences to zip and the size of each sequence to determine the number of instances and how much RAM to allocate each, given how many can feasibly compress alongside each other. + + + +& "R:\Creative\artsy\maya\2025-02 BondingArtifact\Renders\ZipSeqArchv.bat" + +[zip] RAM: 76.7GB available (80% of total), 72.9GB for compression (95%), 3.0GB per job (dict: 1024MB) → RAM limit: 22, work items: 22, requested: None, final: 22 + +[zip] Renders\3_background\2025-10-26\3_background_dark -> Renders\_zipped\3_background\2025-10-26\3_background_dark.7z + +[zip] Renders\3_background\2025-10-30\3_background_dark -> Renders\_zipped\3_background\2025-10-30\3_background_dark.7z + +[zip] Renders\4_StartupScreen\2025-02-05\4_StartupScreen_evensrenumbered -> Renders\_zipped\4_StartupScreen\2025-02-05\4_StartupScreen_evensrenumbered.7z + +[zip] Renders\4_StartupScreen\2025-02-08\Shot1Redo_1024 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot1Redo_1024.7z + +[zip] Renders\4_StartupScreen\2025-02-08\Shot2Redo_1024 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot2Redo_1024.7z + +[zip] Renders\4_StartupScreen\2025-02-08\Shot3Redo_128 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot3Redo_128.7z + +[zip] Renders\4_StartupScreen\2025-02-09\Shot1 -> Renders\_zipped\4_StartupScreen\2025-02-09\Shot1.7z + +[zip] Renders\4_StartupScreen\2025-02-10\Shot2 -> Renders\_zipped\4_StartupScreen\2025-02-10\Shot2.7z + +[zip] Renders\4_StartupScreen\2025-02-12\Shot3 -> Renders\_zipped\4_StartupScreen\2025-02-12\Shot3.7z + +[zip] Renders\4_StartupScreen\2025-02-19\StartupScreen_finalfix -> Renders\_zipped\4_StartupScreen\2025-02-19\StartupScreen_finalfix.7z + +[zip] Renders\4_StartupScreen\2025-10-21\Shot4 -> Renders\_zipped\4_StartupScreen\2025-10-21\Shot4.7z + +[zip] Renders\4_StartupScreen\2025-10-24\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\4_StartupScreen_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-24\Shot2_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\Shot2_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-24\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\Shot3_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-25\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-10-25\Shot1_dark.7z + +[zip] Renders\4_StartupScreen\2025-10-25\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-10-25\Shot3_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-02\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-11-02\Shot1_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-04\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-11-04\4_StartupScreen_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-04\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-11-04\Shot3_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-07\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-11-07\4_StartupScreen_dark.7z + +[zip] Renders\4_StartupScreen\2025-11-07\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-11-07\Shot3_dark.7z + +[zip] Renders\5_goodbye\2025-02-23\goodbye -> Renders\_zipped\5_goodbye\2025-02-23\goodbye.7z + +Sequence sync failed: 7z compression failed: ERROR: Can't allocate required memory! + +stdout: 7-Zip 25.01 (x64) : Copyright (c) 1999-2025 Igor Pavlov : 2025-08-03 + +Scanning the drive: + +452 files, 3783453898 bytes (3609 MiB) + +Creating archive: \\Hydra\Hydra\Creative\artsy\maya\2025-02 BondingArtifact\Renders\_zipped\4_StartupScreen\2025-02-10\tmpdn1s2zv8.7z + +Add new data to archive: 452 files, 3783453898 bytes (3609 MiB) + +Traceback (most recent call last): + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 868, in + + raise SystemExit(main()) + + ~~~~^^ + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 862, in main + + updated = run_zip(args.jobs, verbose=args.verbose) + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 746, in run_zip + + updated_paths.extend(future.result()) + + ~~~~~~~~~~~~~^^ + + File "C:\Python313\Lib\concurrent\futures\_base.py", line 449, in result + + return self.__get_result() + + ~~~~~~~~~~~~~~~~~^^ + + File "C:\Python313\Lib\concurrent\futures\_base.py", line 401, in __get_result + + raise self._exception + + File "C:\Python313\Lib\concurrent\futures\thread.py", line 59, in run + + result = self.fn(*self.args, **self.kwargs) + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 646, in process_zip + + zip_sequence(seq_dir, zip_path, per_job_memory_limit) + + ~~~~~~~~~~~~^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 541, in zip_sequence + + raise RuntimeError(f"7z compression failed: {error_msg}") + +RuntimeError: 7z compression failed: ERROR: Can't allocate required memory! + +stdout: 7-Zip 25.01 (x64) : Copyright (c) 1999-2025 Igor Pavlov : 2025-08-03 + +Scanning the drive: + +452 files, 3783453898 bytes (3609 MiB) + +Creating archive: \\Hydra\Hydra\Creative\artsy\maya\2025-02 BondingArtifact\Renders\_zipped\4_StartupScreen\2025-02-10\tmpdn1s2zv8.7z + +Add new data to archive: 452 files, 3783453898 bytes (3609 MiB) + +. was unexpected at this time. + +--- + +_**Agent (model default, mode Plan)**_ + + + +--- + + +Reviewing the code to understand the failure and plan a fix. + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +Reviewing the RAM estimation logic: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +## Issues Identified + +1. **Why it failed**: The code uses a fixed 3GB per job estimate and doesn't account for actual sequence sizes. A 3.6GB sequence with a 1GB dictionary needs more RAM (dictionary + input buffers + compression overhead ≈ 5–6GB+), but the code allocated only 3GB. + +2. **Current auto-calculate logic**: When `Max7zInst` is 0, it uses a fixed 3GB per job and divides available RAM by that, ignoring actual sequence sizes. + +3. **What's needed**: When `Max7zInst` is 0, the system should: + - Estimate RAM per sequence based on its size + - Use bin-packing to determine how many can run concurrently + - Keep dictionary at 1GB (for best compression) + - Allocate RAM appropriately per job + +## Questions + +1. **RAM estimation formula**: For a sequence of size S with a 1GB dictionary, should the estimate be: + - a) `1GB (dict) + S (input buffer) + 1GB (overhead)` ≈ `2GB + S` + - b) `1GB (dict) + 0.5*S (input buffer) + 0.5GB (overhead)` ≈ `1.5GB + 0.5*S` + - c) Something else? + +2. **Bin-packing strategy**: When determining concurrent workers, should we: + - a) Use a greedy first-fit algorithm (simple, fast) + - b) Use a more optimal bin-packing algorithm (better utilization, slower) + - c) Sort by size and pack largest first (often better for this use case) + +3. **Per-job RAM allocation**: Should each job get: + - a) Its estimated RAM requirement (variable per job) + - b) A fixed allocation based on the largest sequence (simpler, but may waste RAM) + - c) Dictionary size only (1GB), and let 7z use what it needs (risky) + +Once you confirm these, I'll implement the solution. + +--- + +_**User (2025-11-12 07:20Z)**_ + +1. It depends on how much of the target files are allocated to RAM during the archival process. e.g. if the sequence is 25gb, will that require 25gb of RAM allocated? + +2. definitely sort by size and pack largest first + +3. a + +--- + +_**Agent (model default, mode Plan)**_ + + + +--- + + +Researching 7z memory usage to refine the RAM estimation formula, then updating the plan. + + +--- + + +
+ Tool use: **web_search** • Searched web `7z compression memory usage RAM allocation large files dictionary size` • **1** results + +| Title | URL | Chunk | +|-------|-----|-------| +| Web Search Results | | The failure occurred because the compression process attempted to allocate more memory than was available, leading to the error: "7z compression failed: ERROR: Can't allocate required memory!" This issue arises from the current logic, which uses a fixed 3GB per job estimate without considering the actual size of each sequence.

**Understanding Memory Requirements:**

7-Zip's LZMA compression algorithm requires memory based on several factors:

1. **Dictionary Size:** This is a key parameter in LZMA compression. Larger dictionary sizes can improve compression ratios but also increase memory usage. For instance, a 64MB dictionary size requires approximately 709MB of RAM for compression. ([documentation.help](https://documentation.help/7-Zip/documentation.pdf?utm_source=openai))

2. **Input Buffer:** The size of the data being compressed also impacts memory usage. Compressing a 25GB sequence doesn't necessarily require 25GB of RAM, but larger files do require more memory for buffers and processing.

3. **Compression Overhead:** Additional memory is used for managing the compression process, including match finders and other internal structures.

**Recommendations:**

To prevent such failures and optimize resource utilization:

1. **Dynamic Memory Allocation:** Instead of a fixed 3GB per job, estimate the memory required for each sequence based on its size and the chosen dictionary size. For example, with a 64MB dictionary, compressing a 25GB sequence might require approximately 5–6GB of RAM, considering the dictionary, input buffers, and overhead.

2. **Adjust Dictionary Size:** Choose an appropriate dictionary size that balances compression efficiency and memory usage. Larger dictionaries improve compression but require more RAM. For instance, a 64MB dictionary requires about 709MB of RAM for compression. ([documentation.help](https://documentation.help/7-Zip/documentation.pdf?utm_source=openai))

3. **Optimize Job Scheduling:** Implement a strategy that considers both the number and size of sequences. Sorting sequences by size and processing the largest ones first can lead to better resource utilization. This approach ensures that available memory is used efficiently, reducing the risk of allocation failures.

By dynamically estimating memory requirements and optimizing job scheduling, you can enhance the reliability and efficiency of the compression process. | + +
+
+ +--- + + + +--- + + +Creating the plan: + + +--- + + +
+Tool use: **create_plan** + + +Parameters: + +```json +{ + "plan": "# Implement Size-Aware RAM Estimation and Bin-Packing for 7z Workers\n\n## Overview\nReplace the fixed 3GB per-job RAM estimate with dynamic estimation based on actual sequence sizes. Use bin-packing (largest-first) to determine optimal concurrent workers when `Max7zInst` is 0.\n\n## Problem Analysis\n\n**Current Issues:**\n1. Fixed 3GB per-job estimate doesn't account for actual sequence sizes\n2. A 3.6GB sequence with 1GB dictionary needs ~12-13GB RAM (not 3GB)\n3. 7z dictionary overhead: ~11x dictionary size (1GB dict ≈ 11GB RAM for dictionary operations)\n4. No consideration of sequence sizes when calculating workers\n\n**Failure Case:**\n- 22 workers × 3GB = 66GB allocated\n- But a 3.6GB sequence actually needs ~12GB RAM\n- Result: \"Can't allocate required memory!\" error\n\n## Implementation Plan\n\n### 1. Fix `estimate_ram_per_job()` function\n**File:** `zip_sequences.py` (lines 186-220)\n\nUpdate the RAM estimation formula for 7z:\n- **Dictionary RAM**: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations)\n- **Input buffer**: `min(sequence_size * 0.15, 2GB)` - 7z processes in chunks, doesn't need full file in RAM\n- **Overhead**: ~1GB for compression overhead\n- **Formula**: `11GB (dict) + min(sequence_size * 0.15, 2GB) + 1GB (overhead)`\n\nExamples:\n- 3.6GB sequence: 11GB + 540MB + 1GB = ~12.5GB\n- 25GB sequence: 11GB + 2GB + 1GB = 14GB\n- 500MB sequence: 11GB + 75MB + 1GB = ~12GB (minimum)\n\n### 2. Implement bin-packing algorithm in `max_workers()`\n**File:** `zip_sequences.py` (lines 240-339)\n\nWhen `Max7zInst` is 0 (auto-calculate):\n1. **Estimate RAM for each work item** using `estimate_ram_per_job()`\n2. **Sort work items by estimated RAM** (largest first)\n3. **Bin-packing algorithm**:\n - Start with available RAM (80% of total, then 95% for compression)\n - For each work item (largest first):\n - If it fits in current \"bin\" (available RAM), add it\n - If not, start a new bin (increment worker count)\n - Track remaining RAM in current bin\n - Return: (worker_count, fixed_dict_size_bytes)\n\n4. **Variable RAM per job**: Each job gets its estimated RAM requirement\n - Store estimated RAM per work item\n - Pass individual RAM limits to each job\n\n### 3. Update `run_zip()` to handle variable RAM per job\n**File:** `zip_sequences.py` (lines 656-750)\n\nCurrently passes single `per_job_memory_limit` to all jobs. Change to:\n- `max_workers()` returns: `(worker_count, ram_limits_dict)` where `ram_limits_dict` maps `seq_dir` → estimated RAM\n- `process_zip()` receives individual RAM limit for its sequence\n- `zip_sequence()` uses the per-job RAM limit (but still uses fixed 1GB dictionary)\n\n### 4. Update `zip_sequence()` to use per-job RAM limit\n**File:** `zip_sequences.py` (lines 459-560)\n\nThe function already accepts `per_job_memory_limit` but treats it as dictionary size. We need to:\n- Keep dictionary at 1GB (fixed)\n- The RAM limit is informational/logging only (7z doesn't have a direct RAM limit flag)\n- Or: Calculate appropriate dictionary size based on available RAM per job (but user wants 1GB dict)\n\n**Note:** 7z doesn't have a `-mmem` flag. Memory is controlled via dictionary size. Since user wants 1GB dictionary, we can't directly limit RAM per job. However, we can:\n- Use the RAM estimates to determine how many jobs can run concurrently\n- Keep dictionary at 1GB\n- The bin-packing ensures we don't exceed available RAM\n\n### 5. Update verbose logging\n**File:** `zip_sequences.py`\n\nShow:\n- Individual RAM estimates per sequence\n- Bin-packing results (which sequences in which bins)\n- Total RAM allocation\n\n## Files to Modify\n\n1. `zip_sequences.py`:\n - `estimate_ram_per_job()`: Update formula (lines 186-220)\n - `max_workers()`: Add bin-packing logic (lines 240-339)\n - `run_zip()`: Handle variable RAM limits (lines 656-750)\n - `process_zip()`: Accept individual RAM limit (line 644)\n - `zip_sequence()`: Keep dictionary at 1GB (lines 459-560)\n\n## Testing Considerations\n\n- Test with small sequences (<1GB)\n- Test with medium sequences (3-5GB) - should need ~12-13GB RAM each\n- Test with large sequences (25GB+) - should need ~14GB RAM each\n- Test bin-packing with mixed sizes\n- Verify dictionary stays at 1GB for all jobs", + "name": "Impl", + "overview": "Replace the fixed 3GB per-job estimate with size-aware RAM estimation that accounts for dictionary overhead (~11x dictionary size), input buffers, and compression overhead. Implement bin-packing algorithm (largest-first) to determine optimal concurrent workers when Max7zInst is 0." +} +``` +Additional data: + +```json +{ + "status": "accepted", + "reviewData": { + "status": "Done", + "selectedOption": "approve", + "isShowingInput": false + } +} +``` +Result: + +```json +{ + "accepted": {} +} +``` +Status: **completed** + + +
+
+ +--- + +_**User (2025-11-12 07:20Z)**_ + +Implement the plan as specified, it is attached for your reference. Do NOT edit the plan file itself. + +To-do's from the plan have already been created. Do not create them again. Mark them as in_progress as you work, starting with the first one. Don't stop until you have completed all the to-dos. + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +Reviewing the current code structure, then implementing the changes step by step. + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +Implementing the changes step by step: + + +--- + + +
Tool use: **todo_write** • Todo List + +- [-] undefined +- [ ] undefined +- [ ] undefined +- [ ] undefined +- [ ] undefined + +
+
+ +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 14, lines removed: 13 + +```diff +@@ -198,20 +198,21 @@ + + if ZIPPER_TYPE == "7z": +- # Base RAM: 500MB per job +- base_ram = 500 * 1024 * 1024 # 500 MB ++ # Fixed dictionary size: 1GB (1024MB) ++ FIXED_DICT_SIZE_MB = 1024 ++ FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024 + +- # Compression factor: 7z can use significant RAM, especially for large files +- # Use 0.15x factor (conservative estimate accounting for 7z's 80% usage) +- compression_factor = 0.15 ++ # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations) ++ # This is the main memory consumer for 7z LZMA compression ++ dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary + +- # For very large folders (>10GB), cap at 8GB per job +- max_ram_per_job = 8 * 1024 * 1024 * 1024 # 8 GB +- large_folder_threshold = 10 * 1024 * 1024 * 1024 # 10 GB ++ # Input buffer: 7z processes in chunks, doesn't need full file in RAM ++ # Use 15% of sequence size, capped at 2GB ++ input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024) + +- if total_bytes > large_folder_threshold: +- estimated_ram = max_ram_per_job +- else: +- estimated_ram = max(base_ram, int(total_bytes * compression_factor)) +- estimated_ram = min(estimated_ram, max_ram_per_job) ++ # Compression overhead: additional memory for compression process ++ overhead = 1 * 1024 * 1024 * 1024 # 1GB ++ ++ # Total RAM estimate ++ estimated_ram = dict_ram + input_buffer + overhead + + return estimated_ram +``` + +
+ +
+ +--- + + + +--- + + +Implementing the bin-packing algorithm in `max_workers()`: + + +--- + + +
Tool use: **todo_write** • Todo List + +- [x] undefined +- [-] undefined +- [ ] undefined +- [ ] undefined +- [ ] undefined + +
+
+ +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 68, lines removed: 16 + +```diff +@@ -286,40 +286,92 @@ + + # Auto-calculate based on RAM if Max7zInst not configured +- # "Balls-to-the-walls" mode: use maximum resources ++ # Use bin-packing algorithm with size-aware RAM estimation + if available_ram is not None: +- # 7z uses ~2-3x dictionary size in RAM, use 3x for aggressive mode +- # This is more realistic and allows more concurrent workers +- FIXED_RAM_PER_JOB = FIXED_DICT_SIZE_MB * 3 * 1024 * 1024 # 3GB per job +- + # available_ram is already 80% of total (20% reserved for system) +- # Use 95% of available RAM for compression jobs (aggressive mode) ++ # Use 95% of available RAM for compression jobs + compression_ram = int(available_ram * 0.95) + +- # Calculate worker limit based on fixed per-job RAM +- ram_limit = max(1, compression_ram // FIXED_RAM_PER_JOB) ++ # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item) ++ work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = [] ++ ram_limits_dict: dict[Path, int] = {} ++ ++ for seq_dir, zip_path, state_path, seq_state in work_items: ++ try: ++ estimated_ram = estimate_ram_per_job(seq_dir, seq_state) ++ work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state))) ++ ram_limits_dict[seq_dir] = estimated_ram ++ except Exception: ++ # If estimation fails, use a safe default (12GB minimum for 1GB dict) ++ default_ram = 12 * 1024 * 1024 * 1024 # 12GB ++ work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state))) ++ ram_limits_dict[seq_dir] = default_ram ++ ++ # Sort by estimated RAM (largest first) for bin-packing ++ work_items_with_ram.sort(key=lambda x: x[1], reverse=True) ++ ++ # Bin-packing algorithm: pack largest items first ++ bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = [] ++ bin_remaining: list[int] = [] ++ ++ for seq_dir, estimated_ram, work_item in work_items_with_ram: ++ # Try to fit in existing bin ++ placed = False ++ for i, remaining in enumerate(bin_remaining): ++ if remaining >= estimated_ram: ++ bins[i].append((seq_dir, estimated_ram, work_item)) ++ bin_remaining[i] -= estimated_ram ++ placed = True ++ break ++ ++ # If doesn't fit, create new bin ++ if not placed: ++ bins.append([(seq_dir, estimated_ram, work_item)]) ++ bin_remaining.append(compression_ram - estimated_ram) ++ ++ # Worker count is number of bins ++ worker_count = len(bins) + + # Cap at number of actual work items (can't have more workers than jobs) + num_work_items = len(work_items) if work_items else 0 + if num_work_items > 0: +- ram_limit = min(ram_limit, num_work_items) ++ worker_count = min(worker_count, num_work_items) + +- # Use RAM limit directly (no CPU limit) +- final_limit = ram_limit ++ # Respect user's --jobs if provided + if requested and requested > 0: +- final_limit = min(final_limit, requested) ++ worker_count = min(worker_count, requested) + + if verbose: + ram_gb = available_ram / (1024 ** 3) + compression_ram_gb = compression_ram / (1024 ** 3) +- ram_per_job_gb = FIXED_RAM_PER_JOB / (1024 ** 3) ++ total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3) + log( + "zip", +- f"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%), {ram_per_job_gb:.1f}GB per job (dict: {FIXED_DICT_SIZE_MB}MB) → " +- f"RAM limit: {ram_limit}, work items: {num_work_items}, requested: {requested}, final: {final_limit}", ++ f"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)", ++ verbose_only=True, ++ verbose=verbose ++ ) ++ log( ++ "zip", ++ f"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences", ++ verbose_only=True, ++ verbose=verbose ++ ) ++ if len(bins) > 0: ++ bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins] ++ log( ++ "zip", ++ f"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}", ++ verbose_only=True, ++ verbose=verbose ++ ) ++ log( ++ "zip", ++ f"Final worker count: {worker_count} (requested: {requested})", + verbose_only=True, + verbose=verbose + ) + +- return (final_limit, fixed_dict_size_bytes) ++ # Return worker count and RAM limits dict ++ return (worker_count, ram_limits_dict) + + # RAM detection failed, use a safe default (no CPU limit) +``` + +
+ +
+ +--- + + + +--- + + +Updating the other return paths in `max_workers()` to return a dict, and updating `run_zip()` to handle the new return type: + + +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 6, lines removed: undefined + +```diff +@@ -274,4 +274,10 @@ + final_limit = min(final_limit, requested) + ++ # Create RAM limits dict (all use fixed dict size, but return as dict for consistency) ++ ram_limits_dict: dict[Path, int] = {} ++ if work_items: ++ for seq_dir, _, _, _ in work_items: ++ ram_limits_dict[seq_dir] = fixed_dict_size_bytes ++ + if verbose: + log( +``` + +**Chunk 2** +Lines added: 1, lines removed: 1 + +```diff +@@ -283,5 +289,5 @@ + ) + +- return (final_limit, fixed_dict_size_bytes) ++ return (final_limit, ram_limits_dict) + + # Auto-calculate based on RAM if Max7zInst not configured +``` + +
+ +
+ +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 8, lines removed: undefined + +```diff +@@ -388,4 +388,12 @@ + if requested and requested > 0: + default_limit = min(default_limit, requested) ++ ++ # Create RAM limits dict with safe defaults (12GB per job for 1GB dict) ++ ram_limits_dict: dict[Path, int] = {} ++ if work_items: ++ default_ram = 12 * 1024 * 1024 * 1024 # 12GB default ++ for seq_dir, _, _, _ in work_items: ++ ram_limits_dict[seq_dir] = default_ram ++ + if verbose: + log( +``` + +**Chunk 2** +Lines added: 1, lines removed: 1 + +```diff +@@ -396,5 +404,5 @@ + verbose=verbose + ) +- return (default_limit, fixed_dict_size_bytes) ++ return (default_limit, ram_limits_dict) + + # For zip compression, use existing estimation-based approach +``` + +
+ +
+ +--- + + +
Tool use: **todo_write** • Todo List + +- [x] undefined +- [x] undefined +- [-] undefined +- [ ] undefined +- [ ] undefined + +
+
+ +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 1, lines removed: 1 + +```diff +@@ -797,5 +797,5 @@ + + # Calculate RAM-aware worker count based on work items +- worker_count, per_job_memory_limit = max_workers(requested_workers, work_items, verbose=verbose) ++ worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose) + + updated_paths: list[Path] = [] +``` + +**Chunk 2** +Lines added: 1, lines removed: 1 + +```diff +@@ -806,5 +806,5 @@ + with ThreadPoolExecutor(max_workers=worker_count) as executor: + future_map = { +- executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, per_job_memory_limit, verbose=verbose): seq_dir ++ executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir + for seq_dir, zip_path, state_path, seq_state in work_items + } +``` + +
+ +
+ +--- + + + +--- + + +Updating `zip_sequence()` to keep the dictionary at 1GB fixed, regardless of the RAM limit parameter: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
Tool use: **todo_write** • Todo List + +- [x] undefined +- [x] undefined +- [x] undefined +- [-] undefined +- [ ] undefined + +
+
+ +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 5, lines removed: 5 + +```diff +@@ -584,9 +584,9 @@ + ] + +- # Add fixed dictionary size if specified (7z memory usage is controlled by dictionary size) +- if per_job_memory_limit is not None: +- # per_job_memory_limit is actually the fixed dictionary size in bytes +- dict_size_mb = per_job_memory_limit // (1024 * 1024) +- cmd.append(f"-md={dict_size_mb}m") ++ # Always use fixed dictionary size: 1GB (1024MB) ++ # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only) ++ # We keep dictionary at 1GB for best compression regardless of RAM estimate ++ FIXED_DICT_SIZE_MB = 1024 ++ cmd.append(f"-md={FIXED_DICT_SIZE_MB}m") + + cmd.extend([ +``` + +
+ +
+ +--- + + +
Tool use: **todo_write** • Todo List + +- [x] undefined +- [x] undefined +- [x] undefined +- [x] undefined +- [x] undefined + +
+
+ +--- + + + +--- + + +Checking the zip compression path in `max_workers()` and updating it to return a dict: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +Updating the zip compression path to return a dict: + + +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 6, lines removed: 2 + +```diff +@@ -409,14 +409,18 @@ + # Estimate RAM per job for each work item + ram_estimates = [] ++ ram_limits_dict: dict[Path, int] = {} + for seq_dir, zip_path, state_path, seq_state in work_items: + try: + estimated_ram = estimate_ram_per_job(seq_dir, seq_state) + ram_estimates.append(estimated_ram) ++ ram_limits_dict[seq_dir] = estimated_ram + except Exception: + # If estimation fails, use fallback estimate +- ram_estimates.append(1024 * 1024 * 1024) # 1GB fallback for zip ++ fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip ++ ram_estimates.append(fallback_ram) ++ ram_limits_dict[seq_dir] = fallback_ram + + if not ram_estimates: +- return (cpu_limit, None) ++ return (cpu_limit, {}) + + max_ram_per_job = max(ram_estimates) +``` + +**Chunk 2** +Lines added: 1, lines removed: 1 + +```diff +@@ -436,5 +440,5 @@ + ) + +- return (final_limit, None) ++ return (final_limit, ram_limits_dict) + + +``` + +
+ +
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + +Model supplied an ambiguous edit + +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 1, lines removed: 1 + +```diff +@@ -256,5 +256,5 @@ + if verbose: + log("zip", "RAM detection failed, using CPU-based worker limit", verbose_only=True, verbose=verbose) +- return (cpu_limit, None) ++ return (cpu_limit, {}) + + # For 7z: use fixed dictionary size and calculate workers +``` + +
+ +
+ +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + +--- + + +Fixing the remaining return statement: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 1, lines removed: 1 + +```diff +@@ -247,5 +247,5 @@ + # If no work items provided, return CPU-based limit + if work_items is None or len(work_items) == 0: +- return (cpu_limit, None) ++ return (cpu_limit, {}) + + # Try to calculate RAM-based limit +``` + +
+ +
+ +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + +--- + + +Checking the expand mode path in `main()`: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
+Tool use: **grep** • Grep for "max_workers.*expand" in "zip_sequences.py" • 0 matches + +Output mode: content + + +_No matches found_ + +
+
+ +--- + + +
+Tool use: **grep** • Grep for "if args.mode == "expand"" in "zip_sequences.py" • 1 match + +Output mode: content + + +| File | Content | Line | +|------|------|------| +| `zip_sequences.py` | `if args.mode == "expand":` | L926 | + + +
+
+ +--- + + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +The expand mode already handles the dict return. Verifying the implementation is complete: + + +--- + + +
+Tool use: **grep** • Grep for "max_workers\(" in "zip_sequences.py" • 3 matches + +Output mode: content + + +| File | Content | Line | +|------|------|------| +| `zip_sequences.py` | `def max_workers(` | L225 | +| `zip_sequences.py` | `worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)` | L803 | +| `zip_sequences.py` | `workers, _ = max_workers(args.jobs, work_items=None, verbose=args.verbose)` | L928 | + + +
+
+ +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + +--- + + +Fixing a syntax error: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + +
+Tool use: **grep** • Grep for "worker_count, ram_limits_dict" in "zip_sequences.py" • 2 matches + +Output mode: content + + +| File | Content | Line | +|------|------|------| +| `zip_sequences.py` | `return (worker_count, ram_limits_dict)` | L381 | +| `zip_sequences.py` | `worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)` | L803 | + + +
+
+ +--- + + + +--- + + +The code looks correct. Summary of changes: + +## Summary + +Implemented size-aware RAM estimation and bin-packing for 7z workers. + +### 1. Fixed `estimate_ram_per_job()` function +- Updated RAM estimation for 7z: + - Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM) + - Input buffer: `min(sequence_size * 0.15, 2GB)` + - Overhead: 1GB + - Formula: `11GB + min(seq_size * 0.15, 2GB) + 1GB` + +### 2. Implemented bin-packing algorithm in `max_workers()` +- When `Max7zInst` is 0 (auto-calculate): + - Estimates RAM for each work item using `estimate_ram_per_job()` + - Sorts by estimated RAM (largest first) + - Uses bin-packing to determine concurrent workers + - Returns `(worker_count, ram_limits_dict)` where the dict maps `seq_dir` → estimated RAM + +### 3. Updated `run_zip()` to handle variable RAM per job +- Now receives `ram_limits_dict` from `max_workers()` +- Passes individual RAM limits to each job via `ram_limits_dict.get(seq_dir)` + +### 4. Updated `zip_sequence()` to keep dictionary at 1GB +- Always uses 1GB dictionary (fixed) +- The `per_job_memory_limit` parameter is informational only +- Dictionary size is not affected by RAM estimates + +### 5. Updated all return paths +- All `max_workers()` return paths now return `(worker_count, ram_limits_dict)` +- Updated zip compression path, Max7zInst path, and error paths + +The implementation now: +- Estimates RAM based on actual sequence sizes +- Uses bin-packing (largest-first) to determine optimal concurrent workers +- Prevents RAM overflow by accounting for actual memory needs +- Keeps dictionary at 1GB for best compression + +This should prevent the "Can't allocate required memory!" error by accurately estimating RAM needs and limiting concurrent workers accordingly. + +--- + +_**User (2025-11-12 07:20Z)**_ + +We need to integrate a startup that prints more of its processes. I don't like waiting on a blank cmd window for 5 minutes + +--- + +_**Agent (model default, mode Agent)**_ + +
Thought Process +**Planning logging additions**
+ +--- + +To make the startup more transparent I’ll add detailed progress logging inside `zip_sequences.py` so you can see what it’s doing while the window is open. My plan: + +- Add user-facing “startup” log section that announces each major step (reading config, scanning sequences, computing states, etc.). +- Stream periodic progress as we iterate sequences—when state computation starts, when it’s skipped because already up-to-date, when it enqueues work. +- Ensure logs appear immediately by flushing print/stdout so the console never sits blank. +- Keep the verbosity concise but informative, so you know why it’s busy. + +No code changes yet—just summarizing approach. Let me know if you want extra details or logging elsewhere too. + +--- + +_**User (2025-11-12 07:20Z)**_ + +sounds great + +--- + +_**Agent (model default, mode Agent)**_ + +
Thought Process +**Considering implementation plan**
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + +
Thought Process +**Considering logging and planning steps**
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + +
Thought Process +**Planning detailed logging enhancements** + +I’m thinking about adding startup and progress logs to track config loading, argument parsing, and sequence scanning steps. I want to log at key points like after loading config and during sequence iteration with counts every 10 items, making sure logs flush immediately for timely output without being too noisy. I’ll adjust the existing log function to print with flush and consider adding a log_progress helper or just reuse log with clear prefixes. The goal is clearer visibility into the program’s startup and main processing flow without drastically restructuring the code.
+ +--- + + +
+Tool use: **grep** • Grep for "CONFIG =" in "zip_sequences.py" • 2 matches + +Output mode: content + + +| File | Content | Line | +|------|------|------| +| `zip_sequences.py` | `DEFAULT_CONFIG = \{` | L53 | +| `zip_sequences.py` | `CONFIG = load_config()` | L92 | + + +
+
+ +--- + +
Thought Process +**Repositioning log function and adding startup logs**
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + +
Thought Process +**Planning log function relocation**
+ +--- + + +
+Tool use: **grep** • Grep for "def log" in "zip_sequences.py" • 1 match + +Output mode: content + + +| File | Content | Line | +|------|------|------| +| `zip_sequences.py` | `def log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:` | L445 | + + +
+
+ +--- + +
Thought Process +**Planning code insertion and deletion**
+ +--- + + +
+Tool use: **apply_patch** + + +Parameters: + +```json +{ + "relativeWorkspacePath": "zip_sequences.py" +} +``` +Additional data: + +```json +{ + "codeblockId": "3dc966ec-c9bc-4a5a-8879-956d2e9c1b38" +} +``` +Result: + +```json +{ + "diff": { + "chunks": [ + { + "diffString": " }\r\n \r\n+ \r\n+ def log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n+ if verbose_only and not verbose:\r\n+ return\r\n+ print(f\"[{mode}] {message}\", flush=True)\r\n+ \r\n \r\n def load_config() -> dict:\r", + "oldStart": 58, + "newStart": 58, + "oldLines": 4, + "newLines": 10, + "linesAdded": 6 + } + ], + "editor": "EDITOR_AI" + }, + "shouldAutoFixLints": true, + "resultForModel": "Success. Updated the following files:\nM zip_sequences.py", + "contentsAfterEdit": "#!/usr/bin/env python3\r\n\"\"\"Maintain zipped render sequences for Git hooks.\r\n\r\nDefault mode scans `Renders/`, produces ZIP archives under `Renders/_zipped/`,\r\nand stages any updated archives so commits only track compact files. Switch to\r\n`--mode expand` to inflate the tracked archives back into the ignored working\r\ndirectories after checkouts or pulls.\r\n\"\"\"\r\n\r\nfrom __future__ import annotations\r\n\r\nimport argparse\r\nimport json\r\nimport os\r\nimport platform\r\nimport shutil\r\nimport subprocess\r\nimport sys\r\nimport tempfile\r\nimport time\r\nfrom concurrent.futures import ThreadPoolExecutor, as_completed\r\nfrom pathlib import Path\r\nfrom typing import Iterator, Sequence\r\n\r\n# Try to import psutil for cross-platform RAM detection\r\ntry:\r\n import psutil\r\n HAS_PSUTIL = True\r\nexcept ImportError:\r\n HAS_PSUTIL = False\r\n # For Windows fallback\r\n if platform.system() == \"Windows\":\r\n try:\r\n import ctypes\r\n HAS_CTYPES = True\r\n except ImportError:\r\n HAS_CTYPES = False\r\n else:\r\n HAS_CTYPES = False\r\n\r\n\r\nRENDER_ROOT = Path(\"Renders\")\r\nARCHIVE_ROOT = RENDER_ROOT / \"_zipped\"\r\nSEQUENCE_EXTENSIONS = {\r\n \".png\",\r\n \".jpg\",\r\n \".jpeg\",\r\n \".tif\",\r\n \".tiff\",\r\n \".exr\",\r\n}\r\nSTATE_SUFFIX = \".meta.json\"\r\nDEFAULT_CONFIG = {\r\n \"zipper\": \"7z\",\r\n \"compression\": 9,\r\n \"dailyFormat\": \"daily_YYMMDD\",\r\n \"Max7zInst\": 0, # Maximum concurrent 7z instances (0 = auto-calculate)\r\n}\r\n\r\n\r\ndef log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n if verbose_only and not verbose:\r\n return\r\n print(f\"[{mode}] {message}\", flush=True)\r\n\r\n\r\ndef load_config() -> dict:\r\n # First try to load from project's .config folder (current working directory)\r\n # Then fall back to ProjectStructure repo config (next to zip_sequences.py)\r\n cwd = Path.cwd()\r\n project_config = cwd / \".config\" / \"config.json\"\r\n repo_config = Path(__file__).resolve().with_name(\"config.json\")\r\n \r\n config_paths = [\r\n (\"project\", project_config),\r\n (\"repo\", repo_config),\r\n ]\r\n \r\n for source, config_path in config_paths:\r\n try:\r\n if config_path.exists():\r\n text = config_path.read_text(encoding=\"utf-8\")\r\n try:\r\n data = json.loads(text)\r\n if isinstance(data, dict):\r\n merged = DEFAULT_CONFIG.copy()\r\n merged.update(data)\r\n return merged\r\n except json.JSONDecodeError:\r\n continue\r\n except OSError:\r\n continue\r\n \r\n # If no config found, return defaults\r\n return DEFAULT_CONFIG.copy()\r\n\r\n\r\nCONFIG = load_config()\r\nzipper_val = CONFIG.get(\"zipper\", \"7z\")\r\n# Handle both old boolean format and new string format\r\nif isinstance(zipper_val, bool):\r\n ZIPPER_TYPE = \"7z\" if zipper_val else \"zip\"\r\nelse:\r\n ZIPPER_TYPE = str(zipper_val).lower()\r\n\r\nCOMPRESSION_LEVEL = CONFIG.get(\"compression\", 9)\r\nif isinstance(COMPRESSION_LEVEL, str):\r\n try:\r\n COMPRESSION_LEVEL = int(COMPRESSION_LEVEL)\r\n except ValueError:\r\n COMPRESSION_LEVEL = 9\r\nif not isinstance(COMPRESSION_LEVEL, int):\r\n COMPRESSION_LEVEL = 9\r\nCOMPRESSION_LEVEL = max(0, min(9, COMPRESSION_LEVEL))\r\n\r\nMAX_7Z_INSTANCES = CONFIG.get(\"Max7zInst\", 0)\r\nif MAX_7Z_INSTANCES is not None:\r\n if isinstance(MAX_7Z_INSTANCES, str):\r\n try:\r\n MAX_7Z_INSTANCES = int(MAX_7Z_INSTANCES)\r\n except ValueError:\r\n MAX_7Z_INSTANCES = 0\r\n if not isinstance(MAX_7Z_INSTANCES, int) or MAX_7Z_INSTANCES < 1:\r\n MAX_7Z_INSTANCES = 0\r\n# Treat 0 as None (auto-calculate)\r\nif MAX_7Z_INSTANCES == 0:\r\n MAX_7Z_INSTANCES = None\r\n\r\nSEVEN_Z_EXE: str | None = None\r\nif ZIPPER_TYPE == \"7z\":\r\n SEVEN_Z_EXE = shutil.which(\"7z\") or shutil.which(\"7za\")\r\n\r\n\r\ndef parse_args() -> argparse.Namespace:\r\n parser = argparse.ArgumentParser(description=\"Sync render sequences with zipped archives.\")\r\n parser.add_argument(\r\n \"--mode\",\r\n choices=(\"zip\", \"expand\"),\r\n default=\"zip\",\r\n help=\"zip sequences for commit (default) or expand tracked archives\",\r\n )\r\n parser.add_argument(\"--jobs\", type=int, help=\"max parallel workers\")\r\n parser.add_argument(\"--verbose\", action=\"store_true\", help=\"print extra progress details\")\r\n return parser.parse_args()\r\n\r\n\r\ndef get_available_ram() -> int | None:\r\n \"\"\"Get available RAM in bytes, reserving 20% for system.\r\n \r\n Returns:\r\n Available RAM in bytes, or None if detection fails.\r\n \"\"\"\r\n try:\r\n if HAS_PSUTIL:\r\n # Use psutil for cross-platform RAM detection\r\n mem = psutil.virtual_memory()\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem.total * 0.8)\r\n return available\r\n elif HAS_CTYPES and platform.system() == \"Windows\":\r\n # Windows fallback using ctypes\r\n class MEMORYSTATUSEX(ctypes.Structure):\r\n _fields_ = [\r\n (\"dwLength\", ctypes.c_ulong),\r\n (\"dwMemoryLoad\", ctypes.c_ulong),\r\n (\"ullTotalPhys\", ctypes.c_ulonglong),\r\n (\"ullAvailPhys\", ctypes.c_ulonglong),\r\n (\"ullTotalPageFile\", ctypes.c_ulonglong),\r\n (\"ullAvailPageFile\", ctypes.c_ulonglong),\r\n (\"ullTotalVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailExtendedVirtual\", ctypes.c_ulonglong),\r\n ]\r\n \r\n kernel32 = ctypes.windll.kernel32\r\n kernel32.GlobalMemoryStatusEx.argtypes = [ctypes.POINTER(MEMORYSTATUSEX)]\r\n kernel32.GlobalMemoryStatusEx.restype = ctypes.c_bool\r\n \r\n mem_status = MEMORYSTATUSEX()\r\n mem_status.dwLength = ctypes.sizeof(MEMORYSTATUSEX)\r\n \r\n if kernel32.GlobalMemoryStatusEx(ctypes.byref(mem_status)):\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem_status.ullTotalPhys * 0.8)\r\n return available\r\n except Exception:\r\n pass\r\n \r\n return None\r\n\r\n\r\ndef estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int:\r\n \"\"\"Estimate RAM usage per compression job based on folder size.\r\n \r\n Args:\r\n seq_dir: Path to the sequence directory\r\n seq_state: State dictionary containing file information\r\n \r\n Returns:\r\n Estimated RAM usage in bytes\r\n \"\"\"\r\n # Calculate total folder size from seq_state\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n \r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations)\r\n # This is the main memory consumer for 7z LZMA compression\r\n dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary\r\n \r\n # Input buffer: 7z processes in chunks, doesn't need full file in RAM\r\n # Use 15% of sequence size, capped at 2GB\r\n input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024)\r\n \r\n # Compression overhead: additional memory for compression process\r\n overhead = 1 * 1024 * 1024 * 1024 # 1GB\r\n \r\n # Total RAM estimate\r\n estimated_ram = dict_ram + input_buffer + overhead\r\n \r\n return estimated_ram\r\n else:\r\n # zip compression is more memory-efficient\r\n # Conservative estimate: 1GB per job\r\n return 1024 * 1024 * 1024 # 1 GB\r\n\r\n\r\ndef max_workers(\r\n requested: int | None,\r\n work_items: list[tuple[Path, Path, Path, dict]] | None = None,\r\n *,\r\n verbose: bool = False\r\n) -> tuple[int, int | None]:\r\n \"\"\"Calculate maximum worker count based on CPU and RAM constraints.\r\n \r\n Args:\r\n requested: User-requested worker count (from --jobs)\r\n work_items: List of work items (seq_dir, zip_path, state_path, seq_state)\r\n verbose: Whether to log RAM-based calculations\r\n \r\n Returns:\r\n Tuple of (worker_count, per_job_memory_limit_bytes)\r\n per_job_memory_limit_bytes is None if not using 7z or RAM detection failed\r\n \"\"\"\r\n cpu = os.cpu_count() or 1\r\n cpu_limit = max(1, min(8, cpu))\r\n if requested and requested > 0:\r\n cpu_limit = min(requested, max(1, cpu))\r\n \r\n # If no work items provided, return CPU-based limit\r\n if work_items is None or len(work_items) == 0:\r\n return (cpu_limit, {})\r\n \r\n # Try to calculate RAM-based limit\r\n available_ram = get_available_ram()\r\n \r\n if available_ram is None:\r\n # RAM detection failed, fall back to CPU limit\r\n if verbose:\r\n log(\"zip\", \"RAM detection failed, using CPU-based worker limit\", verbose_only=True, verbose=verbose)\r\n return (cpu_limit, {})\r\n \r\n # For 7z: use fixed dictionary size and calculate workers\r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n fixed_dict_size_bytes = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Check if Max7zInst is configured\r\n if MAX_7Z_INSTANCES is not None:\r\n # Use configured maximum instances, but still respect user's --jobs and work items\r\n final_limit = MAX_7Z_INSTANCES\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n final_limit = min(final_limit, num_work_items)\r\n if requested and requested > 0:\r\n final_limit = min(final_limit, requested)\r\n \r\n # Create RAM limits dict (all use fixed dict size, but return as dict for consistency)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = fixed_dict_size_bytes\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"Using Max7zInst={MAX_7Z_INSTANCES} from config → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n \r\n # Auto-calculate based on RAM if Max7zInst not configured\r\n # Use bin-packing algorithm with size-aware RAM estimation\r\n if available_ram is not None:\r\n # available_ram is already 80% of total (20% reserved for system)\r\n # Use 95% of available RAM for compression jobs\r\n compression_ram = int(available_ram * 0.95)\r\n \r\n # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item)\r\n work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n \r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use a safe default (12GB minimum for 1GB dict)\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB\r\n work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n # Sort by estimated RAM (largest first) for bin-packing\r\n work_items_with_ram.sort(key=lambda x: x[1], reverse=True)\r\n \r\n # Bin-packing algorithm: pack largest items first\r\n bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = []\r\n bin_remaining: list[int] = []\r\n \r\n for seq_dir, estimated_ram, work_item in work_items_with_ram:\r\n # Try to fit in existing bin\r\n placed = False\r\n for i, remaining in enumerate(bin_remaining):\r\n if remaining >= estimated_ram:\r\n bins[i].append((seq_dir, estimated_ram, work_item))\r\n bin_remaining[i] -= estimated_ram\r\n placed = True\r\n break\r\n \r\n # If doesn't fit, create new bin\r\n if not placed:\r\n bins.append([(seq_dir, estimated_ram, work_item)])\r\n bin_remaining.append(compression_ram - estimated_ram)\r\n \r\n # Worker count is number of bins\r\n worker_count = len(bins)\r\n \r\n # Cap at number of actual work items (can't have more workers than jobs)\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n worker_count = min(worker_count, num_work_items)\r\n \r\n # Respect user's --jobs if provided\r\n if requested and requested > 0:\r\n worker_count = min(worker_count, requested)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n compression_ram_gb = compression_ram / (1024 ** 3)\r\n total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n if len(bins) > 0:\r\n bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins]\r\n log(\r\n \"zip\",\r\n f\"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Final worker count: {worker_count} (requested: {requested})\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n # Return worker count and RAM limits dict\r\n return (worker_count, ram_limits_dict)\r\n \r\n # RAM detection failed, use a safe default (no CPU limit)\r\n default_limit = 4\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n default_limit = min(default_limit, num_work_items)\r\n if requested and requested > 0:\r\n default_limit = min(default_limit, requested)\r\n \r\n # Create RAM limits dict with safe defaults (12GB per job for 1GB dict)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB default\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"RAM detection failed and Max7zInst not set, using default worker limit → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {default_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n return (default_limit, ram_limits_dict)\r\n \r\n # For zip compression, use existing estimation-based approach\r\n # Estimate RAM per job for each work item\r\n ram_estimates = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n ram_estimates.append(estimated_ram)\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use fallback estimate\r\n fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip\r\n ram_estimates.append(fallback_ram)\r\n ram_limits_dict[seq_dir] = fallback_ram\r\n \r\n if not ram_estimates:\r\n return (cpu_limit, {})\r\n \r\n max_ram_per_job = max(ram_estimates)\r\n ram_limit = max(1, available_ram // max_ram_per_job)\r\n ram_limit = min(ram_limit, 6) # Conservative limit for zip\r\n final_limit = min(cpu_limit, ram_limit)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n max_ram_gb = max_ram_per_job / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available, ~{max_ram_gb:.1f}GB per job → \"\r\n f\"RAM limit: {ram_limit}, CPU limit: {cpu_limit}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n\r\n\r\ndef log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n if verbose_only and not verbose:\r\n return\r\n print(f\"[{mode}] {message}\")\r\n\r\n\r\ndef is_archive_path(path: Path) -> bool:\r\n return any(part in (\"_archive\", \"_CURRENT\") for part in path.parts)\r\n\r\n\r\ndef find_sequence_dirs(root: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(root):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n has_frames = any(Path(dirpath, f).suffix.lower() in SEQUENCE_EXTENSIONS for f in filenames)\r\n if has_frames:\r\n yield path\r\n\r\n\r\ndef iter_sequence_files(seq_dir: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(seq_dir):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n for filename in filenames:\r\n yield path / filename\r\n\r\n\r\ndef compute_state(seq_dir: Path) -> dict:\r\n entries = []\r\n files = sorted(\r\n iter_sequence_files(seq_dir),\r\n key=lambda p: p.relative_to(seq_dir).as_posix(),\r\n )\r\n for file_path in files:\r\n stat = file_path.stat()\r\n entries.append(\r\n {\r\n \"path\": file_path.relative_to(seq_dir).as_posix(),\r\n \"size\": stat.st_size,\r\n \"mtime_ns\": stat.st_mtime_ns,\r\n }\r\n )\r\n return {\"files\": entries}\r\n\r\n\r\ndef current_state(seq_dir: Path) -> dict:\r\n if not seq_dir.exists() or not seq_dir.is_dir():\r\n return {\"files\": []}\r\n return compute_state(seq_dir)\r\n\r\n\r\ndef load_state(state_path: Path) -> dict | None:\r\n if not state_path.exists():\r\n return None\r\n try:\r\n return json.loads(state_path.read_text())\r\n except json.JSONDecodeError:\r\n return None\r\n\r\n\r\ndef state_changed(seq_state: dict, stored_state: dict | None) -> bool:\r\n if stored_state is None:\r\n return True\r\n return seq_state != stored_state\r\n\r\n\r\ndef archive_path_for(seq_dir: Path) -> Path:\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n suffix = \".7z\" if ZIPPER_TYPE == \"7z\" else \".zip\"\r\n return (ARCHIVE_ROOT / rel).with_suffix(suffix)\r\n\r\n\r\ndef sequence_dir_for(zip_path: Path) -> Path:\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n return (RENDER_ROOT / rel).with_suffix(\"\")\r\n\r\n\r\ndef state_path_for(zip_path: Path) -> Path:\r\n return zip_path.with_suffix(zip_path.suffix + STATE_SUFFIX)\r\n\r\n\r\ndef zip_sequence(seq_dir: Path, zip_path: Path, per_job_memory_limit: int | None = None) -> None:\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z compression requested but 7z executable not found in PATH. \"\r\n \"Please install 7z (e.g., via Chocolatey: choco install 7zip) \"\r\n \"or set zipper to 'zip' in config.json\"\r\n )\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n \r\n # If creating a .7z file, remove any existing .zip file for the same sequence\r\n if zip_path.suffix == \".7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n \r\n # Build list of files to archive with relative paths\r\n file_list = []\r\n for file_path in iter_sequence_files(seq_dir):\r\n rel_path = file_path.relative_to(seq_dir).as_posix()\r\n file_list.append(rel_path)\r\n \r\n if not file_list:\r\n raise RuntimeError(f\"No files found to archive in {seq_dir}\")\r\n \r\n # Create zip in temporary location first to avoid issues with corrupted existing files\r\n temp_zip = None\r\n list_file_path = None\r\n try:\r\n # Create temporary archive file path (but don't create the file - let 7z create it)\r\n temp_zip_path = tempfile.mktemp(suffix=\".7z\", dir=zip_path.parent)\r\n temp_zip = Path(temp_zip_path)\r\n \r\n # Create list file with absolute path\r\n fd, temp_path = tempfile.mkstemp(suffix=\".lst\", text=True)\r\n list_file_path = Path(temp_path)\r\n with os.fdopen(fd, \"w\", encoding=\"utf-8\") as list_file:\r\n for rel_path in file_list:\r\n list_file.write(rel_path + \"\\n\")\r\n list_file.flush()\r\n os.fsync(list_file.fileno()) # Ensure data is written to disk\r\n # File is closed here by context manager, small delay to ensure OS releases handle\r\n time.sleep(0.1)\r\n \r\n # Use absolute paths for both list file and temp zip\r\n list_file_abs = list_file_path.resolve()\r\n temp_zip_abs = temp_zip.resolve()\r\n # Create archive in temp location first (7z will create it fresh)\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"a\",\r\n \"-y\",\r\n \"-bb0\", # Suppress progress output\r\n f\"-mx={COMPRESSION_LEVEL}\",\r\n \"-t7z\", # Use 7z format, not zip\r\n ]\r\n \r\n # Always use fixed dictionary size: 1GB (1024MB)\r\n # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only)\r\n # We keep dictionary at 1GB for best compression regardless of RAM estimate\r\n FIXED_DICT_SIZE_MB = 1024\r\n cmd.append(f\"-md={FIXED_DICT_SIZE_MB}m\")\r\n \r\n cmd.extend([\r\n str(temp_zip_abs),\r\n f\"@{list_file_abs}\",\r\n ])\r\n result = subprocess.run(\r\n cmd,\r\n cwd=seq_dir,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z compression failed: {error_msg}\")\r\n \r\n # Move temp zip to final location, replacing any existing file\r\n if zip_path.exists():\r\n zip_path.unlink()\r\n temp_zip.replace(zip_path)\r\n temp_zip = None # Mark as moved so we don't delete it\r\n finally:\r\n # Clean up temp zip if it wasn't moved\r\n if temp_zip and temp_zip.exists():\r\n try:\r\n temp_zip.unlink(missing_ok=True)\r\n except OSError:\r\n pass\r\n # Clean up list file, with retry in case 7z still has it open\r\n if list_file_path and list_file_path.exists():\r\n for attempt in range(3):\r\n try:\r\n list_file_path.unlink(missing_ok=True)\r\n break\r\n except PermissionError:\r\n if attempt < 2:\r\n time.sleep(0.1) # Wait 100ms before retry\r\n else:\r\n # Last attempt failed, just log and continue\r\n # The temp file will be cleaned up by the OS eventually\r\n pass\r\n return\r\n\r\n # Use zipfile (only if ZIPPER_TYPE == \"zip\")\r\n if ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZIP_DEFLATED, ZIP_STORED, ZipFile\r\n\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n if COMPRESSION_LEVEL <= 0:\r\n compression = ZIP_STORED\r\n zip_kwargs = {}\r\n else:\r\n compression = ZIP_DEFLATED\r\n zip_kwargs = {\"compresslevel\": COMPRESSION_LEVEL}\r\n\r\n with ZipFile(zip_path, \"w\", compression=compression, **zip_kwargs) as archive:\r\n for file_path in iter_sequence_files(seq_dir):\r\n archive.write(file_path, arcname=file_path.relative_to(seq_dir).as_posix())\r\n return\r\n\r\n # Unknown ZIPPER_TYPE - fail with clear error\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n\r\ndef expand_sequence(zip_path: Path, seq_state: dict) -> None:\r\n target_dir = sequence_dir_for(zip_path)\r\n if target_dir.exists():\r\n shutil.rmtree(target_dir)\r\n target_dir.mkdir(parents=True, exist_ok=True)\r\n\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z extraction requested but 7z executable not found in PATH. \"\r\n \"Please install 7z or set zipper to 'zip' in config.json\"\r\n )\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"x\",\r\n \"-y\",\r\n str(zip_path),\r\n f\"-o{target_dir}\",\r\n ]\r\n result = subprocess.run(\r\n cmd,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z extraction failed: {error_msg}\")\r\n elif ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZipFile\r\n\r\n with ZipFile(zip_path, \"r\") as archive:\r\n archive.extractall(target_dir)\r\n else:\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n for entry in seq_state.get(\"files\", []):\r\n file_path = target_dir / entry[\"path\"]\r\n if file_path.exists():\r\n os.utime(file_path, ns=(entry[\"mtime_ns\"], entry[\"mtime_ns\"]))\r\n\r\n\r\ndef process_zip(seq_dir: Path, zip_path: Path, state_path: Path, seq_state: dict, per_job_memory_limit: int | None, *, verbose: bool) -> Sequence[Path]:\r\n log(\"zip\", f\"{seq_dir} -> {zip_path}\", verbose_only=True, verbose=verbose)\r\n zip_sequence(seq_dir, zip_path, per_job_memory_limit)\r\n state_path.write_text(json.dumps(seq_state, indent=2))\r\n return (zip_path, state_path)\r\n\r\n\r\ndef process_expand(zip_path: Path, state: dict, *, verbose: bool) -> None:\r\n log(\"expand\", f\"{zip_path} -> {sequence_dir_for(zip_path)}\", verbose_only=True, verbose=verbose)\r\n expand_sequence(zip_path, state)\r\n\r\n\r\ndef run_zip(requested_workers: int | None, *, verbose: bool) -> int:\r\n work_items: list[tuple[Path, Path, Path, dict]] = []\r\n\r\n if RENDER_ROOT.exists():\r\n for seq_dir in find_sequence_dirs(RENDER_ROOT):\r\n # Get the target archive path (will be .7z if ZIPPER_TYPE is \"7z\")\r\n zip_path = archive_path_for(seq_dir)\r\n state_path = state_path_for(zip_path)\r\n \r\n # Quick check: if archive exists, load stored state first (fast)\r\n stored_state = load_state(state_path)\r\n \r\n # Check if we need to upgrade from .zip to .7z\r\n old_zip_path = None\r\n old_stored_state = None\r\n if ZIPPER_TYPE == \"7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_state_path = state_path_for(old_zip_path)\r\n old_stored_state = load_state(old_state_path)\r\n # If old .zip exists and .7z doesn't, use old .zip's state for comparison\r\n if not zip_path.exists() and old_stored_state is not None:\r\n stored_state = old_stored_state\r\n \r\n # If .7z archive exists and we have stored state, do quick check before computing full state\r\n if zip_path.exists() and stored_state is not None:\r\n # Quick check: if directory mtime is older than archive, likely unchanged\r\n try:\r\n dir_mtime = seq_dir.stat().st_mtime_ns\r\n archive_mtime = zip_path.stat().st_mtime_ns\r\n # If directory wasn't modified since archive was created, skip state computation\r\n if dir_mtime <= archive_mtime:\r\n # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete)\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n continue\r\n except OSError:\r\n # If stat fails, fall through to full state computation\r\n pass\r\n \r\n # Compute current state only if we need to\r\n seq_state = compute_state(seq_dir)\r\n if not seq_state[\"files\"]:\r\n continue\r\n \r\n # Check if state changed\r\n if stored_state is not None and not state_changed(seq_state, stored_state):\r\n # Metadata matches stored state\r\n if zip_path.exists():\r\n # .7z exists and is up to date, clean up old .zip if it exists\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n elif old_zip_path and old_zip_path.exists() and old_stored_state is not None:\r\n # .7z doesn't exist, but .zip exists and metadata matches\r\n # Keep the .zip file, don't create .7z\r\n continue\r\n else:\r\n # No archive exists, but state matches (shouldn't happen, but be safe)\r\n continue\r\n\r\n work_items.append((seq_dir, zip_path, state_path, seq_state))\r\n\r\n if not work_items:\r\n if not RENDER_ROOT.exists():\r\n log(\"zip\", \"Render root 'Renders' not found; nothing to zip.\")\r\n else:\r\n log(\"zip\", \"Archives already up to date; no sequences needed zipping.\")\r\n return 0\r\n\r\n # Calculate RAM-aware worker count based on work items\r\n worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)\r\n\r\n updated_paths: list[Path] = []\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir\r\n for seq_dir, zip_path, state_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n updated_paths.extend(future.result())\r\n completed += 1\r\n seq_dir = future_map[future]\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n log(\"zip\", f\"{completed}/{total} {rel}\")\r\n\r\n updated_count = len(updated_paths) // 2\r\n log(\"zip\", f\"Updated {updated_count} sequence archive(s).\", verbose=verbose)\r\n if updated_paths:\r\n log(\r\n \"zip\",\r\n \"Archives updated. Stage manually with `git add Renders/_zipped`, if desired.\",\r\n verbose_only=True,\r\n verbose=verbose,\r\n )\r\n\r\n removed = cleanup_orphan_archives(verbose=verbose)\r\n if removed:\r\n log(\"zip\", f\"Removed {removed} orphan archive(s).\", verbose=verbose)\r\n\r\n return updated_count\r\n\r\n\r\ndef run_expand(worker_count: int, *, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n log(\"expand\", \"No archives to expand (missing 'Renders/_zipped').\")\r\n return 0\r\n\r\n work_items: list[tuple[Path, dict]] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n state_path = state_path_for(zip_path)\r\n seq_state = load_state(state_path)\r\n if seq_state is None:\r\n log(\"expand\", f\"Skipping {zip_path} (missing metadata)\")\r\n continue\r\n\r\n target_dir = sequence_dir_for(zip_path)\r\n if current_state(target_dir) == seq_state:\r\n continue\r\n\r\n work_items.append((zip_path, seq_state))\r\n\r\n if not work_items:\r\n log(\"expand\", \"Working folders already match archives; nothing to expand.\")\r\n return 0\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_expand, zip_path, seq_state, verbose=verbose): zip_path\r\n for zip_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n future.result()\r\n completed += 1\r\n zip_path = future_map[future]\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"expand\", f\"{completed}/{total} {rel}\")\r\n\r\n log(\"expand\", f\"Refreshed {len(work_items)} sequence folder(s).\", verbose=verbose)\r\n return len(work_items)\r\n\r\n\r\ndef cleanup_orphan_archives(*, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n return 0\r\n\r\n removed: list[Path] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n seq_dir = sequence_dir_for(zip_path)\r\n if seq_dir.exists():\r\n continue\r\n\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"zip\", f\"Removing orphan archive {rel}\", verbose_only=True, verbose=verbose)\r\n\r\n zip_path.unlink(missing_ok=True)\r\n state_path = state_path_for(zip_path)\r\n if state_path.exists():\r\n state_path.unlink()\r\n removed.append(zip_path)\r\n\r\n if not removed:\r\n return 0\r\n\r\n for parent in sorted({p.parent for p in removed}, key=lambda p: len(p.parts), reverse=True):\r\n if not parent.exists():\r\n continue\r\n while parent != ARCHIVE_ROOT and not any(parent.iterdir()):\r\n parent.rmdir()\r\n parent = parent.parent\r\n\r\n return len(removed)\r\n\r\n\r\ndef main() -> int:\r\n args = parse_args()\r\n\r\n if args.mode == \"expand\":\r\n # For expand mode, use simple CPU-based worker calculation\r\n workers, _ = max_workers(args.jobs, work_items=None, verbose=args.verbose)\r\n run_expand(workers, verbose=args.verbose)\r\n return 0\r\n\r\n # For zip mode, work items will be calculated in run_zip\r\n updated = run_zip(args.jobs, verbose=args.verbose)\r\n return 0 if updated >= 0 else 1\r\n\r\n\r\nif __name__ == \"__main__\":\r\n try:\r\n raise SystemExit(main())\r\n except Exception as exc: # broad to surface unexpected errors cleanly\r\n print(f\"Sequence sync failed: {exc}\", file=sys.stderr)\r\n raise\r\n\r\n" +} +``` +User decision: **accepted** + +Status: **completed** + + +
+
+ +--- + + + +--- + + +
+Tool use: **apply_patch** + + +Parameters: + +```json +{ + "relativeWorkspacePath": "zip_sequences.py" +} +``` +Additional data: + +```json +{ + "codeblockId": "1dcd5514-d762-4a9a-97d1-e93fce4a9af3" +} +``` +Result: + +```json +{ + "diff": { + "chunks": [ + { + "diffString": " return (final_limit, ram_limits_dict)\r\n \r\n- \r\n- def log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n- if verbose_only and not verbose:\r\n- return\r\n- print(f\"[{mode}] {message}\")\r\n- \r\n \r\n def is_archive_path(path: Path) -> bool:\r", + "oldStart": 448, + "newStart": 448, + "oldLines": 10, + "newLines": 4, + "linesRemoved": 6 + } + ], + "editor": "EDITOR_AI" + }, + "shouldAutoFixLints": true, + "resultForModel": "Success. Updated the following files:\nM zip_sequences.py", + "contentsAfterEdit": "#!/usr/bin/env python3\r\n\"\"\"Maintain zipped render sequences for Git hooks.\r\n\r\nDefault mode scans `Renders/`, produces ZIP archives under `Renders/_zipped/`,\r\nand stages any updated archives so commits only track compact files. Switch to\r\n`--mode expand` to inflate the tracked archives back into the ignored working\r\ndirectories after checkouts or pulls.\r\n\"\"\"\r\n\r\nfrom __future__ import annotations\r\n\r\nimport argparse\r\nimport json\r\nimport os\r\nimport platform\r\nimport shutil\r\nimport subprocess\r\nimport sys\r\nimport tempfile\r\nimport time\r\nfrom concurrent.futures import ThreadPoolExecutor, as_completed\r\nfrom pathlib import Path\r\nfrom typing import Iterator, Sequence\r\n\r\n# Try to import psutil for cross-platform RAM detection\r\ntry:\r\n import psutil\r\n HAS_PSUTIL = True\r\nexcept ImportError:\r\n HAS_PSUTIL = False\r\n # For Windows fallback\r\n if platform.system() == \"Windows\":\r\n try:\r\n import ctypes\r\n HAS_CTYPES = True\r\n except ImportError:\r\n HAS_CTYPES = False\r\n else:\r\n HAS_CTYPES = False\r\n\r\n\r\nRENDER_ROOT = Path(\"Renders\")\r\nARCHIVE_ROOT = RENDER_ROOT / \"_zipped\"\r\nSEQUENCE_EXTENSIONS = {\r\n \".png\",\r\n \".jpg\",\r\n \".jpeg\",\r\n \".tif\",\r\n \".tiff\",\r\n \".exr\",\r\n}\r\nSTATE_SUFFIX = \".meta.json\"\r\nDEFAULT_CONFIG = {\r\n \"zipper\": \"7z\",\r\n \"compression\": 9,\r\n \"dailyFormat\": \"daily_YYMMDD\",\r\n \"Max7zInst\": 0, # Maximum concurrent 7z instances (0 = auto-calculate)\r\n}\r\n\r\n\r\ndef log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n if verbose_only and not verbose:\r\n return\r\n print(f\"[{mode}] {message}\", flush=True)\r\n\r\n\r\ndef load_config() -> dict:\r\n # First try to load from project's .config folder (current working directory)\r\n # Then fall back to ProjectStructure repo config (next to zip_sequences.py)\r\n cwd = Path.cwd()\r\n project_config = cwd / \".config\" / \"config.json\"\r\n repo_config = Path(__file__).resolve().with_name(\"config.json\")\r\n \r\n config_paths = [\r\n (\"project\", project_config),\r\n (\"repo\", repo_config),\r\n ]\r\n \r\n for source, config_path in config_paths:\r\n try:\r\n if config_path.exists():\r\n text = config_path.read_text(encoding=\"utf-8\")\r\n try:\r\n data = json.loads(text)\r\n if isinstance(data, dict):\r\n merged = DEFAULT_CONFIG.copy()\r\n merged.update(data)\r\n return merged\r\n except json.JSONDecodeError:\r\n continue\r\n except OSError:\r\n continue\r\n \r\n # If no config found, return defaults\r\n return DEFAULT_CONFIG.copy()\r\n\r\n\r\nCONFIG = load_config()\r\nzipper_val = CONFIG.get(\"zipper\", \"7z\")\r\n# Handle both old boolean format and new string format\r\nif isinstance(zipper_val, bool):\r\n ZIPPER_TYPE = \"7z\" if zipper_val else \"zip\"\r\nelse:\r\n ZIPPER_TYPE = str(zipper_val).lower()\r\n\r\nCOMPRESSION_LEVEL = CONFIG.get(\"compression\", 9)\r\nif isinstance(COMPRESSION_LEVEL, str):\r\n try:\r\n COMPRESSION_LEVEL = int(COMPRESSION_LEVEL)\r\n except ValueError:\r\n COMPRESSION_LEVEL = 9\r\nif not isinstance(COMPRESSION_LEVEL, int):\r\n COMPRESSION_LEVEL = 9\r\nCOMPRESSION_LEVEL = max(0, min(9, COMPRESSION_LEVEL))\r\n\r\nMAX_7Z_INSTANCES = CONFIG.get(\"Max7zInst\", 0)\r\nif MAX_7Z_INSTANCES is not None:\r\n if isinstance(MAX_7Z_INSTANCES, str):\r\n try:\r\n MAX_7Z_INSTANCES = int(MAX_7Z_INSTANCES)\r\n except ValueError:\r\n MAX_7Z_INSTANCES = 0\r\n if not isinstance(MAX_7Z_INSTANCES, int) or MAX_7Z_INSTANCES < 1:\r\n MAX_7Z_INSTANCES = 0\r\n# Treat 0 as None (auto-calculate)\r\nif MAX_7Z_INSTANCES == 0:\r\n MAX_7Z_INSTANCES = None\r\n\r\nSEVEN_Z_EXE: str | None = None\r\nif ZIPPER_TYPE == \"7z\":\r\n SEVEN_Z_EXE = shutil.which(\"7z\") or shutil.which(\"7za\")\r\n\r\n\r\ndef parse_args() -> argparse.Namespace:\r\n parser = argparse.ArgumentParser(description=\"Sync render sequences with zipped archives.\")\r\n parser.add_argument(\r\n \"--mode\",\r\n choices=(\"zip\", \"expand\"),\r\n default=\"zip\",\r\n help=\"zip sequences for commit (default) or expand tracked archives\",\r\n )\r\n parser.add_argument(\"--jobs\", type=int, help=\"max parallel workers\")\r\n parser.add_argument(\"--verbose\", action=\"store_true\", help=\"print extra progress details\")\r\n return parser.parse_args()\r\n\r\n\r\ndef get_available_ram() -> int | None:\r\n \"\"\"Get available RAM in bytes, reserving 20% for system.\r\n \r\n Returns:\r\n Available RAM in bytes, or None if detection fails.\r\n \"\"\"\r\n try:\r\n if HAS_PSUTIL:\r\n # Use psutil for cross-platform RAM detection\r\n mem = psutil.virtual_memory()\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem.total * 0.8)\r\n return available\r\n elif HAS_CTYPES and platform.system() == \"Windows\":\r\n # Windows fallback using ctypes\r\n class MEMORYSTATUSEX(ctypes.Structure):\r\n _fields_ = [\r\n (\"dwLength\", ctypes.c_ulong),\r\n (\"dwMemoryLoad\", ctypes.c_ulong),\r\n (\"ullTotalPhys\", ctypes.c_ulonglong),\r\n (\"ullAvailPhys\", ctypes.c_ulonglong),\r\n (\"ullTotalPageFile\", ctypes.c_ulonglong),\r\n (\"ullAvailPageFile\", ctypes.c_ulonglong),\r\n (\"ullTotalVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailExtendedVirtual\", ctypes.c_ulonglong),\r\n ]\r\n \r\n kernel32 = ctypes.windll.kernel32\r\n kernel32.GlobalMemoryStatusEx.argtypes = [ctypes.POINTER(MEMORYSTATUSEX)]\r\n kernel32.GlobalMemoryStatusEx.restype = ctypes.c_bool\r\n \r\n mem_status = MEMORYSTATUSEX()\r\n mem_status.dwLength = ctypes.sizeof(MEMORYSTATUSEX)\r\n \r\n if kernel32.GlobalMemoryStatusEx(ctypes.byref(mem_status)):\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem_status.ullTotalPhys * 0.8)\r\n return available\r\n except Exception:\r\n pass\r\n \r\n return None\r\n\r\n\r\ndef estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int:\r\n \"\"\"Estimate RAM usage per compression job based on folder size.\r\n \r\n Args:\r\n seq_dir: Path to the sequence directory\r\n seq_state: State dictionary containing file information\r\n \r\n Returns:\r\n Estimated RAM usage in bytes\r\n \"\"\"\r\n # Calculate total folder size from seq_state\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n \r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations)\r\n # This is the main memory consumer for 7z LZMA compression\r\n dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary\r\n \r\n # Input buffer: 7z processes in chunks, doesn't need full file in RAM\r\n # Use 15% of sequence size, capped at 2GB\r\n input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024)\r\n \r\n # Compression overhead: additional memory for compression process\r\n overhead = 1 * 1024 * 1024 * 1024 # 1GB\r\n \r\n # Total RAM estimate\r\n estimated_ram = dict_ram + input_buffer + overhead\r\n \r\n return estimated_ram\r\n else:\r\n # zip compression is more memory-efficient\r\n # Conservative estimate: 1GB per job\r\n return 1024 * 1024 * 1024 # 1 GB\r\n\r\n\r\ndef max_workers(\r\n requested: int | None,\r\n work_items: list[tuple[Path, Path, Path, dict]] | None = None,\r\n *,\r\n verbose: bool = False\r\n) -> tuple[int, int | None]:\r\n \"\"\"Calculate maximum worker count based on CPU and RAM constraints.\r\n \r\n Args:\r\n requested: User-requested worker count (from --jobs)\r\n work_items: List of work items (seq_dir, zip_path, state_path, seq_state)\r\n verbose: Whether to log RAM-based calculations\r\n \r\n Returns:\r\n Tuple of (worker_count, per_job_memory_limit_bytes)\r\n per_job_memory_limit_bytes is None if not using 7z or RAM detection failed\r\n \"\"\"\r\n cpu = os.cpu_count() or 1\r\n cpu_limit = max(1, min(8, cpu))\r\n if requested and requested > 0:\r\n cpu_limit = min(requested, max(1, cpu))\r\n \r\n # If no work items provided, return CPU-based limit\r\n if work_items is None or len(work_items) == 0:\r\n return (cpu_limit, {})\r\n \r\n # Try to calculate RAM-based limit\r\n available_ram = get_available_ram()\r\n \r\n if available_ram is None:\r\n # RAM detection failed, fall back to CPU limit\r\n if verbose:\r\n log(\"zip\", \"RAM detection failed, using CPU-based worker limit\", verbose_only=True, verbose=verbose)\r\n return (cpu_limit, {})\r\n \r\n # For 7z: use fixed dictionary size and calculate workers\r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n fixed_dict_size_bytes = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Check if Max7zInst is configured\r\n if MAX_7Z_INSTANCES is not None:\r\n # Use configured maximum instances, but still respect user's --jobs and work items\r\n final_limit = MAX_7Z_INSTANCES\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n final_limit = min(final_limit, num_work_items)\r\n if requested and requested > 0:\r\n final_limit = min(final_limit, requested)\r\n \r\n # Create RAM limits dict (all use fixed dict size, but return as dict for consistency)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = fixed_dict_size_bytes\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"Using Max7zInst={MAX_7Z_INSTANCES} from config → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n \r\n # Auto-calculate based on RAM if Max7zInst not configured\r\n # Use bin-packing algorithm with size-aware RAM estimation\r\n if available_ram is not None:\r\n # available_ram is already 80% of total (20% reserved for system)\r\n # Use 95% of available RAM for compression jobs\r\n compression_ram = int(available_ram * 0.95)\r\n \r\n # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item)\r\n work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n \r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use a safe default (12GB minimum for 1GB dict)\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB\r\n work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n # Sort by estimated RAM (largest first) for bin-packing\r\n work_items_with_ram.sort(key=lambda x: x[1], reverse=True)\r\n \r\n # Bin-packing algorithm: pack largest items first\r\n bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = []\r\n bin_remaining: list[int] = []\r\n \r\n for seq_dir, estimated_ram, work_item in work_items_with_ram:\r\n # Try to fit in existing bin\r\n placed = False\r\n for i, remaining in enumerate(bin_remaining):\r\n if remaining >= estimated_ram:\r\n bins[i].append((seq_dir, estimated_ram, work_item))\r\n bin_remaining[i] -= estimated_ram\r\n placed = True\r\n break\r\n \r\n # If doesn't fit, create new bin\r\n if not placed:\r\n bins.append([(seq_dir, estimated_ram, work_item)])\r\n bin_remaining.append(compression_ram - estimated_ram)\r\n \r\n # Worker count is number of bins\r\n worker_count = len(bins)\r\n \r\n # Cap at number of actual work items (can't have more workers than jobs)\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n worker_count = min(worker_count, num_work_items)\r\n \r\n # Respect user's --jobs if provided\r\n if requested and requested > 0:\r\n worker_count = min(worker_count, requested)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n compression_ram_gb = compression_ram / (1024 ** 3)\r\n total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n if len(bins) > 0:\r\n bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins]\r\n log(\r\n \"zip\",\r\n f\"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Final worker count: {worker_count} (requested: {requested})\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n # Return worker count and RAM limits dict\r\n return (worker_count, ram_limits_dict)\r\n \r\n # RAM detection failed, use a safe default (no CPU limit)\r\n default_limit = 4\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n default_limit = min(default_limit, num_work_items)\r\n if requested and requested > 0:\r\n default_limit = min(default_limit, requested)\r\n \r\n # Create RAM limits dict with safe defaults (12GB per job for 1GB dict)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB default\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"RAM detection failed and Max7zInst not set, using default worker limit → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {default_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n return (default_limit, ram_limits_dict)\r\n \r\n # For zip compression, use existing estimation-based approach\r\n # Estimate RAM per job for each work item\r\n ram_estimates = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n ram_estimates.append(estimated_ram)\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use fallback estimate\r\n fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip\r\n ram_estimates.append(fallback_ram)\r\n ram_limits_dict[seq_dir] = fallback_ram\r\n \r\n if not ram_estimates:\r\n return (cpu_limit, {})\r\n \r\n max_ram_per_job = max(ram_estimates)\r\n ram_limit = max(1, available_ram // max_ram_per_job)\r\n ram_limit = min(ram_limit, 6) # Conservative limit for zip\r\n final_limit = min(cpu_limit, ram_limit)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n max_ram_gb = max_ram_per_job / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available, ~{max_ram_gb:.1f}GB per job → \"\r\n f\"RAM limit: {ram_limit}, CPU limit: {cpu_limit}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n\r\n\r\ndef is_archive_path(path: Path) -> bool:\r\n return any(part in (\"_archive\", \"_CURRENT\") for part in path.parts)\r\n\r\n\r\ndef find_sequence_dirs(root: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(root):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n has_frames = any(Path(dirpath, f).suffix.lower() in SEQUENCE_EXTENSIONS for f in filenames)\r\n if has_frames:\r\n yield path\r\n\r\n\r\ndef iter_sequence_files(seq_dir: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(seq_dir):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n for filename in filenames:\r\n yield path / filename\r\n\r\n\r\ndef compute_state(seq_dir: Path) -> dict:\r\n entries = []\r\n files = sorted(\r\n iter_sequence_files(seq_dir),\r\n key=lambda p: p.relative_to(seq_dir).as_posix(),\r\n )\r\n for file_path in files:\r\n stat = file_path.stat()\r\n entries.append(\r\n {\r\n \"path\": file_path.relative_to(seq_dir).as_posix(),\r\n \"size\": stat.st_size,\r\n \"mtime_ns\": stat.st_mtime_ns,\r\n }\r\n )\r\n return {\"files\": entries}\r\n\r\n\r\ndef current_state(seq_dir: Path) -> dict:\r\n if not seq_dir.exists() or not seq_dir.is_dir():\r\n return {\"files\": []}\r\n return compute_state(seq_dir)\r\n\r\n\r\ndef load_state(state_path: Path) -> dict | None:\r\n if not state_path.exists():\r\n return None\r\n try:\r\n return json.loads(state_path.read_text())\r\n except json.JSONDecodeError:\r\n return None\r\n\r\n\r\ndef state_changed(seq_state: dict, stored_state: dict | None) -> bool:\r\n if stored_state is None:\r\n return True\r\n return seq_state != stored_state\r\n\r\n\r\ndef archive_path_for(seq_dir: Path) -> Path:\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n suffix = \".7z\" if ZIPPER_TYPE == \"7z\" else \".zip\"\r\n return (ARCHIVE_ROOT / rel).with_suffix(suffix)\r\n\r\n\r\ndef sequence_dir_for(zip_path: Path) -> Path:\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n return (RENDER_ROOT / rel).with_suffix(\"\")\r\n\r\n\r\ndef state_path_for(zip_path: Path) -> Path:\r\n return zip_path.with_suffix(zip_path.suffix + STATE_SUFFIX)\r\n\r\n\r\ndef zip_sequence(seq_dir: Path, zip_path: Path, per_job_memory_limit: int | None = None) -> None:\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z compression requested but 7z executable not found in PATH. \"\r\n \"Please install 7z (e.g., via Chocolatey: choco install 7zip) \"\r\n \"or set zipper to 'zip' in config.json\"\r\n )\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n \r\n # If creating a .7z file, remove any existing .zip file for the same sequence\r\n if zip_path.suffix == \".7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n \r\n # Build list of files to archive with relative paths\r\n file_list = []\r\n for file_path in iter_sequence_files(seq_dir):\r\n rel_path = file_path.relative_to(seq_dir).as_posix()\r\n file_list.append(rel_path)\r\n \r\n if not file_list:\r\n raise RuntimeError(f\"No files found to archive in {seq_dir}\")\r\n \r\n # Create zip in temporary location first to avoid issues with corrupted existing files\r\n temp_zip = None\r\n list_file_path = None\r\n try:\r\n # Create temporary archive file path (but don't create the file - let 7z create it)\r\n temp_zip_path = tempfile.mktemp(suffix=\".7z\", dir=zip_path.parent)\r\n temp_zip = Path(temp_zip_path)\r\n \r\n # Create list file with absolute path\r\n fd, temp_path = tempfile.mkstemp(suffix=\".lst\", text=True)\r\n list_file_path = Path(temp_path)\r\n with os.fdopen(fd, \"w\", encoding=\"utf-8\") as list_file:\r\n for rel_path in file_list:\r\n list_file.write(rel_path + \"\\n\")\r\n list_file.flush()\r\n os.fsync(list_file.fileno()) # Ensure data is written to disk\r\n # File is closed here by context manager, small delay to ensure OS releases handle\r\n time.sleep(0.1)\r\n \r\n # Use absolute paths for both list file and temp zip\r\n list_file_abs = list_file_path.resolve()\r\n temp_zip_abs = temp_zip.resolve()\r\n # Create archive in temp location first (7z will create it fresh)\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"a\",\r\n \"-y\",\r\n \"-bb0\", # Suppress progress output\r\n f\"-mx={COMPRESSION_LEVEL}\",\r\n \"-t7z\", # Use 7z format, not zip\r\n ]\r\n \r\n # Always use fixed dictionary size: 1GB (1024MB)\r\n # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only)\r\n # We keep dictionary at 1GB for best compression regardless of RAM estimate\r\n FIXED_DICT_SIZE_MB = 1024\r\n cmd.append(f\"-md={FIXED_DICT_SIZE_MB}m\")\r\n \r\n cmd.extend([\r\n str(temp_zip_abs),\r\n f\"@{list_file_abs}\",\r\n ])\r\n result = subprocess.run(\r\n cmd,\r\n cwd=seq_dir,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z compression failed: {error_msg}\")\r\n \r\n # Move temp zip to final location, replacing any existing file\r\n if zip_path.exists():\r\n zip_path.unlink()\r\n temp_zip.replace(zip_path)\r\n temp_zip = None # Mark as moved so we don't delete it\r\n finally:\r\n # Clean up temp zip if it wasn't moved\r\n if temp_zip and temp_zip.exists():\r\n try:\r\n temp_zip.unlink(missing_ok=True)\r\n except OSError:\r\n pass\r\n # Clean up list file, with retry in case 7z still has it open\r\n if list_file_path and list_file_path.exists():\r\n for attempt in range(3):\r\n try:\r\n list_file_path.unlink(missing_ok=True)\r\n break\r\n except PermissionError:\r\n if attempt < 2:\r\n time.sleep(0.1) # Wait 100ms before retry\r\n else:\r\n # Last attempt failed, just log and continue\r\n # The temp file will be cleaned up by the OS eventually\r\n pass\r\n return\r\n\r\n # Use zipfile (only if ZIPPER_TYPE == \"zip\")\r\n if ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZIP_DEFLATED, ZIP_STORED, ZipFile\r\n\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n if COMPRESSION_LEVEL <= 0:\r\n compression = ZIP_STORED\r\n zip_kwargs = {}\r\n else:\r\n compression = ZIP_DEFLATED\r\n zip_kwargs = {\"compresslevel\": COMPRESSION_LEVEL}\r\n\r\n with ZipFile(zip_path, \"w\", compression=compression, **zip_kwargs) as archive:\r\n for file_path in iter_sequence_files(seq_dir):\r\n archive.write(file_path, arcname=file_path.relative_to(seq_dir).as_posix())\r\n return\r\n\r\n # Unknown ZIPPER_TYPE - fail with clear error\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n\r\ndef expand_sequence(zip_path: Path, seq_state: dict) -> None:\r\n target_dir = sequence_dir_for(zip_path)\r\n if target_dir.exists():\r\n shutil.rmtree(target_dir)\r\n target_dir.mkdir(parents=True, exist_ok=True)\r\n\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z extraction requested but 7z executable not found in PATH. \"\r\n \"Please install 7z or set zipper to 'zip' in config.json\"\r\n )\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"x\",\r\n \"-y\",\r\n str(zip_path),\r\n f\"-o{target_dir}\",\r\n ]\r\n result = subprocess.run(\r\n cmd,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z extraction failed: {error_msg}\")\r\n elif ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZipFile\r\n\r\n with ZipFile(zip_path, \"r\") as archive:\r\n archive.extractall(target_dir)\r\n else:\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n for entry in seq_state.get(\"files\", []):\r\n file_path = target_dir / entry[\"path\"]\r\n if file_path.exists():\r\n os.utime(file_path, ns=(entry[\"mtime_ns\"], entry[\"mtime_ns\"]))\r\n\r\n\r\ndef process_zip(seq_dir: Path, zip_path: Path, state_path: Path, seq_state: dict, per_job_memory_limit: int | None, *, verbose: bool) -> Sequence[Path]:\r\n log(\"zip\", f\"{seq_dir} -> {zip_path}\", verbose_only=True, verbose=verbose)\r\n zip_sequence(seq_dir, zip_path, per_job_memory_limit)\r\n state_path.write_text(json.dumps(seq_state, indent=2))\r\n return (zip_path, state_path)\r\n\r\n\r\ndef process_expand(zip_path: Path, state: dict, *, verbose: bool) -> None:\r\n log(\"expand\", f\"{zip_path} -> {sequence_dir_for(zip_path)}\", verbose_only=True, verbose=verbose)\r\n expand_sequence(zip_path, state)\r\n\r\n\r\ndef run_zip(requested_workers: int | None, *, verbose: bool) -> int:\r\n work_items: list[tuple[Path, Path, Path, dict]] = []\r\n\r\n if RENDER_ROOT.exists():\r\n for seq_dir in find_sequence_dirs(RENDER_ROOT):\r\n # Get the target archive path (will be .7z if ZIPPER_TYPE is \"7z\")\r\n zip_path = archive_path_for(seq_dir)\r\n state_path = state_path_for(zip_path)\r\n \r\n # Quick check: if archive exists, load stored state first (fast)\r\n stored_state = load_state(state_path)\r\n \r\n # Check if we need to upgrade from .zip to .7z\r\n old_zip_path = None\r\n old_stored_state = None\r\n if ZIPPER_TYPE == \"7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_state_path = state_path_for(old_zip_path)\r\n old_stored_state = load_state(old_state_path)\r\n # If old .zip exists and .7z doesn't, use old .zip's state for comparison\r\n if not zip_path.exists() and old_stored_state is not None:\r\n stored_state = old_stored_state\r\n \r\n # If .7z archive exists and we have stored state, do quick check before computing full state\r\n if zip_path.exists() and stored_state is not None:\r\n # Quick check: if directory mtime is older than archive, likely unchanged\r\n try:\r\n dir_mtime = seq_dir.stat().st_mtime_ns\r\n archive_mtime = zip_path.stat().st_mtime_ns\r\n # If directory wasn't modified since archive was created, skip state computation\r\n if dir_mtime <= archive_mtime:\r\n # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete)\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n continue\r\n except OSError:\r\n # If stat fails, fall through to full state computation\r\n pass\r\n \r\n # Compute current state only if we need to\r\n seq_state = compute_state(seq_dir)\r\n if not seq_state[\"files\"]:\r\n continue\r\n \r\n # Check if state changed\r\n if stored_state is not None and not state_changed(seq_state, stored_state):\r\n # Metadata matches stored state\r\n if zip_path.exists():\r\n # .7z exists and is up to date, clean up old .zip if it exists\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n elif old_zip_path and old_zip_path.exists() and old_stored_state is not None:\r\n # .7z doesn't exist, but .zip exists and metadata matches\r\n # Keep the .zip file, don't create .7z\r\n continue\r\n else:\r\n # No archive exists, but state matches (shouldn't happen, but be safe)\r\n continue\r\n\r\n work_items.append((seq_dir, zip_path, state_path, seq_state))\r\n\r\n if not work_items:\r\n if not RENDER_ROOT.exists():\r\n log(\"zip\", \"Render root 'Renders' not found; nothing to zip.\")\r\n else:\r\n log(\"zip\", \"Archives already up to date; no sequences needed zipping.\")\r\n return 0\r\n\r\n # Calculate RAM-aware worker count based on work items\r\n worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)\r\n\r\n updated_paths: list[Path] = []\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir\r\n for seq_dir, zip_path, state_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n updated_paths.extend(future.result())\r\n completed += 1\r\n seq_dir = future_map[future]\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n log(\"zip\", f\"{completed}/{total} {rel}\")\r\n\r\n updated_count = len(updated_paths) // 2\r\n log(\"zip\", f\"Updated {updated_count} sequence archive(s).\", verbose=verbose)\r\n if updated_paths:\r\n log(\r\n \"zip\",\r\n \"Archives updated. Stage manually with `git add Renders/_zipped`, if desired.\",\r\n verbose_only=True,\r\n verbose=verbose,\r\n )\r\n\r\n removed = cleanup_orphan_archives(verbose=verbose)\r\n if removed:\r\n log(\"zip\", f\"Removed {removed} orphan archive(s).\", verbose=verbose)\r\n\r\n return updated_count\r\n\r\n\r\ndef run_expand(worker_count: int, *, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n log(\"expand\", \"No archives to expand (missing 'Renders/_zipped').\")\r\n return 0\r\n\r\n work_items: list[tuple[Path, dict]] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n state_path = state_path_for(zip_path)\r\n seq_state = load_state(state_path)\r\n if seq_state is None:\r\n log(\"expand\", f\"Skipping {zip_path} (missing metadata)\")\r\n continue\r\n\r\n target_dir = sequence_dir_for(zip_path)\r\n if current_state(target_dir) == seq_state:\r\n continue\r\n\r\n work_items.append((zip_path, seq_state))\r\n\r\n if not work_items:\r\n log(\"expand\", \"Working folders already match archives; nothing to expand.\")\r\n return 0\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_expand, zip_path, seq_state, verbose=verbose): zip_path\r\n for zip_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n future.result()\r\n completed += 1\r\n zip_path = future_map[future]\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"expand\", f\"{completed}/{total} {rel}\")\r\n\r\n log(\"expand\", f\"Refreshed {len(work_items)} sequence folder(s).\", verbose=verbose)\r\n return len(work_items)\r\n\r\n\r\ndef cleanup_orphan_archives(*, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n return 0\r\n\r\n removed: list[Path] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n seq_dir = sequence_dir_for(zip_path)\r\n if seq_dir.exists():\r\n continue\r\n\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"zip\", f\"Removing orphan archive {rel}\", verbose_only=True, verbose=verbose)\r\n\r\n zip_path.unlink(missing_ok=True)\r\n state_path = state_path_for(zip_path)\r\n if state_path.exists():\r\n state_path.unlink()\r\n removed.append(zip_path)\r\n\r\n if not removed:\r\n return 0\r\n\r\n for parent in sorted({p.parent for p in removed}, key=lambda p: len(p.parts), reverse=True):\r\n if not parent.exists():\r\n continue\r\n while parent != ARCHIVE_ROOT and not any(parent.iterdir()):\r\n parent.rmdir()\r\n parent = parent.parent\r\n\r\n return len(removed)\r\n\r\n\r\ndef main() -> int:\r\n args = parse_args()\r\n\r\n if args.mode == \"expand\":\r\n # For expand mode, use simple CPU-based worker calculation\r\n workers, _ = max_workers(args.jobs, work_items=None, verbose=args.verbose)\r\n run_expand(workers, verbose=args.verbose)\r\n return 0\r\n\r\n # For zip mode, work items will be calculated in run_zip\r\n updated = run_zip(args.jobs, verbose=args.verbose)\r\n return 0 if updated >= 0 else 1\r\n\r\n\r\nif __name__ == \"__main__\":\r\n try:\r\n raise SystemExit(main())\r\n except Exception as exc: # broad to surface unexpected errors cleanly\r\n print(f\"Sequence sync failed: {exc}\", file=sys.stderr)\r\n raise\r\n\r\n" +} +``` +User decision: **accepted** + +Status: **completed** + + +
+
+ +--- + +
Thought Process +**Updating load_config for logging**
+ +--- + + +
+Tool use: **apply_patch** + + +Parameters: + +```json +{ + "relativeWorkspacePath": "zip_sequences.py" +} +``` +Additional data: + +```json +{ + "codeblockId": "216b131a-3043-4fe5-b7bc-4ca53001c628" +} +``` +Result: + +```json +{ + "diff": { + "chunks": [ + { + "diffString": " ]\r\n \r\n+ log(\"init\", \"Loading configuration sources...\")\r\n for source, config_path in config_paths:\r\n try:\r\n if config_path.exists():\r\n+ log(\"init\", f\"Reading {source} config at {config_path}\")\r\n text = config_path.read_text(encoding=\"utf-8\")\r\n try:\r", + "oldStart": 77, + "newStart": 77, + "oldLines": 7, + "newLines": 9, + "linesAdded": 2 + }, + { + "diffString": " merged = DEFAULT_CONFIG.copy()\r\n merged.update(data)\r\n+ log(\"init\", f\"Configuration loaded from {source}\")\r\n return merged\r\n except json.JSONDecodeError:\r\n+ log(\"init\", f\"Config file at {config_path} is invalid JSON; skipping\")\r\n continue\r\n except OSError:\r\n+ log(\"init\", f\"Unable to read config at {config_path}; skipping\")\r\n continue\r\n \r\n # If no config found, return defaults\r\n+ log(\"init\", \"No config files found; using default settings\")\r\n return DEFAULT_CONFIG.copy()\r\n \r", + "oldStart": 86, + "newStart": 88, + "oldLines": 11, + "newLines": 15, + "linesAdded": 4 + } + ], + "editor": "EDITOR_AI" + }, + "shouldAutoFixLints": true, + "resultForModel": "Success. Updated the following files:\nM zip_sequences.py", + "contentsAfterEdit": "#!/usr/bin/env python3\r\n\"\"\"Maintain zipped render sequences for Git hooks.\r\n\r\nDefault mode scans `Renders/`, produces ZIP archives under `Renders/_zipped/`,\r\nand stages any updated archives so commits only track compact files. Switch to\r\n`--mode expand` to inflate the tracked archives back into the ignored working\r\ndirectories after checkouts or pulls.\r\n\"\"\"\r\n\r\nfrom __future__ import annotations\r\n\r\nimport argparse\r\nimport json\r\nimport os\r\nimport platform\r\nimport shutil\r\nimport subprocess\r\nimport sys\r\nimport tempfile\r\nimport time\r\nfrom concurrent.futures import ThreadPoolExecutor, as_completed\r\nfrom pathlib import Path\r\nfrom typing import Iterator, Sequence\r\n\r\n# Try to import psutil for cross-platform RAM detection\r\ntry:\r\n import psutil\r\n HAS_PSUTIL = True\r\nexcept ImportError:\r\n HAS_PSUTIL = False\r\n # For Windows fallback\r\n if platform.system() == \"Windows\":\r\n try:\r\n import ctypes\r\n HAS_CTYPES = True\r\n except ImportError:\r\n HAS_CTYPES = False\r\n else:\r\n HAS_CTYPES = False\r\n\r\n\r\nRENDER_ROOT = Path(\"Renders\")\r\nARCHIVE_ROOT = RENDER_ROOT / \"_zipped\"\r\nSEQUENCE_EXTENSIONS = {\r\n \".png\",\r\n \".jpg\",\r\n \".jpeg\",\r\n \".tif\",\r\n \".tiff\",\r\n \".exr\",\r\n}\r\nSTATE_SUFFIX = \".meta.json\"\r\nDEFAULT_CONFIG = {\r\n \"zipper\": \"7z\",\r\n \"compression\": 9,\r\n \"dailyFormat\": \"daily_YYMMDD\",\r\n \"Max7zInst\": 0, # Maximum concurrent 7z instances (0 = auto-calculate)\r\n}\r\n\r\n\r\ndef log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n if verbose_only and not verbose:\r\n return\r\n print(f\"[{mode}] {message}\", flush=True)\r\n\r\n\r\ndef load_config() -> dict:\r\n # First try to load from project's .config folder (current working directory)\r\n # Then fall back to ProjectStructure repo config (next to zip_sequences.py)\r\n cwd = Path.cwd()\r\n project_config = cwd / \".config\" / \"config.json\"\r\n repo_config = Path(__file__).resolve().with_name(\"config.json\")\r\n \r\n config_paths = [\r\n (\"project\", project_config),\r\n (\"repo\", repo_config),\r\n ]\r\n \r\n log(\"init\", \"Loading configuration sources...\")\r\n for source, config_path in config_paths:\r\n try:\r\n if config_path.exists():\r\n log(\"init\", f\"Reading {source} config at {config_path}\")\r\n text = config_path.read_text(encoding=\"utf-8\")\r\n try:\r\n data = json.loads(text)\r\n if isinstance(data, dict):\r\n merged = DEFAULT_CONFIG.copy()\r\n merged.update(data)\r\n log(\"init\", f\"Configuration loaded from {source}\")\r\n return merged\r\n except json.JSONDecodeError:\r\n log(\"init\", f\"Config file at {config_path} is invalid JSON; skipping\")\r\n continue\r\n except OSError:\r\n log(\"init\", f\"Unable to read config at {config_path}; skipping\")\r\n continue\r\n \r\n # If no config found, return defaults\r\n log(\"init\", \"No config files found; using default settings\")\r\n return DEFAULT_CONFIG.copy()\r\n\r\n\r\nCONFIG = load_config()\r\nzipper_val = CONFIG.get(\"zipper\", \"7z\")\r\n# Handle both old boolean format and new string format\r\nif isinstance(zipper_val, bool):\r\n ZIPPER_TYPE = \"7z\" if zipper_val else \"zip\"\r\nelse:\r\n ZIPPER_TYPE = str(zipper_val).lower()\r\n\r\nCOMPRESSION_LEVEL = CONFIG.get(\"compression\", 9)\r\nif isinstance(COMPRESSION_LEVEL, str):\r\n try:\r\n COMPRESSION_LEVEL = int(COMPRESSION_LEVEL)\r\n except ValueError:\r\n COMPRESSION_LEVEL = 9\r\nif not isinstance(COMPRESSION_LEVEL, int):\r\n COMPRESSION_LEVEL = 9\r\nCOMPRESSION_LEVEL = max(0, min(9, COMPRESSION_LEVEL))\r\n\r\nMAX_7Z_INSTANCES = CONFIG.get(\"Max7zInst\", 0)\r\nif MAX_7Z_INSTANCES is not None:\r\n if isinstance(MAX_7Z_INSTANCES, str):\r\n try:\r\n MAX_7Z_INSTANCES = int(MAX_7Z_INSTANCES)\r\n except ValueError:\r\n MAX_7Z_INSTANCES = 0\r\n if not isinstance(MAX_7Z_INSTANCES, int) or MAX_7Z_INSTANCES < 1:\r\n MAX_7Z_INSTANCES = 0\r\n# Treat 0 as None (auto-calculate)\r\nif MAX_7Z_INSTANCES == 0:\r\n MAX_7Z_INSTANCES = None\r\n\r\nSEVEN_Z_EXE: str | None = None\r\nif ZIPPER_TYPE == \"7z\":\r\n SEVEN_Z_EXE = shutil.which(\"7z\") or shutil.which(\"7za\")\r\n\r\n\r\ndef parse_args() -> argparse.Namespace:\r\n parser = argparse.ArgumentParser(description=\"Sync render sequences with zipped archives.\")\r\n parser.add_argument(\r\n \"--mode\",\r\n choices=(\"zip\", \"expand\"),\r\n default=\"zip\",\r\n help=\"zip sequences for commit (default) or expand tracked archives\",\r\n )\r\n parser.add_argument(\"--jobs\", type=int, help=\"max parallel workers\")\r\n parser.add_argument(\"--verbose\", action=\"store_true\", help=\"print extra progress details\")\r\n return parser.parse_args()\r\n\r\n\r\ndef get_available_ram() -> int | None:\r\n \"\"\"Get available RAM in bytes, reserving 20% for system.\r\n \r\n Returns:\r\n Available RAM in bytes, or None if detection fails.\r\n \"\"\"\r\n try:\r\n if HAS_PSUTIL:\r\n # Use psutil for cross-platform RAM detection\r\n mem = psutil.virtual_memory()\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem.total * 0.8)\r\n return available\r\n elif HAS_CTYPES and platform.system() == \"Windows\":\r\n # Windows fallback using ctypes\r\n class MEMORYSTATUSEX(ctypes.Structure):\r\n _fields_ = [\r\n (\"dwLength\", ctypes.c_ulong),\r\n (\"dwMemoryLoad\", ctypes.c_ulong),\r\n (\"ullTotalPhys\", ctypes.c_ulonglong),\r\n (\"ullAvailPhys\", ctypes.c_ulonglong),\r\n (\"ullTotalPageFile\", ctypes.c_ulonglong),\r\n (\"ullAvailPageFile\", ctypes.c_ulonglong),\r\n (\"ullTotalVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailExtendedVirtual\", ctypes.c_ulonglong),\r\n ]\r\n \r\n kernel32 = ctypes.windll.kernel32\r\n kernel32.GlobalMemoryStatusEx.argtypes = [ctypes.POINTER(MEMORYSTATUSEX)]\r\n kernel32.GlobalMemoryStatusEx.restype = ctypes.c_bool\r\n \r\n mem_status = MEMORYSTATUSEX()\r\n mem_status.dwLength = ctypes.sizeof(MEMORYSTATUSEX)\r\n \r\n if kernel32.GlobalMemoryStatusEx(ctypes.byref(mem_status)):\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem_status.ullTotalPhys * 0.8)\r\n return available\r\n except Exception:\r\n pass\r\n \r\n return None\r\n\r\n\r\ndef estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int:\r\n \"\"\"Estimate RAM usage per compression job based on folder size.\r\n \r\n Args:\r\n seq_dir: Path to the sequence directory\r\n seq_state: State dictionary containing file information\r\n \r\n Returns:\r\n Estimated RAM usage in bytes\r\n \"\"\"\r\n # Calculate total folder size from seq_state\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n \r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations)\r\n # This is the main memory consumer for 7z LZMA compression\r\n dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary\r\n \r\n # Input buffer: 7z processes in chunks, doesn't need full file in RAM\r\n # Use 15% of sequence size, capped at 2GB\r\n input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024)\r\n \r\n # Compression overhead: additional memory for compression process\r\n overhead = 1 * 1024 * 1024 * 1024 # 1GB\r\n \r\n # Total RAM estimate\r\n estimated_ram = dict_ram + input_buffer + overhead\r\n \r\n return estimated_ram\r\n else:\r\n # zip compression is more memory-efficient\r\n # Conservative estimate: 1GB per job\r\n return 1024 * 1024 * 1024 # 1 GB\r\n\r\n\r\ndef max_workers(\r\n requested: int | None,\r\n work_items: list[tuple[Path, Path, Path, dict]] | None = None,\r\n *,\r\n verbose: bool = False\r\n) -> tuple[int, int | None]:\r\n \"\"\"Calculate maximum worker count based on CPU and RAM constraints.\r\n \r\n Args:\r\n requested: User-requested worker count (from --jobs)\r\n work_items: List of work items (seq_dir, zip_path, state_path, seq_state)\r\n verbose: Whether to log RAM-based calculations\r\n \r\n Returns:\r\n Tuple of (worker_count, per_job_memory_limit_bytes)\r\n per_job_memory_limit_bytes is None if not using 7z or RAM detection failed\r\n \"\"\"\r\n cpu = os.cpu_count() or 1\r\n cpu_limit = max(1, min(8, cpu))\r\n if requested and requested > 0:\r\n cpu_limit = min(requested, max(1, cpu))\r\n \r\n # If no work items provided, return CPU-based limit\r\n if work_items is None or len(work_items) == 0:\r\n return (cpu_limit, {})\r\n \r\n # Try to calculate RAM-based limit\r\n available_ram = get_available_ram()\r\n \r\n if available_ram is None:\r\n # RAM detection failed, fall back to CPU limit\r\n if verbose:\r\n log(\"zip\", \"RAM detection failed, using CPU-based worker limit\", verbose_only=True, verbose=verbose)\r\n return (cpu_limit, {})\r\n \r\n # For 7z: use fixed dictionary size and calculate workers\r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n fixed_dict_size_bytes = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Check if Max7zInst is configured\r\n if MAX_7Z_INSTANCES is not None:\r\n # Use configured maximum instances, but still respect user's --jobs and work items\r\n final_limit = MAX_7Z_INSTANCES\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n final_limit = min(final_limit, num_work_items)\r\n if requested and requested > 0:\r\n final_limit = min(final_limit, requested)\r\n \r\n # Create RAM limits dict (all use fixed dict size, but return as dict for consistency)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = fixed_dict_size_bytes\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"Using Max7zInst={MAX_7Z_INSTANCES} from config → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n \r\n # Auto-calculate based on RAM if Max7zInst not configured\r\n # Use bin-packing algorithm with size-aware RAM estimation\r\n if available_ram is not None:\r\n # available_ram is already 80% of total (20% reserved for system)\r\n # Use 95% of available RAM for compression jobs\r\n compression_ram = int(available_ram * 0.95)\r\n \r\n # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item)\r\n work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n \r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use a safe default (12GB minimum for 1GB dict)\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB\r\n work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n # Sort by estimated RAM (largest first) for bin-packing\r\n work_items_with_ram.sort(key=lambda x: x[1], reverse=True)\r\n \r\n # Bin-packing algorithm: pack largest items first\r\n bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = []\r\n bin_remaining: list[int] = []\r\n \r\n for seq_dir, estimated_ram, work_item in work_items_with_ram:\r\n # Try to fit in existing bin\r\n placed = False\r\n for i, remaining in enumerate(bin_remaining):\r\n if remaining >= estimated_ram:\r\n bins[i].append((seq_dir, estimated_ram, work_item))\r\n bin_remaining[i] -= estimated_ram\r\n placed = True\r\n break\r\n \r\n # If doesn't fit, create new bin\r\n if not placed:\r\n bins.append([(seq_dir, estimated_ram, work_item)])\r\n bin_remaining.append(compression_ram - estimated_ram)\r\n \r\n # Worker count is number of bins\r\n worker_count = len(bins)\r\n \r\n # Cap at number of actual work items (can't have more workers than jobs)\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n worker_count = min(worker_count, num_work_items)\r\n \r\n # Respect user's --jobs if provided\r\n if requested and requested > 0:\r\n worker_count = min(worker_count, requested)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n compression_ram_gb = compression_ram / (1024 ** 3)\r\n total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n if len(bins) > 0:\r\n bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins]\r\n log(\r\n \"zip\",\r\n f\"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Final worker count: {worker_count} (requested: {requested})\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n # Return worker count and RAM limits dict\r\n return (worker_count, ram_limits_dict)\r\n \r\n # RAM detection failed, use a safe default (no CPU limit)\r\n default_limit = 4\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n default_limit = min(default_limit, num_work_items)\r\n if requested and requested > 0:\r\n default_limit = min(default_limit, requested)\r\n \r\n # Create RAM limits dict with safe defaults (12GB per job for 1GB dict)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB default\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"RAM detection failed and Max7zInst not set, using default worker limit → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {default_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n return (default_limit, ram_limits_dict)\r\n \r\n # For zip compression, use existing estimation-based approach\r\n # Estimate RAM per job for each work item\r\n ram_estimates = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n ram_estimates.append(estimated_ram)\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use fallback estimate\r\n fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip\r\n ram_estimates.append(fallback_ram)\r\n ram_limits_dict[seq_dir] = fallback_ram\r\n \r\n if not ram_estimates:\r\n return (cpu_limit, {})\r\n \r\n max_ram_per_job = max(ram_estimates)\r\n ram_limit = max(1, available_ram // max_ram_per_job)\r\n ram_limit = min(ram_limit, 6) # Conservative limit for zip\r\n final_limit = min(cpu_limit, ram_limit)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n max_ram_gb = max_ram_per_job / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available, ~{max_ram_gb:.1f}GB per job → \"\r\n f\"RAM limit: {ram_limit}, CPU limit: {cpu_limit}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n\r\n\r\ndef is_archive_path(path: Path) -> bool:\r\n return any(part in (\"_archive\", \"_CURRENT\") for part in path.parts)\r\n\r\n\r\ndef find_sequence_dirs(root: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(root):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n has_frames = any(Path(dirpath, f).suffix.lower() in SEQUENCE_EXTENSIONS for f in filenames)\r\n if has_frames:\r\n yield path\r\n\r\n\r\ndef iter_sequence_files(seq_dir: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(seq_dir):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n for filename in filenames:\r\n yield path / filename\r\n\r\n\r\ndef compute_state(seq_dir: Path) -> dict:\r\n entries = []\r\n files = sorted(\r\n iter_sequence_files(seq_dir),\r\n key=lambda p: p.relative_to(seq_dir).as_posix(),\r\n )\r\n for file_path in files:\r\n stat = file_path.stat()\r\n entries.append(\r\n {\r\n \"path\": file_path.relative_to(seq_dir).as_posix(),\r\n \"size\": stat.st_size,\r\n \"mtime_ns\": stat.st_mtime_ns,\r\n }\r\n )\r\n return {\"files\": entries}\r\n\r\n\r\ndef current_state(seq_dir: Path) -> dict:\r\n if not seq_dir.exists() or not seq_dir.is_dir():\r\n return {\"files\": []}\r\n return compute_state(seq_dir)\r\n\r\n\r\ndef load_state(state_path: Path) -> dict | None:\r\n if not state_path.exists():\r\n return None\r\n try:\r\n return json.loads(state_path.read_text())\r\n except json.JSONDecodeError:\r\n return None\r\n\r\n\r\ndef state_changed(seq_state: dict, stored_state: dict | None) -> bool:\r\n if stored_state is None:\r\n return True\r\n return seq_state != stored_state\r\n\r\n\r\ndef archive_path_for(seq_dir: Path) -> Path:\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n suffix = \".7z\" if ZIPPER_TYPE == \"7z\" else \".zip\"\r\n return (ARCHIVE_ROOT / rel).with_suffix(suffix)\r\n\r\n\r\ndef sequence_dir_for(zip_path: Path) -> Path:\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n return (RENDER_ROOT / rel).with_suffix(\"\")\r\n\r\n\r\ndef state_path_for(zip_path: Path) -> Path:\r\n return zip_path.with_suffix(zip_path.suffix + STATE_SUFFIX)\r\n\r\n\r\ndef zip_sequence(seq_dir: Path, zip_path: Path, per_job_memory_limit: int | None = None) -> None:\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z compression requested but 7z executable not found in PATH. \"\r\n \"Please install 7z (e.g., via Chocolatey: choco install 7zip) \"\r\n \"or set zipper to 'zip' in config.json\"\r\n )\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n \r\n # If creating a .7z file, remove any existing .zip file for the same sequence\r\n if zip_path.suffix == \".7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n \r\n # Build list of files to archive with relative paths\r\n file_list = []\r\n for file_path in iter_sequence_files(seq_dir):\r\n rel_path = file_path.relative_to(seq_dir).as_posix()\r\n file_list.append(rel_path)\r\n \r\n if not file_list:\r\n raise RuntimeError(f\"No files found to archive in {seq_dir}\")\r\n \r\n # Create zip in temporary location first to avoid issues with corrupted existing files\r\n temp_zip = None\r\n list_file_path = None\r\n try:\r\n # Create temporary archive file path (but don't create the file - let 7z create it)\r\n temp_zip_path = tempfile.mktemp(suffix=\".7z\", dir=zip_path.parent)\r\n temp_zip = Path(temp_zip_path)\r\n \r\n # Create list file with absolute path\r\n fd, temp_path = tempfile.mkstemp(suffix=\".lst\", text=True)\r\n list_file_path = Path(temp_path)\r\n with os.fdopen(fd, \"w\", encoding=\"utf-8\") as list_file:\r\n for rel_path in file_list:\r\n list_file.write(rel_path + \"\\n\")\r\n list_file.flush()\r\n os.fsync(list_file.fileno()) # Ensure data is written to disk\r\n # File is closed here by context manager, small delay to ensure OS releases handle\r\n time.sleep(0.1)\r\n \r\n # Use absolute paths for both list file and temp zip\r\n list_file_abs = list_file_path.resolve()\r\n temp_zip_abs = temp_zip.resolve()\r\n # Create archive in temp location first (7z will create it fresh)\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"a\",\r\n \"-y\",\r\n \"-bb0\", # Suppress progress output\r\n f\"-mx={COMPRESSION_LEVEL}\",\r\n \"-t7z\", # Use 7z format, not zip\r\n ]\r\n \r\n # Always use fixed dictionary size: 1GB (1024MB)\r\n # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only)\r\n # We keep dictionary at 1GB for best compression regardless of RAM estimate\r\n FIXED_DICT_SIZE_MB = 1024\r\n cmd.append(f\"-md={FIXED_DICT_SIZE_MB}m\")\r\n \r\n cmd.extend([\r\n str(temp_zip_abs),\r\n f\"@{list_file_abs}\",\r\n ])\r\n result = subprocess.run(\r\n cmd,\r\n cwd=seq_dir,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z compression failed: {error_msg}\")\r\n \r\n # Move temp zip to final location, replacing any existing file\r\n if zip_path.exists():\r\n zip_path.unlink()\r\n temp_zip.replace(zip_path)\r\n temp_zip = None # Mark as moved so we don't delete it\r\n finally:\r\n # Clean up temp zip if it wasn't moved\r\n if temp_zip and temp_zip.exists():\r\n try:\r\n temp_zip.unlink(missing_ok=True)\r\n except OSError:\r\n pass\r\n # Clean up list file, with retry in case 7z still has it open\r\n if list_file_path and list_file_path.exists():\r\n for attempt in range(3):\r\n try:\r\n list_file_path.unlink(missing_ok=True)\r\n break\r\n except PermissionError:\r\n if attempt < 2:\r\n time.sleep(0.1) # Wait 100ms before retry\r\n else:\r\n # Last attempt failed, just log and continue\r\n # The temp file will be cleaned up by the OS eventually\r\n pass\r\n return\r\n\r\n # Use zipfile (only if ZIPPER_TYPE == \"zip\")\r\n if ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZIP_DEFLATED, ZIP_STORED, ZipFile\r\n\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n if COMPRESSION_LEVEL <= 0:\r\n compression = ZIP_STORED\r\n zip_kwargs = {}\r\n else:\r\n compression = ZIP_DEFLATED\r\n zip_kwargs = {\"compresslevel\": COMPRESSION_LEVEL}\r\n\r\n with ZipFile(zip_path, \"w\", compression=compression, **zip_kwargs) as archive:\r\n for file_path in iter_sequence_files(seq_dir):\r\n archive.write(file_path, arcname=file_path.relative_to(seq_dir).as_posix())\r\n return\r\n\r\n # Unknown ZIPPER_TYPE - fail with clear error\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n\r\ndef expand_sequence(zip_path: Path, seq_state: dict) -> None:\r\n target_dir = sequence_dir_for(zip_path)\r\n if target_dir.exists():\r\n shutil.rmtree(target_dir)\r\n target_dir.mkdir(parents=True, exist_ok=True)\r\n\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z extraction requested but 7z executable not found in PATH. \"\r\n \"Please install 7z or set zipper to 'zip' in config.json\"\r\n )\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"x\",\r\n \"-y\",\r\n str(zip_path),\r\n f\"-o{target_dir}\",\r\n ]\r\n result = subprocess.run(\r\n cmd,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z extraction failed: {error_msg}\")\r\n elif ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZipFile\r\n\r\n with ZipFile(zip_path, \"r\") as archive:\r\n archive.extractall(target_dir)\r\n else:\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n for entry in seq_state.get(\"files\", []):\r\n file_path = target_dir / entry[\"path\"]\r\n if file_path.exists():\r\n os.utime(file_path, ns=(entry[\"mtime_ns\"], entry[\"mtime_ns\"]))\r\n\r\n\r\ndef process_zip(seq_dir: Path, zip_path: Path, state_path: Path, seq_state: dict, per_job_memory_limit: int | None, *, verbose: bool) -> Sequence[Path]:\r\n log(\"zip\", f\"{seq_dir} -> {zip_path}\", verbose_only=True, verbose=verbose)\r\n zip_sequence(seq_dir, zip_path, per_job_memory_limit)\r\n state_path.write_text(json.dumps(seq_state, indent=2))\r\n return (zip_path, state_path)\r\n\r\n\r\ndef process_expand(zip_path: Path, state: dict, *, verbose: bool) -> None:\r\n log(\"expand\", f\"{zip_path} -> {sequence_dir_for(zip_path)}\", verbose_only=True, verbose=verbose)\r\n expand_sequence(zip_path, state)\r\n\r\n\r\ndef run_zip(requested_workers: int | None, *, verbose: bool) -> int:\r\n work_items: list[tuple[Path, Path, Path, dict]] = []\r\n\r\n if RENDER_ROOT.exists():\r\n for seq_dir in find_sequence_dirs(RENDER_ROOT):\r\n # Get the target archive path (will be .7z if ZIPPER_TYPE is \"7z\")\r\n zip_path = archive_path_for(seq_dir)\r\n state_path = state_path_for(zip_path)\r\n \r\n # Quick check: if archive exists, load stored state first (fast)\r\n stored_state = load_state(state_path)\r\n \r\n # Check if we need to upgrade from .zip to .7z\r\n old_zip_path = None\r\n old_stored_state = None\r\n if ZIPPER_TYPE == \"7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_state_path = state_path_for(old_zip_path)\r\n old_stored_state = load_state(old_state_path)\r\n # If old .zip exists and .7z doesn't, use old .zip's state for comparison\r\n if not zip_path.exists() and old_stored_state is not None:\r\n stored_state = old_stored_state\r\n \r\n # If .7z archive exists and we have stored state, do quick check before computing full state\r\n if zip_path.exists() and stored_state is not None:\r\n # Quick check: if directory mtime is older than archive, likely unchanged\r\n try:\r\n dir_mtime = seq_dir.stat().st_mtime_ns\r\n archive_mtime = zip_path.stat().st_mtime_ns\r\n # If directory wasn't modified since archive was created, skip state computation\r\n if dir_mtime <= archive_mtime:\r\n # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete)\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n continue\r\n except OSError:\r\n # If stat fails, fall through to full state computation\r\n pass\r\n \r\n # Compute current state only if we need to\r\n seq_state = compute_state(seq_dir)\r\n if not seq_state[\"files\"]:\r\n continue\r\n \r\n # Check if state changed\r\n if stored_state is not None and not state_changed(seq_state, stored_state):\r\n # Metadata matches stored state\r\n if zip_path.exists():\r\n # .7z exists and is up to date, clean up old .zip if it exists\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n elif old_zip_path and old_zip_path.exists() and old_stored_state is not None:\r\n # .7z doesn't exist, but .zip exists and metadata matches\r\n # Keep the .zip file, don't create .7z\r\n continue\r\n else:\r\n # No archive exists, but state matches (shouldn't happen, but be safe)\r\n continue\r\n\r\n work_items.append((seq_dir, zip_path, state_path, seq_state))\r\n\r\n if not work_items:\r\n if not RENDER_ROOT.exists():\r\n log(\"zip\", \"Render root 'Renders' not found; nothing to zip.\")\r\n else:\r\n log(\"zip\", \"Archives already up to date; no sequences needed zipping.\")\r\n return 0\r\n\r\n # Calculate RAM-aware worker count based on work items\r\n worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)\r\n\r\n updated_paths: list[Path] = []\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir\r\n for seq_dir, zip_path, state_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n updated_paths.extend(future.result())\r\n completed += 1\r\n seq_dir = future_map[future]\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n log(\"zip\", f\"{completed}/{total} {rel}\")\r\n\r\n updated_count = len(updated_paths) // 2\r\n log(\"zip\", f\"Updated {updated_count} sequence archive(s).\", verbose=verbose)\r\n if updated_paths:\r\n log(\r\n \"zip\",\r\n \"Archives updated. Stage manually with `git add Renders/_zipped`, if desired.\",\r\n verbose_only=True,\r\n verbose=verbose,\r\n )\r\n\r\n removed = cleanup_orphan_archives(verbose=verbose)\r\n if removed:\r\n log(\"zip\", f\"Removed {removed} orphan archive(s).\", verbose=verbose)\r\n\r\n return updated_count\r\n\r\n\r\ndef run_expand(worker_count: int, *, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n log(\"expand\", \"No archives to expand (missing 'Renders/_zipped').\")\r\n return 0\r\n\r\n work_items: list[tuple[Path, dict]] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n state_path = state_path_for(zip_path)\r\n seq_state = load_state(state_path)\r\n if seq_state is None:\r\n log(\"expand\", f\"Skipping {zip_path} (missing metadata)\")\r\n continue\r\n\r\n target_dir = sequence_dir_for(zip_path)\r\n if current_state(target_dir) == seq_state:\r\n continue\r\n\r\n work_items.append((zip_path, seq_state))\r\n\r\n if not work_items:\r\n log(\"expand\", \"Working folders already match archives; nothing to expand.\")\r\n return 0\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_expand, zip_path, seq_state, verbose=verbose): zip_path\r\n for zip_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n future.result()\r\n completed += 1\r\n zip_path = future_map[future]\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"expand\", f\"{completed}/{total} {rel}\")\r\n\r\n log(\"expand\", f\"Refreshed {len(work_items)} sequence folder(s).\", verbose=verbose)\r\n return len(work_items)\r\n\r\n\r\ndef cleanup_orphan_archives(*, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n return 0\r\n\r\n removed: list[Path] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n seq_dir = sequence_dir_for(zip_path)\r\n if seq_dir.exists():\r\n continue\r\n\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"zip\", f\"Removing orphan archive {rel}\", verbose_only=True, verbose=verbose)\r\n\r\n zip_path.unlink(missing_ok=True)\r\n state_path = state_path_for(zip_path)\r\n if state_path.exists():\r\n state_path.unlink()\r\n removed.append(zip_path)\r\n\r\n if not removed:\r\n return 0\r\n\r\n for parent in sorted({p.parent for p in removed}, key=lambda p: len(p.parts), reverse=True):\r\n if not parent.exists():\r\n continue\r\n while parent != ARCHIVE_ROOT and not any(parent.iterdir()):\r\n parent.rmdir()\r\n parent = parent.parent\r\n\r\n return len(removed)\r\n\r\n\r\ndef main() -> int:\r\n args = parse_args()\r\n\r\n if args.mode == \"expand\":\r\n # For expand mode, use simple CPU-based worker calculation\r\n workers, _ = max_workers(args.jobs, work_items=None, verbose=args.verbose)\r\n run_expand(workers, verbose=args.verbose)\r\n return 0\r\n\r\n # For zip mode, work items will be calculated in run_zip\r\n updated = run_zip(args.jobs, verbose=args.verbose)\r\n return 0 if updated >= 0 else 1\r\n\r\n\r\nif __name__ == \"__main__\":\r\n try:\r\n raise SystemExit(main())\r\n except Exception as exc: # broad to surface unexpected errors cleanly\r\n print(f\"Sequence sync failed: {exc}\", file=sys.stderr)\r\n raise\r\n\r\n" +} +``` +User decision: **accepted** + +Status: **completed** + + +
+
+ +--- + +
Thought Process +**Adding startup logs in main**
+ +--- + + +
+Tool use: **apply_patch** + + +Parameters: + +```json +{ + "relativeWorkspacePath": "zip_sequences.py" +} +``` +Additional data: + +```json +{ + "codeblockId": "c11fb9a3-9bcc-4e99-a49f-f1911dd6d57a" +} +``` +Result: + +```json +{ + "diff": { + "chunks": [ + { + "diffString": " def main() -> int:\r\n args = parse_args()\r\n+ log(\"init\", \"zip_sequences starting up...\")\r\n+ log(\"init\", f\"Working directory: {Path.cwd()}\")\r\n+ log(\"init\", f\"Mode: {args.mode}, zipper: {ZIPPER_TYPE}, jobs arg: {args.jobs or 'auto'}\")\r\n+ if ZIPPER_TYPE == \"7z\":\r\n+ exe = SEVEN_Z_EXE or \"not found\"\r\n+ max_inst = MAX_7Z_INSTANCES if MAX_7Z_INSTANCES is not None else \"auto\"\r\n+ log(\"init\", f\"7z executable: {exe}, Max7zInst: {max_inst}\")\r\n \r\n if args.mode == \"expand\":\r", + "oldStart": 929, + "newStart": 929, + "oldLines": 4, + "newLines": 11, + "linesAdded": 7 + } + ], + "editor": "EDITOR_AI" + }, + "shouldAutoFixLints": true, + "resultForModel": "Success. Updated the following files:\nM zip_sequences.py", + "contentsAfterEdit": "#!/usr/bin/env python3\r\n\"\"\"Maintain zipped render sequences for Git hooks.\r\n\r\nDefault mode scans `Renders/`, produces ZIP archives under `Renders/_zipped/`,\r\nand stages any updated archives so commits only track compact files. Switch to\r\n`--mode expand` to inflate the tracked archives back into the ignored working\r\ndirectories after checkouts or pulls.\r\n\"\"\"\r\n\r\nfrom __future__ import annotations\r\n\r\nimport argparse\r\nimport json\r\nimport os\r\nimport platform\r\nimport shutil\r\nimport subprocess\r\nimport sys\r\nimport tempfile\r\nimport time\r\nfrom concurrent.futures import ThreadPoolExecutor, as_completed\r\nfrom pathlib import Path\r\nfrom typing import Iterator, Sequence\r\n\r\n# Try to import psutil for cross-platform RAM detection\r\ntry:\r\n import psutil\r\n HAS_PSUTIL = True\r\nexcept ImportError:\r\n HAS_PSUTIL = False\r\n # For Windows fallback\r\n if platform.system() == \"Windows\":\r\n try:\r\n import ctypes\r\n HAS_CTYPES = True\r\n except ImportError:\r\n HAS_CTYPES = False\r\n else:\r\n HAS_CTYPES = False\r\n\r\n\r\nRENDER_ROOT = Path(\"Renders\")\r\nARCHIVE_ROOT = RENDER_ROOT / \"_zipped\"\r\nSEQUENCE_EXTENSIONS = {\r\n \".png\",\r\n \".jpg\",\r\n \".jpeg\",\r\n \".tif\",\r\n \".tiff\",\r\n \".exr\",\r\n}\r\nSTATE_SUFFIX = \".meta.json\"\r\nDEFAULT_CONFIG = {\r\n \"zipper\": \"7z\",\r\n \"compression\": 9,\r\n \"dailyFormat\": \"daily_YYMMDD\",\r\n \"Max7zInst\": 0, # Maximum concurrent 7z instances (0 = auto-calculate)\r\n}\r\n\r\n\r\ndef log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n if verbose_only and not verbose:\r\n return\r\n print(f\"[{mode}] {message}\", flush=True)\r\n\r\n\r\ndef load_config() -> dict:\r\n # First try to load from project's .config folder (current working directory)\r\n # Then fall back to ProjectStructure repo config (next to zip_sequences.py)\r\n cwd = Path.cwd()\r\n project_config = cwd / \".config\" / \"config.json\"\r\n repo_config = Path(__file__).resolve().with_name(\"config.json\")\r\n \r\n config_paths = [\r\n (\"project\", project_config),\r\n (\"repo\", repo_config),\r\n ]\r\n \r\n log(\"init\", \"Loading configuration sources...\")\r\n for source, config_path in config_paths:\r\n try:\r\n if config_path.exists():\r\n log(\"init\", f\"Reading {source} config at {config_path}\")\r\n text = config_path.read_text(encoding=\"utf-8\")\r\n try:\r\n data = json.loads(text)\r\n if isinstance(data, dict):\r\n merged = DEFAULT_CONFIG.copy()\r\n merged.update(data)\r\n log(\"init\", f\"Configuration loaded from {source}\")\r\n return merged\r\n except json.JSONDecodeError:\r\n log(\"init\", f\"Config file at {config_path} is invalid JSON; skipping\")\r\n continue\r\n except OSError:\r\n log(\"init\", f\"Unable to read config at {config_path}; skipping\")\r\n continue\r\n \r\n # If no config found, return defaults\r\n log(\"init\", \"No config files found; using default settings\")\r\n return DEFAULT_CONFIG.copy()\r\n\r\n\r\nCONFIG = load_config()\r\nzipper_val = CONFIG.get(\"zipper\", \"7z\")\r\n# Handle both old boolean format and new string format\r\nif isinstance(zipper_val, bool):\r\n ZIPPER_TYPE = \"7z\" if zipper_val else \"zip\"\r\nelse:\r\n ZIPPER_TYPE = str(zipper_val).lower()\r\n\r\nCOMPRESSION_LEVEL = CONFIG.get(\"compression\", 9)\r\nif isinstance(COMPRESSION_LEVEL, str):\r\n try:\r\n COMPRESSION_LEVEL = int(COMPRESSION_LEVEL)\r\n except ValueError:\r\n COMPRESSION_LEVEL = 9\r\nif not isinstance(COMPRESSION_LEVEL, int):\r\n COMPRESSION_LEVEL = 9\r\nCOMPRESSION_LEVEL = max(0, min(9, COMPRESSION_LEVEL))\r\n\r\nMAX_7Z_INSTANCES = CONFIG.get(\"Max7zInst\", 0)\r\nif MAX_7Z_INSTANCES is not None:\r\n if isinstance(MAX_7Z_INSTANCES, str):\r\n try:\r\n MAX_7Z_INSTANCES = int(MAX_7Z_INSTANCES)\r\n except ValueError:\r\n MAX_7Z_INSTANCES = 0\r\n if not isinstance(MAX_7Z_INSTANCES, int) or MAX_7Z_INSTANCES < 1:\r\n MAX_7Z_INSTANCES = 0\r\n# Treat 0 as None (auto-calculate)\r\nif MAX_7Z_INSTANCES == 0:\r\n MAX_7Z_INSTANCES = None\r\n\r\nSEVEN_Z_EXE: str | None = None\r\nif ZIPPER_TYPE == \"7z\":\r\n SEVEN_Z_EXE = shutil.which(\"7z\") or shutil.which(\"7za\")\r\n\r\n\r\ndef parse_args() -> argparse.Namespace:\r\n parser = argparse.ArgumentParser(description=\"Sync render sequences with zipped archives.\")\r\n parser.add_argument(\r\n \"--mode\",\r\n choices=(\"zip\", \"expand\"),\r\n default=\"zip\",\r\n help=\"zip sequences for commit (default) or expand tracked archives\",\r\n )\r\n parser.add_argument(\"--jobs\", type=int, help=\"max parallel workers\")\r\n parser.add_argument(\"--verbose\", action=\"store_true\", help=\"print extra progress details\")\r\n return parser.parse_args()\r\n\r\n\r\ndef get_available_ram() -> int | None:\r\n \"\"\"Get available RAM in bytes, reserving 20% for system.\r\n \r\n Returns:\r\n Available RAM in bytes, or None if detection fails.\r\n \"\"\"\r\n try:\r\n if HAS_PSUTIL:\r\n # Use psutil for cross-platform RAM detection\r\n mem = psutil.virtual_memory()\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem.total * 0.8)\r\n return available\r\n elif HAS_CTYPES and platform.system() == \"Windows\":\r\n # Windows fallback using ctypes\r\n class MEMORYSTATUSEX(ctypes.Structure):\r\n _fields_ = [\r\n (\"dwLength\", ctypes.c_ulong),\r\n (\"dwMemoryLoad\", ctypes.c_ulong),\r\n (\"ullTotalPhys\", ctypes.c_ulonglong),\r\n (\"ullAvailPhys\", ctypes.c_ulonglong),\r\n (\"ullTotalPageFile\", ctypes.c_ulonglong),\r\n (\"ullAvailPageFile\", ctypes.c_ulonglong),\r\n (\"ullTotalVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailExtendedVirtual\", ctypes.c_ulonglong),\r\n ]\r\n \r\n kernel32 = ctypes.windll.kernel32\r\n kernel32.GlobalMemoryStatusEx.argtypes = [ctypes.POINTER(MEMORYSTATUSEX)]\r\n kernel32.GlobalMemoryStatusEx.restype = ctypes.c_bool\r\n \r\n mem_status = MEMORYSTATUSEX()\r\n mem_status.dwLength = ctypes.sizeof(MEMORYSTATUSEX)\r\n \r\n if kernel32.GlobalMemoryStatusEx(ctypes.byref(mem_status)):\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem_status.ullTotalPhys * 0.8)\r\n return available\r\n except Exception:\r\n pass\r\n \r\n return None\r\n\r\n\r\ndef estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int:\r\n \"\"\"Estimate RAM usage per compression job based on folder size.\r\n \r\n Args:\r\n seq_dir: Path to the sequence directory\r\n seq_state: State dictionary containing file information\r\n \r\n Returns:\r\n Estimated RAM usage in bytes\r\n \"\"\"\r\n # Calculate total folder size from seq_state\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n \r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations)\r\n # This is the main memory consumer for 7z LZMA compression\r\n dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary\r\n \r\n # Input buffer: 7z processes in chunks, doesn't need full file in RAM\r\n # Use 15% of sequence size, capped at 2GB\r\n input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024)\r\n \r\n # Compression overhead: additional memory for compression process\r\n overhead = 1 * 1024 * 1024 * 1024 # 1GB\r\n \r\n # Total RAM estimate\r\n estimated_ram = dict_ram + input_buffer + overhead\r\n \r\n return estimated_ram\r\n else:\r\n # zip compression is more memory-efficient\r\n # Conservative estimate: 1GB per job\r\n return 1024 * 1024 * 1024 # 1 GB\r\n\r\n\r\ndef max_workers(\r\n requested: int | None,\r\n work_items: list[tuple[Path, Path, Path, dict]] | None = None,\r\n *,\r\n verbose: bool = False\r\n) -> tuple[int, int | None]:\r\n \"\"\"Calculate maximum worker count based on CPU and RAM constraints.\r\n \r\n Args:\r\n requested: User-requested worker count (from --jobs)\r\n work_items: List of work items (seq_dir, zip_path, state_path, seq_state)\r\n verbose: Whether to log RAM-based calculations\r\n \r\n Returns:\r\n Tuple of (worker_count, per_job_memory_limit_bytes)\r\n per_job_memory_limit_bytes is None if not using 7z or RAM detection failed\r\n \"\"\"\r\n cpu = os.cpu_count() or 1\r\n cpu_limit = max(1, min(8, cpu))\r\n if requested and requested > 0:\r\n cpu_limit = min(requested, max(1, cpu))\r\n \r\n # If no work items provided, return CPU-based limit\r\n if work_items is None or len(work_items) == 0:\r\n return (cpu_limit, {})\r\n \r\n # Try to calculate RAM-based limit\r\n available_ram = get_available_ram()\r\n \r\n if available_ram is None:\r\n # RAM detection failed, fall back to CPU limit\r\n if verbose:\r\n log(\"zip\", \"RAM detection failed, using CPU-based worker limit\", verbose_only=True, verbose=verbose)\r\n return (cpu_limit, {})\r\n \r\n # For 7z: use fixed dictionary size and calculate workers\r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n fixed_dict_size_bytes = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Check if Max7zInst is configured\r\n if MAX_7Z_INSTANCES is not None:\r\n # Use configured maximum instances, but still respect user's --jobs and work items\r\n final_limit = MAX_7Z_INSTANCES\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n final_limit = min(final_limit, num_work_items)\r\n if requested and requested > 0:\r\n final_limit = min(final_limit, requested)\r\n \r\n # Create RAM limits dict (all use fixed dict size, but return as dict for consistency)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = fixed_dict_size_bytes\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"Using Max7zInst={MAX_7Z_INSTANCES} from config → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n \r\n # Auto-calculate based on RAM if Max7zInst not configured\r\n # Use bin-packing algorithm with size-aware RAM estimation\r\n if available_ram is not None:\r\n # available_ram is already 80% of total (20% reserved for system)\r\n # Use 95% of available RAM for compression jobs\r\n compression_ram = int(available_ram * 0.95)\r\n \r\n # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item)\r\n work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n \r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use a safe default (12GB minimum for 1GB dict)\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB\r\n work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n # Sort by estimated RAM (largest first) for bin-packing\r\n work_items_with_ram.sort(key=lambda x: x[1], reverse=True)\r\n \r\n # Bin-packing algorithm: pack largest items first\r\n bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = []\r\n bin_remaining: list[int] = []\r\n \r\n for seq_dir, estimated_ram, work_item in work_items_with_ram:\r\n # Try to fit in existing bin\r\n placed = False\r\n for i, remaining in enumerate(bin_remaining):\r\n if remaining >= estimated_ram:\r\n bins[i].append((seq_dir, estimated_ram, work_item))\r\n bin_remaining[i] -= estimated_ram\r\n placed = True\r\n break\r\n \r\n # If doesn't fit, create new bin\r\n if not placed:\r\n bins.append([(seq_dir, estimated_ram, work_item)])\r\n bin_remaining.append(compression_ram - estimated_ram)\r\n \r\n # Worker count is number of bins\r\n worker_count = len(bins)\r\n \r\n # Cap at number of actual work items (can't have more workers than jobs)\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n worker_count = min(worker_count, num_work_items)\r\n \r\n # Respect user's --jobs if provided\r\n if requested and requested > 0:\r\n worker_count = min(worker_count, requested)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n compression_ram_gb = compression_ram / (1024 ** 3)\r\n total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n if len(bins) > 0:\r\n bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins]\r\n log(\r\n \"zip\",\r\n f\"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Final worker count: {worker_count} (requested: {requested})\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n # Return worker count and RAM limits dict\r\n return (worker_count, ram_limits_dict)\r\n \r\n # RAM detection failed, use a safe default (no CPU limit)\r\n default_limit = 4\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n default_limit = min(default_limit, num_work_items)\r\n if requested and requested > 0:\r\n default_limit = min(default_limit, requested)\r\n \r\n # Create RAM limits dict with safe defaults (12GB per job for 1GB dict)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB default\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"RAM detection failed and Max7zInst not set, using default worker limit → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {default_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n return (default_limit, ram_limits_dict)\r\n \r\n # For zip compression, use existing estimation-based approach\r\n # Estimate RAM per job for each work item\r\n ram_estimates = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n ram_estimates.append(estimated_ram)\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use fallback estimate\r\n fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip\r\n ram_estimates.append(fallback_ram)\r\n ram_limits_dict[seq_dir] = fallback_ram\r\n \r\n if not ram_estimates:\r\n return (cpu_limit, {})\r\n \r\n max_ram_per_job = max(ram_estimates)\r\n ram_limit = max(1, available_ram // max_ram_per_job)\r\n ram_limit = min(ram_limit, 6) # Conservative limit for zip\r\n final_limit = min(cpu_limit, ram_limit)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n max_ram_gb = max_ram_per_job / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available, ~{max_ram_gb:.1f}GB per job → \"\r\n f\"RAM limit: {ram_limit}, CPU limit: {cpu_limit}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n\r\n\r\ndef is_archive_path(path: Path) -> bool:\r\n return any(part in (\"_archive\", \"_CURRENT\") for part in path.parts)\r\n\r\n\r\ndef find_sequence_dirs(root: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(root):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n has_frames = any(Path(dirpath, f).suffix.lower() in SEQUENCE_EXTENSIONS for f in filenames)\r\n if has_frames:\r\n yield path\r\n\r\n\r\ndef iter_sequence_files(seq_dir: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(seq_dir):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n for filename in filenames:\r\n yield path / filename\r\n\r\n\r\ndef compute_state(seq_dir: Path) -> dict:\r\n entries = []\r\n files = sorted(\r\n iter_sequence_files(seq_dir),\r\n key=lambda p: p.relative_to(seq_dir).as_posix(),\r\n )\r\n for file_path in files:\r\n stat = file_path.stat()\r\n entries.append(\r\n {\r\n \"path\": file_path.relative_to(seq_dir).as_posix(),\r\n \"size\": stat.st_size,\r\n \"mtime_ns\": stat.st_mtime_ns,\r\n }\r\n )\r\n return {\"files\": entries}\r\n\r\n\r\ndef current_state(seq_dir: Path) -> dict:\r\n if not seq_dir.exists() or not seq_dir.is_dir():\r\n return {\"files\": []}\r\n return compute_state(seq_dir)\r\n\r\n\r\ndef load_state(state_path: Path) -> dict | None:\r\n if not state_path.exists():\r\n return None\r\n try:\r\n return json.loads(state_path.read_text())\r\n except json.JSONDecodeError:\r\n return None\r\n\r\n\r\ndef state_changed(seq_state: dict, stored_state: dict | None) -> bool:\r\n if stored_state is None:\r\n return True\r\n return seq_state != stored_state\r\n\r\n\r\ndef archive_path_for(seq_dir: Path) -> Path:\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n suffix = \".7z\" if ZIPPER_TYPE == \"7z\" else \".zip\"\r\n return (ARCHIVE_ROOT / rel).with_suffix(suffix)\r\n\r\n\r\ndef sequence_dir_for(zip_path: Path) -> Path:\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n return (RENDER_ROOT / rel).with_suffix(\"\")\r\n\r\n\r\ndef state_path_for(zip_path: Path) -> Path:\r\n return zip_path.with_suffix(zip_path.suffix + STATE_SUFFIX)\r\n\r\n\r\ndef zip_sequence(seq_dir: Path, zip_path: Path, per_job_memory_limit: int | None = None) -> None:\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z compression requested but 7z executable not found in PATH. \"\r\n \"Please install 7z (e.g., via Chocolatey: choco install 7zip) \"\r\n \"or set zipper to 'zip' in config.json\"\r\n )\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n \r\n # If creating a .7z file, remove any existing .zip file for the same sequence\r\n if zip_path.suffix == \".7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n \r\n # Build list of files to archive with relative paths\r\n file_list = []\r\n for file_path in iter_sequence_files(seq_dir):\r\n rel_path = file_path.relative_to(seq_dir).as_posix()\r\n file_list.append(rel_path)\r\n \r\n if not file_list:\r\n raise RuntimeError(f\"No files found to archive in {seq_dir}\")\r\n \r\n # Create zip in temporary location first to avoid issues with corrupted existing files\r\n temp_zip = None\r\n list_file_path = None\r\n try:\r\n # Create temporary archive file path (but don't create the file - let 7z create it)\r\n temp_zip_path = tempfile.mktemp(suffix=\".7z\", dir=zip_path.parent)\r\n temp_zip = Path(temp_zip_path)\r\n \r\n # Create list file with absolute path\r\n fd, temp_path = tempfile.mkstemp(suffix=\".lst\", text=True)\r\n list_file_path = Path(temp_path)\r\n with os.fdopen(fd, \"w\", encoding=\"utf-8\") as list_file:\r\n for rel_path in file_list:\r\n list_file.write(rel_path + \"\\n\")\r\n list_file.flush()\r\n os.fsync(list_file.fileno()) # Ensure data is written to disk\r\n # File is closed here by context manager, small delay to ensure OS releases handle\r\n time.sleep(0.1)\r\n \r\n # Use absolute paths for both list file and temp zip\r\n list_file_abs = list_file_path.resolve()\r\n temp_zip_abs = temp_zip.resolve()\r\n # Create archive in temp location first (7z will create it fresh)\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"a\",\r\n \"-y\",\r\n \"-bb0\", # Suppress progress output\r\n f\"-mx={COMPRESSION_LEVEL}\",\r\n \"-t7z\", # Use 7z format, not zip\r\n ]\r\n \r\n # Always use fixed dictionary size: 1GB (1024MB)\r\n # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only)\r\n # We keep dictionary at 1GB for best compression regardless of RAM estimate\r\n FIXED_DICT_SIZE_MB = 1024\r\n cmd.append(f\"-md={FIXED_DICT_SIZE_MB}m\")\r\n \r\n cmd.extend([\r\n str(temp_zip_abs),\r\n f\"@{list_file_abs}\",\r\n ])\r\n result = subprocess.run(\r\n cmd,\r\n cwd=seq_dir,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z compression failed: {error_msg}\")\r\n \r\n # Move temp zip to final location, replacing any existing file\r\n if zip_path.exists():\r\n zip_path.unlink()\r\n temp_zip.replace(zip_path)\r\n temp_zip = None # Mark as moved so we don't delete it\r\n finally:\r\n # Clean up temp zip if it wasn't moved\r\n if temp_zip and temp_zip.exists():\r\n try:\r\n temp_zip.unlink(missing_ok=True)\r\n except OSError:\r\n pass\r\n # Clean up list file, with retry in case 7z still has it open\r\n if list_file_path and list_file_path.exists():\r\n for attempt in range(3):\r\n try:\r\n list_file_path.unlink(missing_ok=True)\r\n break\r\n except PermissionError:\r\n if attempt < 2:\r\n time.sleep(0.1) # Wait 100ms before retry\r\n else:\r\n # Last attempt failed, just log and continue\r\n # The temp file will be cleaned up by the OS eventually\r\n pass\r\n return\r\n\r\n # Use zipfile (only if ZIPPER_TYPE == \"zip\")\r\n if ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZIP_DEFLATED, ZIP_STORED, ZipFile\r\n\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n if COMPRESSION_LEVEL <= 0:\r\n compression = ZIP_STORED\r\n zip_kwargs = {}\r\n else:\r\n compression = ZIP_DEFLATED\r\n zip_kwargs = {\"compresslevel\": COMPRESSION_LEVEL}\r\n\r\n with ZipFile(zip_path, \"w\", compression=compression, **zip_kwargs) as archive:\r\n for file_path in iter_sequence_files(seq_dir):\r\n archive.write(file_path, arcname=file_path.relative_to(seq_dir).as_posix())\r\n return\r\n\r\n # Unknown ZIPPER_TYPE - fail with clear error\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n\r\ndef expand_sequence(zip_path: Path, seq_state: dict) -> None:\r\n target_dir = sequence_dir_for(zip_path)\r\n if target_dir.exists():\r\n shutil.rmtree(target_dir)\r\n target_dir.mkdir(parents=True, exist_ok=True)\r\n\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z extraction requested but 7z executable not found in PATH. \"\r\n \"Please install 7z or set zipper to 'zip' in config.json\"\r\n )\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"x\",\r\n \"-y\",\r\n str(zip_path),\r\n f\"-o{target_dir}\",\r\n ]\r\n result = subprocess.run(\r\n cmd,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z extraction failed: {error_msg}\")\r\n elif ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZipFile\r\n\r\n with ZipFile(zip_path, \"r\") as archive:\r\n archive.extractall(target_dir)\r\n else:\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n for entry in seq_state.get(\"files\", []):\r\n file_path = target_dir / entry[\"path\"]\r\n if file_path.exists():\r\n os.utime(file_path, ns=(entry[\"mtime_ns\"], entry[\"mtime_ns\"]))\r\n\r\n\r\ndef process_zip(seq_dir: Path, zip_path: Path, state_path: Path, seq_state: dict, per_job_memory_limit: int | None, *, verbose: bool) -> Sequence[Path]:\r\n log(\"zip\", f\"{seq_dir} -> {zip_path}\", verbose_only=True, verbose=verbose)\r\n zip_sequence(seq_dir, zip_path, per_job_memory_limit)\r\n state_path.write_text(json.dumps(seq_state, indent=2))\r\n return (zip_path, state_path)\r\n\r\n\r\ndef process_expand(zip_path: Path, state: dict, *, verbose: bool) -> None:\r\n log(\"expand\", f\"{zip_path} -> {sequence_dir_for(zip_path)}\", verbose_only=True, verbose=verbose)\r\n expand_sequence(zip_path, state)\r\n\r\n\r\ndef run_zip(requested_workers: int | None, *, verbose: bool) -> int:\r\n work_items: list[tuple[Path, Path, Path, dict]] = []\r\n\r\n if RENDER_ROOT.exists():\r\n for seq_dir in find_sequence_dirs(RENDER_ROOT):\r\n # Get the target archive path (will be .7z if ZIPPER_TYPE is \"7z\")\r\n zip_path = archive_path_for(seq_dir)\r\n state_path = state_path_for(zip_path)\r\n \r\n # Quick check: if archive exists, load stored state first (fast)\r\n stored_state = load_state(state_path)\r\n \r\n # Check if we need to upgrade from .zip to .7z\r\n old_zip_path = None\r\n old_stored_state = None\r\n if ZIPPER_TYPE == \"7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_state_path = state_path_for(old_zip_path)\r\n old_stored_state = load_state(old_state_path)\r\n # If old .zip exists and .7z doesn't, use old .zip's state for comparison\r\n if not zip_path.exists() and old_stored_state is not None:\r\n stored_state = old_stored_state\r\n \r\n # If .7z archive exists and we have stored state, do quick check before computing full state\r\n if zip_path.exists() and stored_state is not None:\r\n # Quick check: if directory mtime is older than archive, likely unchanged\r\n try:\r\n dir_mtime = seq_dir.stat().st_mtime_ns\r\n archive_mtime = zip_path.stat().st_mtime_ns\r\n # If directory wasn't modified since archive was created, skip state computation\r\n if dir_mtime <= archive_mtime:\r\n # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete)\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n continue\r\n except OSError:\r\n # If stat fails, fall through to full state computation\r\n pass\r\n \r\n # Compute current state only if we need to\r\n seq_state = compute_state(seq_dir)\r\n if not seq_state[\"files\"]:\r\n continue\r\n \r\n # Check if state changed\r\n if stored_state is not None and not state_changed(seq_state, stored_state):\r\n # Metadata matches stored state\r\n if zip_path.exists():\r\n # .7z exists and is up to date, clean up old .zip if it exists\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n elif old_zip_path and old_zip_path.exists() and old_stored_state is not None:\r\n # .7z doesn't exist, but .zip exists and metadata matches\r\n # Keep the .zip file, don't create .7z\r\n continue\r\n else:\r\n # No archive exists, but state matches (shouldn't happen, but be safe)\r\n continue\r\n\r\n work_items.append((seq_dir, zip_path, state_path, seq_state))\r\n\r\n if not work_items:\r\n if not RENDER_ROOT.exists():\r\n log(\"zip\", \"Render root 'Renders' not found; nothing to zip.\")\r\n else:\r\n log(\"zip\", \"Archives already up to date; no sequences needed zipping.\")\r\n return 0\r\n\r\n # Calculate RAM-aware worker count based on work items\r\n worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)\r\n\r\n updated_paths: list[Path] = []\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir\r\n for seq_dir, zip_path, state_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n updated_paths.extend(future.result())\r\n completed += 1\r\n seq_dir = future_map[future]\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n log(\"zip\", f\"{completed}/{total} {rel}\")\r\n\r\n updated_count = len(updated_paths) // 2\r\n log(\"zip\", f\"Updated {updated_count} sequence archive(s).\", verbose=verbose)\r\n if updated_paths:\r\n log(\r\n \"zip\",\r\n \"Archives updated. Stage manually with `git add Renders/_zipped`, if desired.\",\r\n verbose_only=True,\r\n verbose=verbose,\r\n )\r\n\r\n removed = cleanup_orphan_archives(verbose=verbose)\r\n if removed:\r\n log(\"zip\", f\"Removed {removed} orphan archive(s).\", verbose=verbose)\r\n\r\n return updated_count\r\n\r\n\r\ndef run_expand(worker_count: int, *, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n log(\"expand\", \"No archives to expand (missing 'Renders/_zipped').\")\r\n return 0\r\n\r\n work_items: list[tuple[Path, dict]] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n state_path = state_path_for(zip_path)\r\n seq_state = load_state(state_path)\r\n if seq_state is None:\r\n log(\"expand\", f\"Skipping {zip_path} (missing metadata)\")\r\n continue\r\n\r\n target_dir = sequence_dir_for(zip_path)\r\n if current_state(target_dir) == seq_state:\r\n continue\r\n\r\n work_items.append((zip_path, seq_state))\r\n\r\n if not work_items:\r\n log(\"expand\", \"Working folders already match archives; nothing to expand.\")\r\n return 0\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_expand, zip_path, seq_state, verbose=verbose): zip_path\r\n for zip_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n future.result()\r\n completed += 1\r\n zip_path = future_map[future]\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"expand\", f\"{completed}/{total} {rel}\")\r\n\r\n log(\"expand\", f\"Refreshed {len(work_items)} sequence folder(s).\", verbose=verbose)\r\n return len(work_items)\r\n\r\n\r\ndef cleanup_orphan_archives(*, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n return 0\r\n\r\n removed: list[Path] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n seq_dir = sequence_dir_for(zip_path)\r\n if seq_dir.exists():\r\n continue\r\n\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"zip\", f\"Removing orphan archive {rel}\", verbose_only=True, verbose=verbose)\r\n\r\n zip_path.unlink(missing_ok=True)\r\n state_path = state_path_for(zip_path)\r\n if state_path.exists():\r\n state_path.unlink()\r\n removed.append(zip_path)\r\n\r\n if not removed:\r\n return 0\r\n\r\n for parent in sorted({p.parent for p in removed}, key=lambda p: len(p.parts), reverse=True):\r\n if not parent.exists():\r\n continue\r\n while parent != ARCHIVE_ROOT and not any(parent.iterdir()):\r\n parent.rmdir()\r\n parent = parent.parent\r\n\r\n return len(removed)\r\n\r\n\r\ndef main() -> int:\r\n args = parse_args()\r\n log(\"init\", \"zip_sequences starting up...\")\r\n log(\"init\", f\"Working directory: {Path.cwd()}\")\r\n log(\"init\", f\"Mode: {args.mode}, zipper: {ZIPPER_TYPE}, jobs arg: {args.jobs or 'auto'}\")\r\n if ZIPPER_TYPE == \"7z\":\r\n exe = SEVEN_Z_EXE or \"not found\"\r\n max_inst = MAX_7Z_INSTANCES if MAX_7Z_INSTANCES is not None else \"auto\"\r\n log(\"init\", f\"7z executable: {exe}, Max7zInst: {max_inst}\")\r\n\r\n if args.mode == \"expand\":\r\n # For expand mode, use simple CPU-based worker calculation\r\n workers, _ = max_workers(args.jobs, work_items=None, verbose=args.verbose)\r\n run_expand(workers, verbose=args.verbose)\r\n return 0\r\n\r\n # For zip mode, work items will be calculated in run_zip\r\n updated = run_zip(args.jobs, verbose=args.verbose)\r\n return 0 if updated >= 0 else 1\r\n\r\n\r\nif __name__ == \"__main__\":\r\n try:\r\n raise SystemExit(main())\r\n except Exception as exc: # broad to surface unexpected errors cleanly\r\n print(f\"Sequence sync failed: {exc}\", file=sys.stderr)\r\n raise\r\n\r\n" +} +``` +User decision: **accepted** + +Status: **completed** + + +
+
+ +--- + +
Thought Process +**Augmenting run_zip with detailed logging**
+ +--- + + +
+Tool use: **grep** • Grep for "def compute_state" in "zip_sequences.py" • 1 match + +Output mode: content + + +| File | Content | Line | +|------|------|------| +| `zip_sequences.py` | `def compute_state(seq_dir: Path) -> dict:` | L482 | + + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + +
Thought Process +**Updating run_zip for logging and counters**
+ +--- + + +
+Tool use: **apply_patch** + + +Parameters: + +```json +{ + "relativeWorkspacePath": "zip_sequences.py" +} +``` +Additional data: + +```json +{ + "codeblockId": "ad47bbd1-38ad-4c77-bb5f-00b30a00f45c" +} +``` +Result: + +```json +{ + "diff": { + "chunks": [ + { + "diffString": " def run_zip(requested_workers: int | None, *, verbose: bool) -> int:\r\n work_items: list[tuple[Path, Path, Path, dict]] = []\r\n+ log(\"init\", f\"Scanning sequences under {RENDER_ROOT.resolve()}\")\r\n+ total_scanned = 0\r\n+ quick_skipped = 0\r\n+ state_skipped = 0\r\n+ empty_dirs = 0\r\n+ queued = 0\r\n \r\n if RENDER_ROOT.exists():\r\n for seq_dir in find_sequence_dirs(RENDER_ROOT):\r\n+ total_scanned += 1\r\n+ rel = seq_dir.relative_to(RENDER_ROOT)\r\n+ if total_scanned <= 5 or total_scanned % 10 == 0:\r\n+ log(\"scan\", f\"[{total_scanned}] Inspecting {rel}\")\r\n+ \r\n # Get the target archive path (will be .7z if ZIPPER_TYPE is \"7z\")\r\n zip_path = archive_path_for(seq_dir)\r", + "oldStart": 733, + "newStart": 733, + "oldLines": 7, + "newLines": 18, + "linesAdded": 11 + }, + { + "diffString": " # If directory wasn't modified since archive was created, skip state computation\r\n if dir_mtime <= archive_mtime:\r\n+ quick_skipped += 1\r\n+ if quick_skipped <= 5:\r\n+ log(\"scan\", f\"Skipping {rel} (unchanged since archive)\")\r\n # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete)\r\n if old_zip_path and old_zip_path.exists():\r", + "oldStart": 763, + "newStart": 774, + "oldLines": 4, + "newLines": 7, + "linesAdded": 3 + }, + { + "diffString": " seq_state = compute_state(seq_dir)\r\n if not seq_state[\"files\"]:\r\n+ empty_dirs += 1\r\n+ if empty_dirs <= 5:\r\n+ log(\"scan\", f\"{rel} has no files; skipping\")\r\n continue\r\n \r\n # Check if state changed\r\n if stored_state is not None and not state_changed(seq_state, stored_state):\r\n # Metadata matches stored state\r\n+ state_skipped += 1\r\n+ if state_skipped <= 5:\r\n+ log(\"scan\", f\"{rel} metadata unchanged; archive up to date\")\r\n if zip_path.exists():\r\n # .7z exists and is up to date, clean up old .zip if it exists\r", + "oldStart": 777, + "newStart": 791, + "oldLines": 9, + "newLines": 15, + "linesAdded": 6 + }, + { + "diffString": " \r\n work_items.append((seq_dir, zip_path, state_path, seq_state))\r\n+ queued += 1\r\n+ if queued <= 5 or queued % 5 == 0:\r\n+ total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n+ size_gb = total_bytes / (1024 ** 3)\r\n+ log(\"scan\", f\"Queued {rel} for compression (~{size_gb:.2f}GB) [{queued} total]\")\r\n \r\n if not work_items:\r", + "oldStart": 798, + "newStart": 818, + "oldLines": 4, + "newLines": 9, + "linesAdded": 5 + }, + { + "diffString": " else:\r\n log(\"zip\", \"Archives already up to date; no sequences needed zipping.\")\r\n+ log(\r\n+ \"scan\",\r\n+ f\"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, \"\r\n+ f\"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}\",\r\n+ )\r\n return 0\r\n \r\n # Calculate RAM-aware worker count based on work items\r\n worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)\r\n+ log(\r\n+ \"init\",\r\n+ f\"Preparing to compress {len(work_items)} sequence(s) with {worker_count} worker(s)\",\r\n+ )\r\n \r\n updated_paths: list[Path] = []\r", + "oldStart": 804, + "newStart": 829, + "oldLines": 8, + "newLines": 17, + "linesAdded": 9 + } + ], + "editor": "EDITOR_AI" + }, + "shouldAutoFixLints": true, + "resultForModel": "Success. Updated the following files:\nM zip_sequences.py", + "contentsAfterEdit": "#!/usr/bin/env python3\r\n\"\"\"Maintain zipped render sequences for Git hooks.\r\n\r\nDefault mode scans `Renders/`, produces ZIP archives under `Renders/_zipped/`,\r\nand stages any updated archives so commits only track compact files. Switch to\r\n`--mode expand` to inflate the tracked archives back into the ignored working\r\ndirectories after checkouts or pulls.\r\n\"\"\"\r\n\r\nfrom __future__ import annotations\r\n\r\nimport argparse\r\nimport json\r\nimport os\r\nimport platform\r\nimport shutil\r\nimport subprocess\r\nimport sys\r\nimport tempfile\r\nimport time\r\nfrom concurrent.futures import ThreadPoolExecutor, as_completed\r\nfrom pathlib import Path\r\nfrom typing import Iterator, Sequence\r\n\r\n# Try to import psutil for cross-platform RAM detection\r\ntry:\r\n import psutil\r\n HAS_PSUTIL = True\r\nexcept ImportError:\r\n HAS_PSUTIL = False\r\n # For Windows fallback\r\n if platform.system() == \"Windows\":\r\n try:\r\n import ctypes\r\n HAS_CTYPES = True\r\n except ImportError:\r\n HAS_CTYPES = False\r\n else:\r\n HAS_CTYPES = False\r\n\r\n\r\nRENDER_ROOT = Path(\"Renders\")\r\nARCHIVE_ROOT = RENDER_ROOT / \"_zipped\"\r\nSEQUENCE_EXTENSIONS = {\r\n \".png\",\r\n \".jpg\",\r\n \".jpeg\",\r\n \".tif\",\r\n \".tiff\",\r\n \".exr\",\r\n}\r\nSTATE_SUFFIX = \".meta.json\"\r\nDEFAULT_CONFIG = {\r\n \"zipper\": \"7z\",\r\n \"compression\": 9,\r\n \"dailyFormat\": \"daily_YYMMDD\",\r\n \"Max7zInst\": 0, # Maximum concurrent 7z instances (0 = auto-calculate)\r\n}\r\n\r\n\r\ndef log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n if verbose_only and not verbose:\r\n return\r\n print(f\"[{mode}] {message}\", flush=True)\r\n\r\n\r\ndef load_config() -> dict:\r\n # First try to load from project's .config folder (current working directory)\r\n # Then fall back to ProjectStructure repo config (next to zip_sequences.py)\r\n cwd = Path.cwd()\r\n project_config = cwd / \".config\" / \"config.json\"\r\n repo_config = Path(__file__).resolve().with_name(\"config.json\")\r\n \r\n config_paths = [\r\n (\"project\", project_config),\r\n (\"repo\", repo_config),\r\n ]\r\n \r\n log(\"init\", \"Loading configuration sources...\")\r\n for source, config_path in config_paths:\r\n try:\r\n if config_path.exists():\r\n log(\"init\", f\"Reading {source} config at {config_path}\")\r\n text = config_path.read_text(encoding=\"utf-8\")\r\n try:\r\n data = json.loads(text)\r\n if isinstance(data, dict):\r\n merged = DEFAULT_CONFIG.copy()\r\n merged.update(data)\r\n log(\"init\", f\"Configuration loaded from {source}\")\r\n return merged\r\n except json.JSONDecodeError:\r\n log(\"init\", f\"Config file at {config_path} is invalid JSON; skipping\")\r\n continue\r\n except OSError:\r\n log(\"init\", f\"Unable to read config at {config_path}; skipping\")\r\n continue\r\n \r\n # If no config found, return defaults\r\n log(\"init\", \"No config files found; using default settings\")\r\n return DEFAULT_CONFIG.copy()\r\n\r\n\r\nCONFIG = load_config()\r\nzipper_val = CONFIG.get(\"zipper\", \"7z\")\r\n# Handle both old boolean format and new string format\r\nif isinstance(zipper_val, bool):\r\n ZIPPER_TYPE = \"7z\" if zipper_val else \"zip\"\r\nelse:\r\n ZIPPER_TYPE = str(zipper_val).lower()\r\n\r\nCOMPRESSION_LEVEL = CONFIG.get(\"compression\", 9)\r\nif isinstance(COMPRESSION_LEVEL, str):\r\n try:\r\n COMPRESSION_LEVEL = int(COMPRESSION_LEVEL)\r\n except ValueError:\r\n COMPRESSION_LEVEL = 9\r\nif not isinstance(COMPRESSION_LEVEL, int):\r\n COMPRESSION_LEVEL = 9\r\nCOMPRESSION_LEVEL = max(0, min(9, COMPRESSION_LEVEL))\r\n\r\nMAX_7Z_INSTANCES = CONFIG.get(\"Max7zInst\", 0)\r\nif MAX_7Z_INSTANCES is not None:\r\n if isinstance(MAX_7Z_INSTANCES, str):\r\n try:\r\n MAX_7Z_INSTANCES = int(MAX_7Z_INSTANCES)\r\n except ValueError:\r\n MAX_7Z_INSTANCES = 0\r\n if not isinstance(MAX_7Z_INSTANCES, int) or MAX_7Z_INSTANCES < 1:\r\n MAX_7Z_INSTANCES = 0\r\n# Treat 0 as None (auto-calculate)\r\nif MAX_7Z_INSTANCES == 0:\r\n MAX_7Z_INSTANCES = None\r\n\r\nSEVEN_Z_EXE: str | None = None\r\nif ZIPPER_TYPE == \"7z\":\r\n SEVEN_Z_EXE = shutil.which(\"7z\") or shutil.which(\"7za\")\r\n\r\n\r\ndef parse_args() -> argparse.Namespace:\r\n parser = argparse.ArgumentParser(description=\"Sync render sequences with zipped archives.\")\r\n parser.add_argument(\r\n \"--mode\",\r\n choices=(\"zip\", \"expand\"),\r\n default=\"zip\",\r\n help=\"zip sequences for commit (default) or expand tracked archives\",\r\n )\r\n parser.add_argument(\"--jobs\", type=int, help=\"max parallel workers\")\r\n parser.add_argument(\"--verbose\", action=\"store_true\", help=\"print extra progress details\")\r\n return parser.parse_args()\r\n\r\n\r\ndef get_available_ram() -> int | None:\r\n \"\"\"Get available RAM in bytes, reserving 20% for system.\r\n \r\n Returns:\r\n Available RAM in bytes, or None if detection fails.\r\n \"\"\"\r\n try:\r\n if HAS_PSUTIL:\r\n # Use psutil for cross-platform RAM detection\r\n mem = psutil.virtual_memory()\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem.total * 0.8)\r\n return available\r\n elif HAS_CTYPES and platform.system() == \"Windows\":\r\n # Windows fallback using ctypes\r\n class MEMORYSTATUSEX(ctypes.Structure):\r\n _fields_ = [\r\n (\"dwLength\", ctypes.c_ulong),\r\n (\"dwMemoryLoad\", ctypes.c_ulong),\r\n (\"ullTotalPhys\", ctypes.c_ulonglong),\r\n (\"ullAvailPhys\", ctypes.c_ulonglong),\r\n (\"ullTotalPageFile\", ctypes.c_ulonglong),\r\n (\"ullAvailPageFile\", ctypes.c_ulonglong),\r\n (\"ullTotalVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailExtendedVirtual\", ctypes.c_ulonglong),\r\n ]\r\n \r\n kernel32 = ctypes.windll.kernel32\r\n kernel32.GlobalMemoryStatusEx.argtypes = [ctypes.POINTER(MEMORYSTATUSEX)]\r\n kernel32.GlobalMemoryStatusEx.restype = ctypes.c_bool\r\n \r\n mem_status = MEMORYSTATUSEX()\r\n mem_status.dwLength = ctypes.sizeof(MEMORYSTATUSEX)\r\n \r\n if kernel32.GlobalMemoryStatusEx(ctypes.byref(mem_status)):\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem_status.ullTotalPhys * 0.8)\r\n return available\r\n except Exception:\r\n pass\r\n \r\n return None\r\n\r\n\r\ndef estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int:\r\n \"\"\"Estimate RAM usage per compression job based on folder size.\r\n \r\n Args:\r\n seq_dir: Path to the sequence directory\r\n seq_state: State dictionary containing file information\r\n \r\n Returns:\r\n Estimated RAM usage in bytes\r\n \"\"\"\r\n # Calculate total folder size from seq_state\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n \r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations)\r\n # This is the main memory consumer for 7z LZMA compression\r\n dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary\r\n \r\n # Input buffer: 7z processes in chunks, doesn't need full file in RAM\r\n # Use 15% of sequence size, capped at 2GB\r\n input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024)\r\n \r\n # Compression overhead: additional memory for compression process\r\n overhead = 1 * 1024 * 1024 * 1024 # 1GB\r\n \r\n # Total RAM estimate\r\n estimated_ram = dict_ram + input_buffer + overhead\r\n \r\n return estimated_ram\r\n else:\r\n # zip compression is more memory-efficient\r\n # Conservative estimate: 1GB per job\r\n return 1024 * 1024 * 1024 # 1 GB\r\n\r\n\r\ndef max_workers(\r\n requested: int | None,\r\n work_items: list[tuple[Path, Path, Path, dict]] | None = None,\r\n *,\r\n verbose: bool = False\r\n) -> tuple[int, int | None]:\r\n \"\"\"Calculate maximum worker count based on CPU and RAM constraints.\r\n \r\n Args:\r\n requested: User-requested worker count (from --jobs)\r\n work_items: List of work items (seq_dir, zip_path, state_path, seq_state)\r\n verbose: Whether to log RAM-based calculations\r\n \r\n Returns:\r\n Tuple of (worker_count, per_job_memory_limit_bytes)\r\n per_job_memory_limit_bytes is None if not using 7z or RAM detection failed\r\n \"\"\"\r\n cpu = os.cpu_count() or 1\r\n cpu_limit = max(1, min(8, cpu))\r\n if requested and requested > 0:\r\n cpu_limit = min(requested, max(1, cpu))\r\n \r\n # If no work items provided, return CPU-based limit\r\n if work_items is None or len(work_items) == 0:\r\n return (cpu_limit, {})\r\n \r\n # Try to calculate RAM-based limit\r\n available_ram = get_available_ram()\r\n \r\n if available_ram is None:\r\n # RAM detection failed, fall back to CPU limit\r\n if verbose:\r\n log(\"zip\", \"RAM detection failed, using CPU-based worker limit\", verbose_only=True, verbose=verbose)\r\n return (cpu_limit, {})\r\n \r\n # For 7z: use fixed dictionary size and calculate workers\r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n fixed_dict_size_bytes = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Check if Max7zInst is configured\r\n if MAX_7Z_INSTANCES is not None:\r\n # Use configured maximum instances, but still respect user's --jobs and work items\r\n final_limit = MAX_7Z_INSTANCES\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n final_limit = min(final_limit, num_work_items)\r\n if requested and requested > 0:\r\n final_limit = min(final_limit, requested)\r\n \r\n # Create RAM limits dict (all use fixed dict size, but return as dict for consistency)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = fixed_dict_size_bytes\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"Using Max7zInst={MAX_7Z_INSTANCES} from config → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n \r\n # Auto-calculate based on RAM if Max7zInst not configured\r\n # Use bin-packing algorithm with size-aware RAM estimation\r\n if available_ram is not None:\r\n # available_ram is already 80% of total (20% reserved for system)\r\n # Use 95% of available RAM for compression jobs\r\n compression_ram = int(available_ram * 0.95)\r\n \r\n # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item)\r\n work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n \r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use a safe default (12GB minimum for 1GB dict)\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB\r\n work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n # Sort by estimated RAM (largest first) for bin-packing\r\n work_items_with_ram.sort(key=lambda x: x[1], reverse=True)\r\n \r\n # Bin-packing algorithm: pack largest items first\r\n bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = []\r\n bin_remaining: list[int] = []\r\n \r\n for seq_dir, estimated_ram, work_item in work_items_with_ram:\r\n # Try to fit in existing bin\r\n placed = False\r\n for i, remaining in enumerate(bin_remaining):\r\n if remaining >= estimated_ram:\r\n bins[i].append((seq_dir, estimated_ram, work_item))\r\n bin_remaining[i] -= estimated_ram\r\n placed = True\r\n break\r\n \r\n # If doesn't fit, create new bin\r\n if not placed:\r\n bins.append([(seq_dir, estimated_ram, work_item)])\r\n bin_remaining.append(compression_ram - estimated_ram)\r\n \r\n # Worker count is number of bins\r\n worker_count = len(bins)\r\n \r\n # Cap at number of actual work items (can't have more workers than jobs)\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n worker_count = min(worker_count, num_work_items)\r\n \r\n # Respect user's --jobs if provided\r\n if requested and requested > 0:\r\n worker_count = min(worker_count, requested)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n compression_ram_gb = compression_ram / (1024 ** 3)\r\n total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n if len(bins) > 0:\r\n bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins]\r\n log(\r\n \"zip\",\r\n f\"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Final worker count: {worker_count} (requested: {requested})\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n # Return worker count and RAM limits dict\r\n return (worker_count, ram_limits_dict)\r\n \r\n # RAM detection failed, use a safe default (no CPU limit)\r\n default_limit = 4\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n default_limit = min(default_limit, num_work_items)\r\n if requested and requested > 0:\r\n default_limit = min(default_limit, requested)\r\n \r\n # Create RAM limits dict with safe defaults (12GB per job for 1GB dict)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB default\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"RAM detection failed and Max7zInst not set, using default worker limit → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {default_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n return (default_limit, ram_limits_dict)\r\n \r\n # For zip compression, use existing estimation-based approach\r\n # Estimate RAM per job for each work item\r\n ram_estimates = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n ram_estimates.append(estimated_ram)\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use fallback estimate\r\n fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip\r\n ram_estimates.append(fallback_ram)\r\n ram_limits_dict[seq_dir] = fallback_ram\r\n \r\n if not ram_estimates:\r\n return (cpu_limit, {})\r\n \r\n max_ram_per_job = max(ram_estimates)\r\n ram_limit = max(1, available_ram // max_ram_per_job)\r\n ram_limit = min(ram_limit, 6) # Conservative limit for zip\r\n final_limit = min(cpu_limit, ram_limit)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n max_ram_gb = max_ram_per_job / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available, ~{max_ram_gb:.1f}GB per job → \"\r\n f\"RAM limit: {ram_limit}, CPU limit: {cpu_limit}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n\r\n\r\ndef is_archive_path(path: Path) -> bool:\r\n return any(part in (\"_archive\", \"_CURRENT\") for part in path.parts)\r\n\r\n\r\ndef find_sequence_dirs(root: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(root):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n has_frames = any(Path(dirpath, f).suffix.lower() in SEQUENCE_EXTENSIONS for f in filenames)\r\n if has_frames:\r\n yield path\r\n\r\n\r\ndef iter_sequence_files(seq_dir: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(seq_dir):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n for filename in filenames:\r\n yield path / filename\r\n\r\n\r\ndef compute_state(seq_dir: Path) -> dict:\r\n entries = []\r\n files = sorted(\r\n iter_sequence_files(seq_dir),\r\n key=lambda p: p.relative_to(seq_dir).as_posix(),\r\n )\r\n for file_path in files:\r\n stat = file_path.stat()\r\n entries.append(\r\n {\r\n \"path\": file_path.relative_to(seq_dir).as_posix(),\r\n \"size\": stat.st_size,\r\n \"mtime_ns\": stat.st_mtime_ns,\r\n }\r\n )\r\n return {\"files\": entries}\r\n\r\n\r\ndef current_state(seq_dir: Path) -> dict:\r\n if not seq_dir.exists() or not seq_dir.is_dir():\r\n return {\"files\": []}\r\n return compute_state(seq_dir)\r\n\r\n\r\ndef load_state(state_path: Path) -> dict | None:\r\n if not state_path.exists():\r\n return None\r\n try:\r\n return json.loads(state_path.read_text())\r\n except json.JSONDecodeError:\r\n return None\r\n\r\n\r\ndef state_changed(seq_state: dict, stored_state: dict | None) -> bool:\r\n if stored_state is None:\r\n return True\r\n return seq_state != stored_state\r\n\r\n\r\ndef archive_path_for(seq_dir: Path) -> Path:\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n suffix = \".7z\" if ZIPPER_TYPE == \"7z\" else \".zip\"\r\n return (ARCHIVE_ROOT / rel).with_suffix(suffix)\r\n\r\n\r\ndef sequence_dir_for(zip_path: Path) -> Path:\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n return (RENDER_ROOT / rel).with_suffix(\"\")\r\n\r\n\r\ndef state_path_for(zip_path: Path) -> Path:\r\n return zip_path.with_suffix(zip_path.suffix + STATE_SUFFIX)\r\n\r\n\r\ndef zip_sequence(seq_dir: Path, zip_path: Path, per_job_memory_limit: int | None = None) -> None:\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z compression requested but 7z executable not found in PATH. \"\r\n \"Please install 7z (e.g., via Chocolatey: choco install 7zip) \"\r\n \"or set zipper to 'zip' in config.json\"\r\n )\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n \r\n # If creating a .7z file, remove any existing .zip file for the same sequence\r\n if zip_path.suffix == \".7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n \r\n # Build list of files to archive with relative paths\r\n file_list = []\r\n for file_path in iter_sequence_files(seq_dir):\r\n rel_path = file_path.relative_to(seq_dir).as_posix()\r\n file_list.append(rel_path)\r\n \r\n if not file_list:\r\n raise RuntimeError(f\"No files found to archive in {seq_dir}\")\r\n \r\n # Create zip in temporary location first to avoid issues with corrupted existing files\r\n temp_zip = None\r\n list_file_path = None\r\n try:\r\n # Create temporary archive file path (but don't create the file - let 7z create it)\r\n temp_zip_path = tempfile.mktemp(suffix=\".7z\", dir=zip_path.parent)\r\n temp_zip = Path(temp_zip_path)\r\n \r\n # Create list file with absolute path\r\n fd, temp_path = tempfile.mkstemp(suffix=\".lst\", text=True)\r\n list_file_path = Path(temp_path)\r\n with os.fdopen(fd, \"w\", encoding=\"utf-8\") as list_file:\r\n for rel_path in file_list:\r\n list_file.write(rel_path + \"\\n\")\r\n list_file.flush()\r\n os.fsync(list_file.fileno()) # Ensure data is written to disk\r\n # File is closed here by context manager, small delay to ensure OS releases handle\r\n time.sleep(0.1)\r\n \r\n # Use absolute paths for both list file and temp zip\r\n list_file_abs = list_file_path.resolve()\r\n temp_zip_abs = temp_zip.resolve()\r\n # Create archive in temp location first (7z will create it fresh)\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"a\",\r\n \"-y\",\r\n \"-bb0\", # Suppress progress output\r\n f\"-mx={COMPRESSION_LEVEL}\",\r\n \"-t7z\", # Use 7z format, not zip\r\n ]\r\n \r\n # Always use fixed dictionary size: 1GB (1024MB)\r\n # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only)\r\n # We keep dictionary at 1GB for best compression regardless of RAM estimate\r\n FIXED_DICT_SIZE_MB = 1024\r\n cmd.append(f\"-md={FIXED_DICT_SIZE_MB}m\")\r\n \r\n cmd.extend([\r\n str(temp_zip_abs),\r\n f\"@{list_file_abs}\",\r\n ])\r\n result = subprocess.run(\r\n cmd,\r\n cwd=seq_dir,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z compression failed: {error_msg}\")\r\n \r\n # Move temp zip to final location, replacing any existing file\r\n if zip_path.exists():\r\n zip_path.unlink()\r\n temp_zip.replace(zip_path)\r\n temp_zip = None # Mark as moved so we don't delete it\r\n finally:\r\n # Clean up temp zip if it wasn't moved\r\n if temp_zip and temp_zip.exists():\r\n try:\r\n temp_zip.unlink(missing_ok=True)\r\n except OSError:\r\n pass\r\n # Clean up list file, with retry in case 7z still has it open\r\n if list_file_path and list_file_path.exists():\r\n for attempt in range(3):\r\n try:\r\n list_file_path.unlink(missing_ok=True)\r\n break\r\n except PermissionError:\r\n if attempt < 2:\r\n time.sleep(0.1) # Wait 100ms before retry\r\n else:\r\n # Last attempt failed, just log and continue\r\n # The temp file will be cleaned up by the OS eventually\r\n pass\r\n return\r\n\r\n # Use zipfile (only if ZIPPER_TYPE == \"zip\")\r\n if ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZIP_DEFLATED, ZIP_STORED, ZipFile\r\n\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n if COMPRESSION_LEVEL <= 0:\r\n compression = ZIP_STORED\r\n zip_kwargs = {}\r\n else:\r\n compression = ZIP_DEFLATED\r\n zip_kwargs = {\"compresslevel\": COMPRESSION_LEVEL}\r\n\r\n with ZipFile(zip_path, \"w\", compression=compression, **zip_kwargs) as archive:\r\n for file_path in iter_sequence_files(seq_dir):\r\n archive.write(file_path, arcname=file_path.relative_to(seq_dir).as_posix())\r\n return\r\n\r\n # Unknown ZIPPER_TYPE - fail with clear error\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n\r\ndef expand_sequence(zip_path: Path, seq_state: dict) -> None:\r\n target_dir = sequence_dir_for(zip_path)\r\n if target_dir.exists():\r\n shutil.rmtree(target_dir)\r\n target_dir.mkdir(parents=True, exist_ok=True)\r\n\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z extraction requested but 7z executable not found in PATH. \"\r\n \"Please install 7z or set zipper to 'zip' in config.json\"\r\n )\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"x\",\r\n \"-y\",\r\n str(zip_path),\r\n f\"-o{target_dir}\",\r\n ]\r\n result = subprocess.run(\r\n cmd,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z extraction failed: {error_msg}\")\r\n elif ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZipFile\r\n\r\n with ZipFile(zip_path, \"r\") as archive:\r\n archive.extractall(target_dir)\r\n else:\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n for entry in seq_state.get(\"files\", []):\r\n file_path = target_dir / entry[\"path\"]\r\n if file_path.exists():\r\n os.utime(file_path, ns=(entry[\"mtime_ns\"], entry[\"mtime_ns\"]))\r\n\r\n\r\ndef process_zip(seq_dir: Path, zip_path: Path, state_path: Path, seq_state: dict, per_job_memory_limit: int | None, *, verbose: bool) -> Sequence[Path]:\r\n log(\"zip\", f\"{seq_dir} -> {zip_path}\", verbose_only=True, verbose=verbose)\r\n zip_sequence(seq_dir, zip_path, per_job_memory_limit)\r\n state_path.write_text(json.dumps(seq_state, indent=2))\r\n return (zip_path, state_path)\r\n\r\n\r\ndef process_expand(zip_path: Path, state: dict, *, verbose: bool) -> None:\r\n log(\"expand\", f\"{zip_path} -> {sequence_dir_for(zip_path)}\", verbose_only=True, verbose=verbose)\r\n expand_sequence(zip_path, state)\r\n\r\n\r\ndef run_zip(requested_workers: int | None, *, verbose: bool) -> int:\r\n work_items: list[tuple[Path, Path, Path, dict]] = []\r\n log(\"init\", f\"Scanning sequences under {RENDER_ROOT.resolve()}\")\r\n total_scanned = 0\r\n quick_skipped = 0\r\n state_skipped = 0\r\n empty_dirs = 0\r\n queued = 0\r\n\r\n if RENDER_ROOT.exists():\r\n for seq_dir in find_sequence_dirs(RENDER_ROOT):\r\n total_scanned += 1\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n if total_scanned <= 5 or total_scanned % 10 == 0:\r\n log(\"scan\", f\"[{total_scanned}] Inspecting {rel}\")\r\n\r\n # Get the target archive path (will be .7z if ZIPPER_TYPE is \"7z\")\r\n zip_path = archive_path_for(seq_dir)\r\n state_path = state_path_for(zip_path)\r\n \r\n # Quick check: if archive exists, load stored state first (fast)\r\n stored_state = load_state(state_path)\r\n \r\n # Check if we need to upgrade from .zip to .7z\r\n old_zip_path = None\r\n old_stored_state = None\r\n if ZIPPER_TYPE == \"7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_state_path = state_path_for(old_zip_path)\r\n old_stored_state = load_state(old_state_path)\r\n # If old .zip exists and .7z doesn't, use old .zip's state for comparison\r\n if not zip_path.exists() and old_stored_state is not None:\r\n stored_state = old_stored_state\r\n \r\n # If .7z archive exists and we have stored state, do quick check before computing full state\r\n if zip_path.exists() and stored_state is not None:\r\n # Quick check: if directory mtime is older than archive, likely unchanged\r\n try:\r\n dir_mtime = seq_dir.stat().st_mtime_ns\r\n archive_mtime = zip_path.stat().st_mtime_ns\r\n # If directory wasn't modified since archive was created, skip state computation\r\n if dir_mtime <= archive_mtime:\r\n quick_skipped += 1\r\n if quick_skipped <= 5:\r\n log(\"scan\", f\"Skipping {rel} (unchanged since archive)\")\r\n # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete)\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n continue\r\n except OSError:\r\n # If stat fails, fall through to full state computation\r\n pass\r\n \r\n # Compute current state only if we need to\r\n seq_state = compute_state(seq_dir)\r\n if not seq_state[\"files\"]:\r\n empty_dirs += 1\r\n if empty_dirs <= 5:\r\n log(\"scan\", f\"{rel} has no files; skipping\")\r\n continue\r\n \r\n # Check if state changed\r\n if stored_state is not None and not state_changed(seq_state, stored_state):\r\n # Metadata matches stored state\r\n state_skipped += 1\r\n if state_skipped <= 5:\r\n log(\"scan\", f\"{rel} metadata unchanged; archive up to date\")\r\n if zip_path.exists():\r\n # .7z exists and is up to date, clean up old .zip if it exists\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n elif old_zip_path and old_zip_path.exists() and old_stored_state is not None:\r\n # .7z doesn't exist, but .zip exists and metadata matches\r\n # Keep the .zip file, don't create .7z\r\n continue\r\n else:\r\n # No archive exists, but state matches (shouldn't happen, but be safe)\r\n continue\r\n\r\n work_items.append((seq_dir, zip_path, state_path, seq_state))\r\n queued += 1\r\n if queued <= 5 or queued % 5 == 0:\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n size_gb = total_bytes / (1024 ** 3)\r\n log(\"scan\", f\"Queued {rel} for compression (~{size_gb:.2f}GB) [{queued} total]\")\r\n\r\n if not work_items:\r\n if not RENDER_ROOT.exists():\r\n log(\"zip\", \"Render root 'Renders' not found; nothing to zip.\")\r\n else:\r\n log(\"zip\", \"Archives already up to date; no sequences needed zipping.\")\r\n log(\r\n \"scan\",\r\n f\"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, \"\r\n f\"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}\",\r\n )\r\n return 0\r\n\r\n # Calculate RAM-aware worker count based on work items\r\n worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)\r\n log(\r\n \"init\",\r\n f\"Preparing to compress {len(work_items)} sequence(s) with {worker_count} worker(s)\",\r\n )\r\n\r\n updated_paths: list[Path] = []\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir\r\n for seq_dir, zip_path, state_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n updated_paths.extend(future.result())\r\n completed += 1\r\n seq_dir = future_map[future]\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n log(\"zip\", f\"{completed}/{total} {rel}\")\r\n\r\n updated_count = len(updated_paths) // 2\r\n log(\"zip\", f\"Updated {updated_count} sequence archive(s).\", verbose=verbose)\r\n if updated_paths:\r\n log(\r\n \"zip\",\r\n \"Archives updated. Stage manually with `git add Renders/_zipped`, if desired.\",\r\n verbose_only=True,\r\n verbose=verbose,\r\n )\r\n\r\n removed = cleanup_orphan_archives(verbose=verbose)\r\n if removed:\r\n log(\"zip\", f\"Removed {removed} orphan archive(s).\", verbose=verbose)\r\n\r\n return updated_count\r\n\r\n\r\ndef run_expand(worker_count: int, *, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n log(\"expand\", \"No archives to expand (missing 'Renders/_zipped').\")\r\n return 0\r\n\r\n work_items: list[tuple[Path, dict]] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n state_path = state_path_for(zip_path)\r\n seq_state = load_state(state_path)\r\n if seq_state is None:\r\n log(\"expand\", f\"Skipping {zip_path} (missing metadata)\")\r\n continue\r\n\r\n target_dir = sequence_dir_for(zip_path)\r\n if current_state(target_dir) == seq_state:\r\n continue\r\n\r\n work_items.append((zip_path, seq_state))\r\n\r\n if not work_items:\r\n log(\"expand\", \"Working folders already match archives; nothing to expand.\")\r\n return 0\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_expand, zip_path, seq_state, verbose=verbose): zip_path\r\n for zip_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n future.result()\r\n completed += 1\r\n zip_path = future_map[future]\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"expand\", f\"{completed}/{total} {rel}\")\r\n\r\n log(\"expand\", f\"Refreshed {len(work_items)} sequence folder(s).\", verbose=verbose)\r\n return len(work_items)\r\n\r\n\r\ndef cleanup_orphan_archives(*, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n return 0\r\n\r\n removed: list[Path] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n seq_dir = sequence_dir_for(zip_path)\r\n if seq_dir.exists():\r\n continue\r\n\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"zip\", f\"Removing orphan archive {rel}\", verbose_only=True, verbose=verbose)\r\n\r\n zip_path.unlink(missing_ok=True)\r\n state_path = state_path_for(zip_path)\r\n if state_path.exists():\r\n state_path.unlink()\r\n removed.append(zip_path)\r\n\r\n if not removed:\r\n return 0\r\n\r\n for parent in sorted({p.parent for p in removed}, key=lambda p: len(p.parts), reverse=True):\r\n if not parent.exists():\r\n continue\r\n while parent != ARCHIVE_ROOT and not any(parent.iterdir()):\r\n parent.rmdir()\r\n parent = parent.parent\r\n\r\n return len(removed)\r\n\r\n\r\ndef main() -> int:\r\n args = parse_args()\r\n log(\"init\", \"zip_sequences starting up...\")\r\n log(\"init\", f\"Working directory: {Path.cwd()}\")\r\n log(\"init\", f\"Mode: {args.mode}, zipper: {ZIPPER_TYPE}, jobs arg: {args.jobs or 'auto'}\")\r\n if ZIPPER_TYPE == \"7z\":\r\n exe = SEVEN_Z_EXE or \"not found\"\r\n max_inst = MAX_7Z_INSTANCES if MAX_7Z_INSTANCES is not None else \"auto\"\r\n log(\"init\", f\"7z executable: {exe}, Max7zInst: {max_inst}\")\r\n\r\n if args.mode == \"expand\":\r\n # For expand mode, use simple CPU-based worker calculation\r\n workers, _ = max_workers(args.jobs, work_items=None, verbose=args.verbose)\r\n run_expand(workers, verbose=args.verbose)\r\n return 0\r\n\r\n # For zip mode, work items will be calculated in run_zip\r\n updated = run_zip(args.jobs, verbose=args.verbose)\r\n return 0 if updated >= 0 else 1\r\n\r\n\r\nif __name__ == \"__main__\":\r\n try:\r\n raise SystemExit(main())\r\n except Exception as exc: # broad to surface unexpected errors cleanly\r\n print(f\"Sequence sync failed: {exc}\", file=sys.stderr)\r\n raise\r\n\r\n" +} +``` +User decision: **accepted** + +Status: **completed** + + +
+
+ +--- + +
Thought Process +**Planning summary log addition**
+ +--- + + +
+Tool use: **grep** • Grep for "Updated \{updated_count\} sequence archive" in "zip_sequences.py" • 1 match + +Output mode: content + + +| File | Content | Line | +|------|------|------| +| `zip_sequences.py` | `log("zip", f"Updated \{updated_count\} sequence archive(s).", verbose=verbose)` | L864 | + + +
+
+ +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + +
Thought Process +**Adding summary after log before cleanup**
+ +--- + + +
+Tool use: **apply_patch** + + +Parameters: + +```json +{ + "relativeWorkspacePath": "zip_sequences.py" +} +``` +Additional data: + +```json +{ + "codeblockId": "69338b80-bad8-4240-beb7-a2e2f95c8c3f" +} +``` +Result: + +```json +{ + "diff": { + "chunks": [ + { + "diffString": " verbose=verbose,\r\n )\r\n+ log(\r\n+ \"scan\",\r\n+ f\"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, \"\r\n+ f\"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}\",\r\n+ )\r\n \r\n removed = cleanup_orphan_archives(verbose=verbose)\r", + "oldStart": 870, + "newStart": 870, + "oldLines": 4, + "newLines": 9, + "linesAdded": 5 + } + ], + "editor": "EDITOR_AI" + }, + "shouldAutoFixLints": true, + "resultForModel": "Success. Updated the following files:\nM zip_sequences.py", + "contentsAfterEdit": "#!/usr/bin/env python3\r\n\"\"\"Maintain zipped render sequences for Git hooks.\r\n\r\nDefault mode scans `Renders/`, produces ZIP archives under `Renders/_zipped/`,\r\nand stages any updated archives so commits only track compact files. Switch to\r\n`--mode expand` to inflate the tracked archives back into the ignored working\r\ndirectories after checkouts or pulls.\r\n\"\"\"\r\n\r\nfrom __future__ import annotations\r\n\r\nimport argparse\r\nimport json\r\nimport os\r\nimport platform\r\nimport shutil\r\nimport subprocess\r\nimport sys\r\nimport tempfile\r\nimport time\r\nfrom concurrent.futures import ThreadPoolExecutor, as_completed\r\nfrom pathlib import Path\r\nfrom typing import Iterator, Sequence\r\n\r\n# Try to import psutil for cross-platform RAM detection\r\ntry:\r\n import psutil\r\n HAS_PSUTIL = True\r\nexcept ImportError:\r\n HAS_PSUTIL = False\r\n # For Windows fallback\r\n if platform.system() == \"Windows\":\r\n try:\r\n import ctypes\r\n HAS_CTYPES = True\r\n except ImportError:\r\n HAS_CTYPES = False\r\n else:\r\n HAS_CTYPES = False\r\n\r\n\r\nRENDER_ROOT = Path(\"Renders\")\r\nARCHIVE_ROOT = RENDER_ROOT / \"_zipped\"\r\nSEQUENCE_EXTENSIONS = {\r\n \".png\",\r\n \".jpg\",\r\n \".jpeg\",\r\n \".tif\",\r\n \".tiff\",\r\n \".exr\",\r\n}\r\nSTATE_SUFFIX = \".meta.json\"\r\nDEFAULT_CONFIG = {\r\n \"zipper\": \"7z\",\r\n \"compression\": 9,\r\n \"dailyFormat\": \"daily_YYMMDD\",\r\n \"Max7zInst\": 0, # Maximum concurrent 7z instances (0 = auto-calculate)\r\n}\r\n\r\n\r\ndef log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None:\r\n if verbose_only and not verbose:\r\n return\r\n print(f\"[{mode}] {message}\", flush=True)\r\n\r\n\r\ndef load_config() -> dict:\r\n # First try to load from project's .config folder (current working directory)\r\n # Then fall back to ProjectStructure repo config (next to zip_sequences.py)\r\n cwd = Path.cwd()\r\n project_config = cwd / \".config\" / \"config.json\"\r\n repo_config = Path(__file__).resolve().with_name(\"config.json\")\r\n \r\n config_paths = [\r\n (\"project\", project_config),\r\n (\"repo\", repo_config),\r\n ]\r\n \r\n log(\"init\", \"Loading configuration sources...\")\r\n for source, config_path in config_paths:\r\n try:\r\n if config_path.exists():\r\n log(\"init\", f\"Reading {source} config at {config_path}\")\r\n text = config_path.read_text(encoding=\"utf-8\")\r\n try:\r\n data = json.loads(text)\r\n if isinstance(data, dict):\r\n merged = DEFAULT_CONFIG.copy()\r\n merged.update(data)\r\n log(\"init\", f\"Configuration loaded from {source}\")\r\n return merged\r\n except json.JSONDecodeError:\r\n log(\"init\", f\"Config file at {config_path} is invalid JSON; skipping\")\r\n continue\r\n except OSError:\r\n log(\"init\", f\"Unable to read config at {config_path}; skipping\")\r\n continue\r\n \r\n # If no config found, return defaults\r\n log(\"init\", \"No config files found; using default settings\")\r\n return DEFAULT_CONFIG.copy()\r\n\r\n\r\nCONFIG = load_config()\r\nzipper_val = CONFIG.get(\"zipper\", \"7z\")\r\n# Handle both old boolean format and new string format\r\nif isinstance(zipper_val, bool):\r\n ZIPPER_TYPE = \"7z\" if zipper_val else \"zip\"\r\nelse:\r\n ZIPPER_TYPE = str(zipper_val).lower()\r\n\r\nCOMPRESSION_LEVEL = CONFIG.get(\"compression\", 9)\r\nif isinstance(COMPRESSION_LEVEL, str):\r\n try:\r\n COMPRESSION_LEVEL = int(COMPRESSION_LEVEL)\r\n except ValueError:\r\n COMPRESSION_LEVEL = 9\r\nif not isinstance(COMPRESSION_LEVEL, int):\r\n COMPRESSION_LEVEL = 9\r\nCOMPRESSION_LEVEL = max(0, min(9, COMPRESSION_LEVEL))\r\n\r\nMAX_7Z_INSTANCES = CONFIG.get(\"Max7zInst\", 0)\r\nif MAX_7Z_INSTANCES is not None:\r\n if isinstance(MAX_7Z_INSTANCES, str):\r\n try:\r\n MAX_7Z_INSTANCES = int(MAX_7Z_INSTANCES)\r\n except ValueError:\r\n MAX_7Z_INSTANCES = 0\r\n if not isinstance(MAX_7Z_INSTANCES, int) or MAX_7Z_INSTANCES < 1:\r\n MAX_7Z_INSTANCES = 0\r\n# Treat 0 as None (auto-calculate)\r\nif MAX_7Z_INSTANCES == 0:\r\n MAX_7Z_INSTANCES = None\r\n\r\nSEVEN_Z_EXE: str | None = None\r\nif ZIPPER_TYPE == \"7z\":\r\n SEVEN_Z_EXE = shutil.which(\"7z\") or shutil.which(\"7za\")\r\n\r\n\r\ndef parse_args() -> argparse.Namespace:\r\n parser = argparse.ArgumentParser(description=\"Sync render sequences with zipped archives.\")\r\n parser.add_argument(\r\n \"--mode\",\r\n choices=(\"zip\", \"expand\"),\r\n default=\"zip\",\r\n help=\"zip sequences for commit (default) or expand tracked archives\",\r\n )\r\n parser.add_argument(\"--jobs\", type=int, help=\"max parallel workers\")\r\n parser.add_argument(\"--verbose\", action=\"store_true\", help=\"print extra progress details\")\r\n return parser.parse_args()\r\n\r\n\r\ndef get_available_ram() -> int | None:\r\n \"\"\"Get available RAM in bytes, reserving 20% for system.\r\n \r\n Returns:\r\n Available RAM in bytes, or None if detection fails.\r\n \"\"\"\r\n try:\r\n if HAS_PSUTIL:\r\n # Use psutil for cross-platform RAM detection\r\n mem = psutil.virtual_memory()\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem.total * 0.8)\r\n return available\r\n elif HAS_CTYPES and platform.system() == \"Windows\":\r\n # Windows fallback using ctypes\r\n class MEMORYSTATUSEX(ctypes.Structure):\r\n _fields_ = [\r\n (\"dwLength\", ctypes.c_ulong),\r\n (\"dwMemoryLoad\", ctypes.c_ulong),\r\n (\"ullTotalPhys\", ctypes.c_ulonglong),\r\n (\"ullAvailPhys\", ctypes.c_ulonglong),\r\n (\"ullTotalPageFile\", ctypes.c_ulonglong),\r\n (\"ullAvailPageFile\", ctypes.c_ulonglong),\r\n (\"ullTotalVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailVirtual\", ctypes.c_ulonglong),\r\n (\"ullAvailExtendedVirtual\", ctypes.c_ulonglong),\r\n ]\r\n \r\n kernel32 = ctypes.windll.kernel32\r\n kernel32.GlobalMemoryStatusEx.argtypes = [ctypes.POINTER(MEMORYSTATUSEX)]\r\n kernel32.GlobalMemoryStatusEx.restype = ctypes.c_bool\r\n \r\n mem_status = MEMORYSTATUSEX()\r\n mem_status.dwLength = ctypes.sizeof(MEMORYSTATUSEX)\r\n \r\n if kernel32.GlobalMemoryStatusEx(ctypes.byref(mem_status)):\r\n # Reserve 20% for system, use 80% for compression jobs\r\n available = int(mem_status.ullTotalPhys * 0.8)\r\n return available\r\n except Exception:\r\n pass\r\n \r\n return None\r\n\r\n\r\ndef estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int:\r\n \"\"\"Estimate RAM usage per compression job based on folder size.\r\n \r\n Args:\r\n seq_dir: Path to the sequence directory\r\n seq_state: State dictionary containing file information\r\n \r\n Returns:\r\n Estimated RAM usage in bytes\r\n \"\"\"\r\n # Calculate total folder size from seq_state\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n \r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations)\r\n # This is the main memory consumer for 7z LZMA compression\r\n dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary\r\n \r\n # Input buffer: 7z processes in chunks, doesn't need full file in RAM\r\n # Use 15% of sequence size, capped at 2GB\r\n input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024)\r\n \r\n # Compression overhead: additional memory for compression process\r\n overhead = 1 * 1024 * 1024 * 1024 # 1GB\r\n \r\n # Total RAM estimate\r\n estimated_ram = dict_ram + input_buffer + overhead\r\n \r\n return estimated_ram\r\n else:\r\n # zip compression is more memory-efficient\r\n # Conservative estimate: 1GB per job\r\n return 1024 * 1024 * 1024 # 1 GB\r\n\r\n\r\ndef max_workers(\r\n requested: int | None,\r\n work_items: list[tuple[Path, Path, Path, dict]] | None = None,\r\n *,\r\n verbose: bool = False\r\n) -> tuple[int, int | None]:\r\n \"\"\"Calculate maximum worker count based on CPU and RAM constraints.\r\n \r\n Args:\r\n requested: User-requested worker count (from --jobs)\r\n work_items: List of work items (seq_dir, zip_path, state_path, seq_state)\r\n verbose: Whether to log RAM-based calculations\r\n \r\n Returns:\r\n Tuple of (worker_count, per_job_memory_limit_bytes)\r\n per_job_memory_limit_bytes is None if not using 7z or RAM detection failed\r\n \"\"\"\r\n cpu = os.cpu_count() or 1\r\n cpu_limit = max(1, min(8, cpu))\r\n if requested and requested > 0:\r\n cpu_limit = min(requested, max(1, cpu))\r\n \r\n # If no work items provided, return CPU-based limit\r\n if work_items is None or len(work_items) == 0:\r\n return (cpu_limit, {})\r\n \r\n # Try to calculate RAM-based limit\r\n available_ram = get_available_ram()\r\n \r\n if available_ram is None:\r\n # RAM detection failed, fall back to CPU limit\r\n if verbose:\r\n log(\"zip\", \"RAM detection failed, using CPU-based worker limit\", verbose_only=True, verbose=verbose)\r\n return (cpu_limit, {})\r\n \r\n # For 7z: use fixed dictionary size and calculate workers\r\n if ZIPPER_TYPE == \"7z\":\r\n # Fixed dictionary size: 1GB (1024MB)\r\n FIXED_DICT_SIZE_MB = 1024\r\n fixed_dict_size_bytes = FIXED_DICT_SIZE_MB * 1024 * 1024\r\n \r\n # Check if Max7zInst is configured\r\n if MAX_7Z_INSTANCES is not None:\r\n # Use configured maximum instances, but still respect user's --jobs and work items\r\n final_limit = MAX_7Z_INSTANCES\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n final_limit = min(final_limit, num_work_items)\r\n if requested and requested > 0:\r\n final_limit = min(final_limit, requested)\r\n \r\n # Create RAM limits dict (all use fixed dict size, but return as dict for consistency)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = fixed_dict_size_bytes\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"Using Max7zInst={MAX_7Z_INSTANCES} from config → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n \r\n # Auto-calculate based on RAM if Max7zInst not configured\r\n # Use bin-packing algorithm with size-aware RAM estimation\r\n if available_ram is not None:\r\n # available_ram is already 80% of total (20% reserved for system)\r\n # Use 95% of available RAM for compression jobs\r\n compression_ram = int(available_ram * 0.95)\r\n \r\n # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item)\r\n work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n \r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use a safe default (12GB minimum for 1GB dict)\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB\r\n work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state)))\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n # Sort by estimated RAM (largest first) for bin-packing\r\n work_items_with_ram.sort(key=lambda x: x[1], reverse=True)\r\n \r\n # Bin-packing algorithm: pack largest items first\r\n bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = []\r\n bin_remaining: list[int] = []\r\n \r\n for seq_dir, estimated_ram, work_item in work_items_with_ram:\r\n # Try to fit in existing bin\r\n placed = False\r\n for i, remaining in enumerate(bin_remaining):\r\n if remaining >= estimated_ram:\r\n bins[i].append((seq_dir, estimated_ram, work_item))\r\n bin_remaining[i] -= estimated_ram\r\n placed = True\r\n break\r\n \r\n # If doesn't fit, create new bin\r\n if not placed:\r\n bins.append([(seq_dir, estimated_ram, work_item)])\r\n bin_remaining.append(compression_ram - estimated_ram)\r\n \r\n # Worker count is number of bins\r\n worker_count = len(bins)\r\n \r\n # Cap at number of actual work items (can't have more workers than jobs)\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n worker_count = min(worker_count, num_work_items)\r\n \r\n # Respect user's --jobs if provided\r\n if requested and requested > 0:\r\n worker_count = min(worker_count, requested)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n compression_ram_gb = compression_ram / (1024 ** 3)\r\n total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n if len(bins) > 0:\r\n bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins]\r\n log(\r\n \"zip\",\r\n f\"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n log(\r\n \"zip\",\r\n f\"Final worker count: {worker_count} (requested: {requested})\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n # Return worker count and RAM limits dict\r\n return (worker_count, ram_limits_dict)\r\n \r\n # RAM detection failed, use a safe default (no CPU limit)\r\n default_limit = 4\r\n num_work_items = len(work_items) if work_items else 0\r\n if num_work_items > 0:\r\n default_limit = min(default_limit, num_work_items)\r\n if requested and requested > 0:\r\n default_limit = min(default_limit, requested)\r\n \r\n # Create RAM limits dict with safe defaults (12GB per job for 1GB dict)\r\n ram_limits_dict: dict[Path, int] = {}\r\n if work_items:\r\n default_ram = 12 * 1024 * 1024 * 1024 # 12GB default\r\n for seq_dir, _, _, _ in work_items:\r\n ram_limits_dict[seq_dir] = default_ram\r\n \r\n if verbose:\r\n log(\r\n \"zip\",\r\n f\"RAM detection failed and Max7zInst not set, using default worker limit → \"\r\n f\"work items: {num_work_items}, requested: {requested}, final: {default_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n return (default_limit, ram_limits_dict)\r\n \r\n # For zip compression, use existing estimation-based approach\r\n # Estimate RAM per job for each work item\r\n ram_estimates = []\r\n ram_limits_dict: dict[Path, int] = {}\r\n for seq_dir, zip_path, state_path, seq_state in work_items:\r\n try:\r\n estimated_ram = estimate_ram_per_job(seq_dir, seq_state)\r\n ram_estimates.append(estimated_ram)\r\n ram_limits_dict[seq_dir] = estimated_ram\r\n except Exception:\r\n # If estimation fails, use fallback estimate\r\n fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip\r\n ram_estimates.append(fallback_ram)\r\n ram_limits_dict[seq_dir] = fallback_ram\r\n \r\n if not ram_estimates:\r\n return (cpu_limit, {})\r\n \r\n max_ram_per_job = max(ram_estimates)\r\n ram_limit = max(1, available_ram // max_ram_per_job)\r\n ram_limit = min(ram_limit, 6) # Conservative limit for zip\r\n final_limit = min(cpu_limit, ram_limit)\r\n \r\n if verbose:\r\n ram_gb = available_ram / (1024 ** 3)\r\n max_ram_gb = max_ram_per_job / (1024 ** 3)\r\n log(\r\n \"zip\",\r\n f\"RAM: {ram_gb:.1f}GB available, ~{max_ram_gb:.1f}GB per job → \"\r\n f\"RAM limit: {ram_limit}, CPU limit: {cpu_limit}, final: {final_limit}\",\r\n verbose_only=True,\r\n verbose=verbose\r\n )\r\n \r\n return (final_limit, ram_limits_dict)\r\n\r\n\r\ndef is_archive_path(path: Path) -> bool:\r\n return any(part in (\"_archive\", \"_CURRENT\") for part in path.parts)\r\n\r\n\r\ndef find_sequence_dirs(root: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(root):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n has_frames = any(Path(dirpath, f).suffix.lower() in SEQUENCE_EXTENSIONS for f in filenames)\r\n if has_frames:\r\n yield path\r\n\r\n\r\ndef iter_sequence_files(seq_dir: Path) -> Iterator[Path]:\r\n for dirpath, dirnames, filenames in os.walk(seq_dir):\r\n path = Path(dirpath)\r\n dirnames[:] = [d for d in dirnames if d not in (\"_archive\", \"_CURRENT\")]\r\n if is_archive_path(path):\r\n continue\r\n for filename in filenames:\r\n yield path / filename\r\n\r\n\r\ndef compute_state(seq_dir: Path) -> dict:\r\n entries = []\r\n files = sorted(\r\n iter_sequence_files(seq_dir),\r\n key=lambda p: p.relative_to(seq_dir).as_posix(),\r\n )\r\n for file_path in files:\r\n stat = file_path.stat()\r\n entries.append(\r\n {\r\n \"path\": file_path.relative_to(seq_dir).as_posix(),\r\n \"size\": stat.st_size,\r\n \"mtime_ns\": stat.st_mtime_ns,\r\n }\r\n )\r\n return {\"files\": entries}\r\n\r\n\r\ndef current_state(seq_dir: Path) -> dict:\r\n if not seq_dir.exists() or not seq_dir.is_dir():\r\n return {\"files\": []}\r\n return compute_state(seq_dir)\r\n\r\n\r\ndef load_state(state_path: Path) -> dict | None:\r\n if not state_path.exists():\r\n return None\r\n try:\r\n return json.loads(state_path.read_text())\r\n except json.JSONDecodeError:\r\n return None\r\n\r\n\r\ndef state_changed(seq_state: dict, stored_state: dict | None) -> bool:\r\n if stored_state is None:\r\n return True\r\n return seq_state != stored_state\r\n\r\n\r\ndef archive_path_for(seq_dir: Path) -> Path:\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n suffix = \".7z\" if ZIPPER_TYPE == \"7z\" else \".zip\"\r\n return (ARCHIVE_ROOT / rel).with_suffix(suffix)\r\n\r\n\r\ndef sequence_dir_for(zip_path: Path) -> Path:\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n return (RENDER_ROOT / rel).with_suffix(\"\")\r\n\r\n\r\ndef state_path_for(zip_path: Path) -> Path:\r\n return zip_path.with_suffix(zip_path.suffix + STATE_SUFFIX)\r\n\r\n\r\ndef zip_sequence(seq_dir: Path, zip_path: Path, per_job_memory_limit: int | None = None) -> None:\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z compression requested but 7z executable not found in PATH. \"\r\n \"Please install 7z (e.g., via Chocolatey: choco install 7zip) \"\r\n \"or set zipper to 'zip' in config.json\"\r\n )\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n \r\n # If creating a .7z file, remove any existing .zip file for the same sequence\r\n if zip_path.suffix == \".7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n \r\n # Build list of files to archive with relative paths\r\n file_list = []\r\n for file_path in iter_sequence_files(seq_dir):\r\n rel_path = file_path.relative_to(seq_dir).as_posix()\r\n file_list.append(rel_path)\r\n \r\n if not file_list:\r\n raise RuntimeError(f\"No files found to archive in {seq_dir}\")\r\n \r\n # Create zip in temporary location first to avoid issues with corrupted existing files\r\n temp_zip = None\r\n list_file_path = None\r\n try:\r\n # Create temporary archive file path (but don't create the file - let 7z create it)\r\n temp_zip_path = tempfile.mktemp(suffix=\".7z\", dir=zip_path.parent)\r\n temp_zip = Path(temp_zip_path)\r\n \r\n # Create list file with absolute path\r\n fd, temp_path = tempfile.mkstemp(suffix=\".lst\", text=True)\r\n list_file_path = Path(temp_path)\r\n with os.fdopen(fd, \"w\", encoding=\"utf-8\") as list_file:\r\n for rel_path in file_list:\r\n list_file.write(rel_path + \"\\n\")\r\n list_file.flush()\r\n os.fsync(list_file.fileno()) # Ensure data is written to disk\r\n # File is closed here by context manager, small delay to ensure OS releases handle\r\n time.sleep(0.1)\r\n \r\n # Use absolute paths for both list file and temp zip\r\n list_file_abs = list_file_path.resolve()\r\n temp_zip_abs = temp_zip.resolve()\r\n # Create archive in temp location first (7z will create it fresh)\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"a\",\r\n \"-y\",\r\n \"-bb0\", # Suppress progress output\r\n f\"-mx={COMPRESSION_LEVEL}\",\r\n \"-t7z\", # Use 7z format, not zip\r\n ]\r\n \r\n # Always use fixed dictionary size: 1GB (1024MB)\r\n # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only)\r\n # We keep dictionary at 1GB for best compression regardless of RAM estimate\r\n FIXED_DICT_SIZE_MB = 1024\r\n cmd.append(f\"-md={FIXED_DICT_SIZE_MB}m\")\r\n \r\n cmd.extend([\r\n str(temp_zip_abs),\r\n f\"@{list_file_abs}\",\r\n ])\r\n result = subprocess.run(\r\n cmd,\r\n cwd=seq_dir,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z compression failed: {error_msg}\")\r\n \r\n # Move temp zip to final location, replacing any existing file\r\n if zip_path.exists():\r\n zip_path.unlink()\r\n temp_zip.replace(zip_path)\r\n temp_zip = None # Mark as moved so we don't delete it\r\n finally:\r\n # Clean up temp zip if it wasn't moved\r\n if temp_zip and temp_zip.exists():\r\n try:\r\n temp_zip.unlink(missing_ok=True)\r\n except OSError:\r\n pass\r\n # Clean up list file, with retry in case 7z still has it open\r\n if list_file_path and list_file_path.exists():\r\n for attempt in range(3):\r\n try:\r\n list_file_path.unlink(missing_ok=True)\r\n break\r\n except PermissionError:\r\n if attempt < 2:\r\n time.sleep(0.1) # Wait 100ms before retry\r\n else:\r\n # Last attempt failed, just log and continue\r\n # The temp file will be cleaned up by the OS eventually\r\n pass\r\n return\r\n\r\n # Use zipfile (only if ZIPPER_TYPE == \"zip\")\r\n if ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZIP_DEFLATED, ZIP_STORED, ZipFile\r\n\r\n zip_path.parent.mkdir(parents=True, exist_ok=True)\r\n if COMPRESSION_LEVEL <= 0:\r\n compression = ZIP_STORED\r\n zip_kwargs = {}\r\n else:\r\n compression = ZIP_DEFLATED\r\n zip_kwargs = {\"compresslevel\": COMPRESSION_LEVEL}\r\n\r\n with ZipFile(zip_path, \"w\", compression=compression, **zip_kwargs) as archive:\r\n for file_path in iter_sequence_files(seq_dir):\r\n archive.write(file_path, arcname=file_path.relative_to(seq_dir).as_posix())\r\n return\r\n\r\n # Unknown ZIPPER_TYPE - fail with clear error\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n\r\ndef expand_sequence(zip_path: Path, seq_state: dict) -> None:\r\n target_dir = sequence_dir_for(zip_path)\r\n if target_dir.exists():\r\n shutil.rmtree(target_dir)\r\n target_dir.mkdir(parents=True, exist_ok=True)\r\n\r\n if ZIPPER_TYPE == \"7z\":\r\n if SEVEN_Z_EXE is None:\r\n raise RuntimeError(\r\n \"7z extraction requested but 7z executable not found in PATH. \"\r\n \"Please install 7z or set zipper to 'zip' in config.json\"\r\n )\r\n cmd = [\r\n SEVEN_Z_EXE,\r\n \"x\",\r\n \"-y\",\r\n str(zip_path),\r\n f\"-o{target_dir}\",\r\n ]\r\n result = subprocess.run(\r\n cmd,\r\n check=False,\r\n stdout=subprocess.PIPE,\r\n stderr=subprocess.PIPE,\r\n text=True,\r\n )\r\n if result.returncode != 0:\r\n error_msg = result.stderr.strip() if result.stderr else \"Unknown error\"\r\n if result.stdout:\r\n error_msg += f\"\\nstdout: {result.stdout.strip()}\"\r\n raise RuntimeError(f\"7z extraction failed: {error_msg}\")\r\n elif ZIPPER_TYPE == \"zip\":\r\n from zipfile import ZipFile\r\n\r\n with ZipFile(zip_path, \"r\") as archive:\r\n archive.extractall(target_dir)\r\n else:\r\n raise RuntimeError(\r\n f\"Unsupported ZIPPER_TYPE: {ZIPPER_TYPE!r}. \"\r\n f\"Expected '7z' or 'zip'. \"\r\n f\"Config zipper value: {CONFIG.get('zipper', 'not set')!r}\"\r\n )\r\n\r\n for entry in seq_state.get(\"files\", []):\r\n file_path = target_dir / entry[\"path\"]\r\n if file_path.exists():\r\n os.utime(file_path, ns=(entry[\"mtime_ns\"], entry[\"mtime_ns\"]))\r\n\r\n\r\ndef process_zip(seq_dir: Path, zip_path: Path, state_path: Path, seq_state: dict, per_job_memory_limit: int | None, *, verbose: bool) -> Sequence[Path]:\r\n log(\"zip\", f\"{seq_dir} -> {zip_path}\", verbose_only=True, verbose=verbose)\r\n zip_sequence(seq_dir, zip_path, per_job_memory_limit)\r\n state_path.write_text(json.dumps(seq_state, indent=2))\r\n return (zip_path, state_path)\r\n\r\n\r\ndef process_expand(zip_path: Path, state: dict, *, verbose: bool) -> None:\r\n log(\"expand\", f\"{zip_path} -> {sequence_dir_for(zip_path)}\", verbose_only=True, verbose=verbose)\r\n expand_sequence(zip_path, state)\r\n\r\n\r\ndef run_zip(requested_workers: int | None, *, verbose: bool) -> int:\r\n work_items: list[tuple[Path, Path, Path, dict]] = []\r\n log(\"init\", f\"Scanning sequences under {RENDER_ROOT.resolve()}\")\r\n total_scanned = 0\r\n quick_skipped = 0\r\n state_skipped = 0\r\n empty_dirs = 0\r\n queued = 0\r\n\r\n if RENDER_ROOT.exists():\r\n for seq_dir in find_sequence_dirs(RENDER_ROOT):\r\n total_scanned += 1\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n if total_scanned <= 5 or total_scanned % 10 == 0:\r\n log(\"scan\", f\"[{total_scanned}] Inspecting {rel}\")\r\n\r\n # Get the target archive path (will be .7z if ZIPPER_TYPE is \"7z\")\r\n zip_path = archive_path_for(seq_dir)\r\n state_path = state_path_for(zip_path)\r\n \r\n # Quick check: if archive exists, load stored state first (fast)\r\n stored_state = load_state(state_path)\r\n \r\n # Check if we need to upgrade from .zip to .7z\r\n old_zip_path = None\r\n old_stored_state = None\r\n if ZIPPER_TYPE == \"7z\":\r\n old_zip_path = zip_path.with_suffix(\".zip\")\r\n if old_zip_path.exists():\r\n old_state_path = state_path_for(old_zip_path)\r\n old_stored_state = load_state(old_state_path)\r\n # If old .zip exists and .7z doesn't, use old .zip's state for comparison\r\n if not zip_path.exists() and old_stored_state is not None:\r\n stored_state = old_stored_state\r\n \r\n # If .7z archive exists and we have stored state, do quick check before computing full state\r\n if zip_path.exists() and stored_state is not None:\r\n # Quick check: if directory mtime is older than archive, likely unchanged\r\n try:\r\n dir_mtime = seq_dir.stat().st_mtime_ns\r\n archive_mtime = zip_path.stat().st_mtime_ns\r\n # If directory wasn't modified since archive was created, skip state computation\r\n if dir_mtime <= archive_mtime:\r\n quick_skipped += 1\r\n if quick_skipped <= 5:\r\n log(\"scan\", f\"Skipping {rel} (unchanged since archive)\")\r\n # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete)\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n continue\r\n except OSError:\r\n # If stat fails, fall through to full state computation\r\n pass\r\n \r\n # Compute current state only if we need to\r\n seq_state = compute_state(seq_dir)\r\n if not seq_state[\"files\"]:\r\n empty_dirs += 1\r\n if empty_dirs <= 5:\r\n log(\"scan\", f\"{rel} has no files; skipping\")\r\n continue\r\n \r\n # Check if state changed\r\n if stored_state is not None and not state_changed(seq_state, stored_state):\r\n # Metadata matches stored state\r\n state_skipped += 1\r\n if state_skipped <= 5:\r\n log(\"scan\", f\"{rel} metadata unchanged; archive up to date\")\r\n if zip_path.exists():\r\n # .7z exists and is up to date, clean up old .zip if it exists\r\n if old_zip_path and old_zip_path.exists():\r\n old_zip_path.unlink(missing_ok=True)\r\n old_state_path = state_path_for(old_zip_path)\r\n if old_state_path.exists():\r\n old_state_path.unlink(missing_ok=True)\r\n elif old_zip_path and old_zip_path.exists() and old_stored_state is not None:\r\n # .7z doesn't exist, but .zip exists and metadata matches\r\n # Keep the .zip file, don't create .7z\r\n continue\r\n else:\r\n # No archive exists, but state matches (shouldn't happen, but be safe)\r\n continue\r\n\r\n work_items.append((seq_dir, zip_path, state_path, seq_state))\r\n queued += 1\r\n if queued <= 5 or queued % 5 == 0:\r\n total_bytes = sum(entry.get(\"size\", 0) for entry in seq_state.get(\"files\", []))\r\n size_gb = total_bytes / (1024 ** 3)\r\n log(\"scan\", f\"Queued {rel} for compression (~{size_gb:.2f}GB) [{queued} total]\")\r\n\r\n if not work_items:\r\n if not RENDER_ROOT.exists():\r\n log(\"zip\", \"Render root 'Renders' not found; nothing to zip.\")\r\n else:\r\n log(\"zip\", \"Archives already up to date; no sequences needed zipping.\")\r\n log(\r\n \"scan\",\r\n f\"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, \"\r\n f\"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}\",\r\n )\r\n return 0\r\n\r\n # Calculate RAM-aware worker count based on work items\r\n worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose)\r\n log(\r\n \"init\",\r\n f\"Preparing to compress {len(work_items)} sequence(s) with {worker_count} worker(s)\",\r\n )\r\n\r\n updated_paths: list[Path] = []\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir\r\n for seq_dir, zip_path, state_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n updated_paths.extend(future.result())\r\n completed += 1\r\n seq_dir = future_map[future]\r\n rel = seq_dir.relative_to(RENDER_ROOT)\r\n log(\"zip\", f\"{completed}/{total} {rel}\")\r\n\r\n updated_count = len(updated_paths) // 2\r\n log(\"zip\", f\"Updated {updated_count} sequence archive(s).\", verbose=verbose)\r\n if updated_paths:\r\n log(\r\n \"zip\",\r\n \"Archives updated. Stage manually with `git add Renders/_zipped`, if desired.\",\r\n verbose_only=True,\r\n verbose=verbose,\r\n )\r\n log(\r\n \"scan\",\r\n f\"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, \"\r\n f\"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}\",\r\n )\r\n\r\n removed = cleanup_orphan_archives(verbose=verbose)\r\n if removed:\r\n log(\"zip\", f\"Removed {removed} orphan archive(s).\", verbose=verbose)\r\n\r\n return updated_count\r\n\r\n\r\ndef run_expand(worker_count: int, *, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n log(\"expand\", \"No archives to expand (missing 'Renders/_zipped').\")\r\n return 0\r\n\r\n work_items: list[tuple[Path, dict]] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n state_path = state_path_for(zip_path)\r\n seq_state = load_state(state_path)\r\n if seq_state is None:\r\n log(\"expand\", f\"Skipping {zip_path} (missing metadata)\")\r\n continue\r\n\r\n target_dir = sequence_dir_for(zip_path)\r\n if current_state(target_dir) == seq_state:\r\n continue\r\n\r\n work_items.append((zip_path, seq_state))\r\n\r\n if not work_items:\r\n log(\"expand\", \"Working folders already match archives; nothing to expand.\")\r\n return 0\r\n\r\n total = len(work_items)\r\n completed = 0\r\n\r\n with ThreadPoolExecutor(max_workers=worker_count) as executor:\r\n future_map = {\r\n executor.submit(process_expand, zip_path, seq_state, verbose=verbose): zip_path\r\n for zip_path, seq_state in work_items\r\n }\r\n\r\n for future in as_completed(future_map):\r\n future.result()\r\n completed += 1\r\n zip_path = future_map[future]\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"expand\", f\"{completed}/{total} {rel}\")\r\n\r\n log(\"expand\", f\"Refreshed {len(work_items)} sequence folder(s).\", verbose=verbose)\r\n return len(work_items)\r\n\r\n\r\ndef cleanup_orphan_archives(*, verbose: bool) -> int:\r\n if not ARCHIVE_ROOT.exists():\r\n return 0\r\n\r\n removed: list[Path] = []\r\n\r\n # Look for both .zip and .7z archives\r\n archive_patterns = [\"*.zip\", \"*.7z\"]\r\n for pattern in archive_patterns:\r\n for zip_path in ARCHIVE_ROOT.rglob(pattern):\r\n seq_dir = sequence_dir_for(zip_path)\r\n if seq_dir.exists():\r\n continue\r\n\r\n rel = zip_path.relative_to(ARCHIVE_ROOT)\r\n log(\"zip\", f\"Removing orphan archive {rel}\", verbose_only=True, verbose=verbose)\r\n\r\n zip_path.unlink(missing_ok=True)\r\n state_path = state_path_for(zip_path)\r\n if state_path.exists():\r\n state_path.unlink()\r\n removed.append(zip_path)\r\n\r\n if not removed:\r\n return 0\r\n\r\n for parent in sorted({p.parent for p in removed}, key=lambda p: len(p.parts), reverse=True):\r\n if not parent.exists():\r\n continue\r\n while parent != ARCHIVE_ROOT and not any(parent.iterdir()):\r\n parent.rmdir()\r\n parent = parent.parent\r\n\r\n return len(removed)\r\n\r\n\r\ndef main() -> int:\r\n args = parse_args()\r\n log(\"init\", \"zip_sequences starting up...\")\r\n log(\"init\", f\"Working directory: {Path.cwd()}\")\r\n log(\"init\", f\"Mode: {args.mode}, zipper: {ZIPPER_TYPE}, jobs arg: {args.jobs or 'auto'}\")\r\n if ZIPPER_TYPE == \"7z\":\r\n exe = SEVEN_Z_EXE or \"not found\"\r\n max_inst = MAX_7Z_INSTANCES if MAX_7Z_INSTANCES is not None else \"auto\"\r\n log(\"init\", f\"7z executable: {exe}, Max7zInst: {max_inst}\")\r\n\r\n if args.mode == \"expand\":\r\n # For expand mode, use simple CPU-based worker calculation\r\n workers, _ = max_workers(args.jobs, work_items=None, verbose=args.verbose)\r\n run_expand(workers, verbose=args.verbose)\r\n return 0\r\n\r\n # For zip mode, work items will be calculated in run_zip\r\n updated = run_zip(args.jobs, verbose=args.verbose)\r\n return 0 if updated >= 0 else 1\r\n\r\n\r\nif __name__ == \"__main__\":\r\n try:\r\n raise SystemExit(main())\r\n except Exception as exc: # broad to surface unexpected errors cleanly\r\n print(f\"Sequence sync failed: {exc}\", file=sys.stderr)\r\n raise\r\n\r\n" +} +``` +User decision: **accepted** + +Status: **completed** + + +
+
+ +--- + +
Thought Process +**Checking imports and running lints**
+ +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + +
Thought Process +**Summarizing final response details** + +I'll wrap up by highlighting that the logs' counters trigger even when RENDER_ROOT is missing but total_scanned remains zero, and the summary still outputs. I'll include code snippets referencing the new log function near lines 52-69, run_zip changes around 720-870, and main logging near 920-930, plus mention config logging, as a helpful overview for the user.
+ +--- + +- Added immediate-flush logging at startup so the console shows configuration discovery, working directory, mode, and 7z details right away, plus graceful fallback notes when configs are missing. +```49:96:zip_sequences.py +DEFAULT_CONFIG = { + "zipper": "7z", + "compression": 9, + "dailyFormat": "daily_YYMMDD", + "Max7zInst": 0, # Maximum concurrent 7z instances (0 = auto-calculate) +} + +def log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None: + if verbose_only and not verbose: + return + print(f"[{mode}] {message}", flush=True) + +def load_config() -> dict: + ... + log("init", "Loading configuration sources...") + ... + log("init", f"Reading {source} config at {config_path}") +``` + +- Instrumented the sequence scan so you see periodic updates while it walks directories: per-directory progress (with throttling), reasons for skips, newly queued jobs with rough sizes, and an overall summary even when nothing needs zipping. +```724:782:zip_sequences.py +def run_zip(requested_workers: int | None, *, verbose: bool) -> int: + ... + log("init", f"Scanning sequences under {RENDER_ROOT.resolve()}") + ... + if total_scanned <= 5 or total_scanned % 10 == 0: + log("scan", f"[{total_scanned}] Inspecting {rel}") + ... + quick_skipped += 1 + if quick_skipped <= 5: + log("scan", f"Skipping {rel} (unchanged since archive)") + ... + if queued <= 5 or queued % 5 == 0: + ... + log("scan", f"Queued {rel} for compression (~{size_gb:.2f}GB) [{queued} total]") + ... + log( + "scan", + f"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, " + f"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}", + ) +``` + +- Logged compression setup details (worker count, job totals) and ensured the main entry point always prints an initial banner so the window never sits blank before heavy work begins. +```922:943:zip_sequences.py +def main() -> int: + args = parse_args() + log("init", "zip_sequences starting up...") + log("init", f"Working directory: {Path.cwd()}") + log("init", f"Mode: {args.mode}, zipper: {ZIPPER_TYPE}, jobs arg: {args.jobs or 'auto'}") + if ZIPPER_TYPE == "7z": + exe = SEVEN_Z_EXE or "not found" + max_inst = MAX_7Z_INSTANCES if MAX_7Z_INSTANCES is not None else "auto" + log("init", f"7z executable: {exe}, Max7zInst: {max_inst}") +``` + +Next steps: run `ZipSeqArchv.bat` once to confirm the new output meets your expectations. No lints reported. + +--- + +_**User (2025-11-12 07:20Z)**_ + +PS R:\Creative\artsy\maya\2025-02 BondingArtifact\Renders> & "R:\Creative\artsy\maya\2025-02 BondingArtifact\Renders\ZipSeqArchv.bat" +[init] Loading configuration sources... +[init] Reading project config at R:\Creative\artsy\maya\2025-02 BondingArtifact\.config\config.json +[init] Configuration loaded from project +[init] zip_sequences starting up... +[init] Working directory: R:\Creative\artsy\maya\2025-02 BondingArtifact +[init] Mode: zip, zipper: 7z, jobs arg: auto +[init] 7z executable: C:\ProgramData\chocolatey\bin\7z.EXE, Max7zInst: auto +[init] Scanning sequences under \\Hydra\Hydra\Creative\artsy\maya\2025-02 BondingArtifact\Renders +[scan] [1] Inspecting 0_GaslightRender\2024-11-23\GaslightRender_smol +[scan] Skipping 0_GaslightRender\2024-11-23\GaslightRender_smol (unchanged since archive) +[scan] [2] Inspecting 1_PonderingOrb\2021-01-10\rendertest +[scan] Skipping 1_PonderingOrb\2021-01-10\rendertest (unchanged since archive) +[scan] [3] Inspecting 1_PonderingOrb\2024-11-23\PonderingOrb +[scan] Skipping 1_PonderingOrb\2024-11-23\PonderingOrb (unchanged since archive) +[scan] [4] Inspecting 3_background\2025-01-13\background +[scan] Skipping 3_background\2025-01-13\background (unchanged since archive) +[scan] [5] Inspecting 3_background\2025-10-26\3_background_dark +[scan] Queued 3_background\2025-10-26\3_background_dark for compression (~667.98GB) [1 total] +[scan] Queued 3_background\2025-10-30\3_background_dark for compression (~527.10GB) [2 total] +[scan] Skipping 3_background\2025-10-30\3_background_dark_4k (unchanged since archive) +[scan] Queued 4_StartupScreen\2025-02-05\4_StartupScreen_evensrenumbered for compression (~20.66GB) [3 total] +[scan] [10] Inspecting 4_StartupScreen\2025-02-08\Shot1Redo_1024 +[scan] Queued 4_StartupScreen\2025-02-08\Shot2Redo_1024 for compression (~8.83GB) [4 total] +[scan] Queued 4_StartupScreen\2025-02-08\Shot3Redo_128 for compression (~8.44GB) [5 total] +[scan] Queued 4_StartupScreen\2025-10-21\Shot4 for compression (~2.36GB) [10 total] +[scan] [20] Inspecting 4_StartupScreen\2025-10-24\4_StartupScreen_dark +[scan] Queued 4_StartupScreen\2025-11-02\Shot1_dark for compression (~4.48GB) [15 total] +[scan] [30] Inspecting 4_StartupScreen\2025-11-04\Shot3_dark +[scan] [40] Inspecting 5_goodbye\2025-02-23\goodbye_test +[zip] RAM: 76.7GB available (80% of total), 72.9GB for compression (95%) +[zip] Estimated RAM per sequence: 250.7GB total across 19 sequences +[zip] Bin-packing: 4 workers, bin sizes: ['70.0GB', '68.6GB', '62.8GB', '49.3GB'] +[zip] Final worker count: 4 (requested: None) +[init] Preparing to compress 19 sequence(s) with 4 worker(s) +[zip] Renders\3_background\2025-10-26\3_background_dark -> Renders\_zipped\3_background\2025-10-26\3_background_dark.7z +[zip] Renders\3_background\2025-10-30\3_background_dark -> Renders\_zipped\3_background\2025-10-30\3_background_dark.7z +[zip] Renders\4_StartupScreen\2025-02-05\4_StartupScreen_evensrenumbered -> Renders\_zipped\4_StartupScreen\2025-02-05\4_StartupScreen_evensrenumbered.7z +[zip] Renders\4_StartupScreen\2025-02-08\Shot2Redo_1024 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot2Redo_1024.7z +[zip] Renders\4_StartupScreen\2025-02-08\Shot3Redo_128 -> Renders\_zipped\4_StartupScreen\2025-02-08\Shot3Redo_128.7z +[zip] Renders\4_StartupScreen\2025-02-09\Shot1 -> Renders\_zipped\4_StartupScreen\2025-02-09\Shot1.7z +[zip] Renders\4_StartupScreen\2025-02-10\Shot2 -> Renders\_zipped\4_StartupScreen\2025-02-10\Shot2.7z +[zip] Renders\4_StartupScreen\2025-02-12\Shot3 -> Renders\_zipped\4_StartupScreen\2025-02-12\Shot3.7z +[zip] Renders\4_StartupScreen\2025-02-19\StartupScreen_finalfix -> Renders\_zipped\4_StartupScreen\2025-02-19\StartupScreen_finalfix.7z +[zip] Renders\4_StartupScreen\2025-10-21\Shot4 -> Renders\_zipped\4_StartupScreen\2025-10-21\Shot4.7z +[zip] Renders\4_StartupScreen\2025-10-24\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\4_StartupScreen_dark.7z +[zip] Renders\4_StartupScreen\2025-10-24\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-10-24\Shot3_dark.7z +[zip] Renders\4_StartupScreen\2025-10-25\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-10-25\Shot1_dark.7z +[zip] Renders\4_StartupScreen\2025-10-25\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-10-25\Shot3_dark.7z +[zip] Renders\4_StartupScreen\2025-11-02\Shot1_dark -> Renders\_zipped\4_StartupScreen\2025-11-02\Shot1_dark.7z +[zip] Renders\4_StartupScreen\2025-11-04\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-11-04\4_StartupScreen_dark.7z +[zip] Renders\4_StartupScreen\2025-11-07\4_StartupScreen_dark -> Renders\_zipped\4_StartupScreen\2025-11-07\4_StartupScreen_dark.7z +[zip] Renders\4_StartupScreen\2025-11-07\Shot3_dark -> Renders\_zipped\4_StartupScreen\2025-11-07\Shot3_dark.7z +[zip] Renders\5_goodbye\2025-02-23\goodbye -> Renders\_zipped\5_goodbye\2025-02-23\goodbye.7z +Sequence sync failed: 7z compression failed: ERROR: Can't allocate required memory! +stdout: 7-Zip 25.01 (x64) : Copyright (c) 1999-2025 Igor Pavlov : 2025-08-03 + +Scanning the drive: +14402 files, 717236181577 bytes (668 GiB) + +Creating archive: \\Hydra\Hydra\Creative\artsy\maya\2025-02 BondingArtifact\Renders\_zipped\3_background\2025-10-26\tmptg4k1cqi.7z + +Add new data to archive: 14402 files, 717236181577 bytes (668 GiB) +Traceback (most recent call last): + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 991, in + raise SystemExit(main()) + ~~~~^^ + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 985, in main + updated = run_zip(args.jobs, verbose=args.verbose) + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 857, in run_zip + updated_paths.extend(future.result()) + ~~~~~~~~~~~~~^^ + File "C:\Python313\Lib\concurrent\futures\_base.py", line 449, in result + return self.__get_result() + ~~~~~~~~~~~~~~~~~^^ + File "C:\Python313\Lib\concurrent\futures\_base.py", line 401, in __get_result + raise self._exception + File "C:\Python313\Lib\concurrent\futures\thread.py", line 59, in run + result = self.fn(*self.args, **self.kwargs) + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 723, in process_zip + zip_sequence(seq_dir, zip_path, per_job_memory_limit) + ~~~~~~~~~~~~^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ + File "R:\Creative\artsy\maya\0 ProjectStructure\zip_sequences.py", line 618, in zip_sequence + raise RuntimeError(f"7z compression failed: {error_msg}") +RuntimeError: 7z compression failed: ERROR: Can't allocate required memory! +stdout: 7-Zip 25.01 (x64) : Copyright (c) 1999-2025 Igor Pavlov : 2025-08-03 + +Scanning the drive: +14402 files, 717236181577 bytes (668 GiB) + +Creating archive: \\Hydra\Hydra\Creative\artsy\maya\2025-02 BondingArtifact\Renders\_zipped\3_background\2025-10-26\tmptg4k1cqi.7z + +Add new data to archive: 14402 files, 717236181577 bytes (668 GiB) +. was unexpected at this time. + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +Logging looks good. RAM estimation is too low for very large sequences (e.g., 668GB). Updating the formula to account for large sequences: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 14, lines removed: 4 + +```diff +@@ -218,10 +218,20 @@ + dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary + +- # Input buffer: 7z processes in chunks, doesn't need full file in RAM +- # Use 15% of sequence size, capped at 2GB +- input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024) ++ # Input buffer: 7z processes in chunks, but for very large sequences needs more RAM ++ # For sequences >100GB, use a larger buffer factor to handle file metadata and processing ++ if total_bytes > 100 * 1024 * 1024 * 1024: # >100GB ++ # Very large sequences: use 5% of size, capped at 32GB ++ # This accounts for file metadata, directory structures, and processing overhead ++ input_buffer = min(int(total_bytes * 0.05), 32 * 1024 * 1024 * 1024) ++ else: ++ # Smaller sequences: use 15% of size, capped at 2GB ++ input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024) + + # Compression overhead: additional memory for compression process +- overhead = 1 * 1024 * 1024 * 1024 # 1GB ++ # For very large sequences, increase overhead ++ if total_bytes > 100 * 1024 * 1024 * 1024: # >100GB ++ overhead = 4 * 1024 * 1024 * 1024 # 4GB for large sequences ++ else: ++ overhead = 1 * 1024 * 1024 * 1024 # 1GB for smaller sequences + + # Total RAM estimate +``` + +
+ +
+ +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + +--- + + +Logging is working. RAM estimation is too low for very large sequences (e.g., 668GB). Updating the formula to better handle large sequences: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +The bin-packing is creating bins that exceed available RAM. For a 668GB sequence, the estimate is ~47GB (11GB dict + 32GB buffer + 4GB overhead), but the bins show 70GB, suggesting the estimate is higher or the packing is incorrect. Checking the bin-packing logic: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +For a 668GB sequence with 14,402 files, 7z needs more RAM for metadata and directory structures. Increasing the estimate for very large sequences: + + +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 7, lines removed: 8 + +```diff +@@ -220,17 +220,16 @@ + # Input buffer: 7z processes in chunks, but for very large sequences needs more RAM + # For sequences >100GB, use a larger buffer factor to handle file metadata and processing +- if total_bytes > 100 * 1024 * 1024 * 1024: # >100GB +- # Very large sequences: use 5% of size, capped at 32GB ++ if total_bytes > 500 * 1024 * 1024 * 1024: # >500GB (extremely large) ++ # Extremely large sequences: use 8% of size, capped at 64GB + # This accounts for file metadata, directory structures, and processing overhead ++ input_buffer = min(int(total_bytes * 0.08), 64 * 1024 * 1024 * 1024) ++ overhead = 8 * 1024 * 1024 * 1024 # 8GB overhead for extremely large sequences ++ elif total_bytes > 100 * 1024 * 1024 * 1024: # >100GB ++ # Very large sequences: use 5% of size, capped at 32GB + input_buffer = min(int(total_bytes * 0.05), 32 * 1024 * 1024 * 1024) ++ overhead = 4 * 1024 * 1024 * 1024 # 4GB for large sequences + else: + # Smaller sequences: use 15% of size, capped at 2GB + input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024) +- +- # Compression overhead: additional memory for compression process +- # For very large sequences, increase overhead +- if total_bytes > 100 * 1024 * 1024 * 1024: # >100GB +- overhead = 4 * 1024 * 1024 * 1024 # 4GB for large sequences +- else: + overhead = 1 * 1024 * 1024 * 1024 # 1GB for smaller sequences + +``` + +
+ +
+ +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + +--- + + +Updated RAM estimation for very large sequences (>500GB). For a 668GB sequence, the estimate is now: +- 11GB (dictionary) + 53.4GB (8% buffer, capped at 64GB) + 8GB (overhead) = **~72.4GB** + +This should better account for file metadata and directory structures in very large sequences. The bin-packing algorithm will use this to determine how many can run concurrently. + +The startup logging is working—you can see what's happening during the scan phase. The script now shows: +- Configuration loading +- Sequence scanning progress +- Which sequences are queued vs skipped +- RAM estimation and bin-packing results + +Try running it again; it should allocate RAM more accurately for the 668GB sequence and prevent the memory allocation error. + +--- + +_**User (2025-11-12 07:20Z)**_ + +oh, those huge sequences were supposed to be in an _archive folder to get skipped. oops! + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +The script already skips `_archive` and `_CURRENT` folders. Those large sequences (668GB, 527GB) were in regular directories, so they were processed. + +The skip logic is in `find_sequence_dirs()` and `iter_sequence_files()`: + +```461:469:zip_sequences.py +def find_sequence_dirs(root: Path) -> Iterator[Path]: + for dirpath, dirnames, filenames in os.walk(root): + path = Path(dirpath) + dirnames[:] = [d for d in dirnames if d not in ("_archive", "_CURRENT")] + if is_archive_path(path): + continue + has_frames = any(Path(dirpath, f).suffix.lower() in SEQUENCE_EXTENSIONS for f in filenames) + if has_frames: + yield path +``` + +If you move those sequences into `_archive` folders, they'll be skipped automatically. The RAM estimation updates will still help if you do need to compress very large sequences in the future. + +--- + diff --git a/zip_sequences.py b/zip_sequences.py index 6516eb1..a621b1c 100644 --- a/zip_sequences.py +++ b/zip_sequences.py @@ -58,6 +58,12 @@ DEFAULT_CONFIG = { } +def log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None: + if verbose_only and not verbose: + return + print(f"[{mode}] {message}", flush=True) + + def load_config() -> dict: # First try to load from project's .config folder (current working directory) # Then fall back to ProjectStructure repo config (next to zip_sequences.py) @@ -70,22 +76,28 @@ def load_config() -> dict: ("repo", repo_config), ] + log("init", "Loading configuration sources...") for source, config_path in config_paths: try: if config_path.exists(): + log("init", f"Reading {source} config at {config_path}") text = config_path.read_text(encoding="utf-8") try: data = json.loads(text) if isinstance(data, dict): merged = DEFAULT_CONFIG.copy() merged.update(data) + log("init", f"Configuration loaded from {source}") return merged except json.JSONDecodeError: + log("init", f"Config file at {config_path} is invalid JSON; skipping") continue except OSError: + log("init", f"Unable to read config at {config_path}; skipping") continue # If no config found, return defaults + log("init", "No config files found; using default settings") return DEFAULT_CONFIG.copy() @@ -197,22 +209,32 @@ def estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int: total_bytes = sum(entry.get("size", 0) for entry in seq_state.get("files", [])) if ZIPPER_TYPE == "7z": - # Base RAM: 500MB per job - base_ram = 500 * 1024 * 1024 # 500 MB + # Fixed dictionary size: 1GB (1024MB) + FIXED_DICT_SIZE_MB = 1024 + FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024 - # Compression factor: 7z can use significant RAM, especially for large files - # Use 0.15x factor (conservative estimate accounting for 7z's 80% usage) - compression_factor = 0.15 + # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations) + # This is the main memory consumer for 7z LZMA compression + dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary - # For very large folders (>10GB), cap at 8GB per job - max_ram_per_job = 8 * 1024 * 1024 * 1024 # 8 GB - large_folder_threshold = 10 * 1024 * 1024 * 1024 # 10 GB - - if total_bytes > large_folder_threshold: - estimated_ram = max_ram_per_job + # Input buffer: 7z processes in chunks, but for very large sequences needs more RAM + # For sequences >100GB, use a larger buffer factor to handle file metadata and processing + if total_bytes > 500 * 1024 * 1024 * 1024: # >500GB (extremely large) + # Extremely large sequences: use 8% of size, capped at 64GB + # This accounts for file metadata, directory structures, and processing overhead + input_buffer = min(int(total_bytes * 0.08), 64 * 1024 * 1024 * 1024) + overhead = 8 * 1024 * 1024 * 1024 # 8GB overhead for extremely large sequences + elif total_bytes > 100 * 1024 * 1024 * 1024: # >100GB + # Very large sequences: use 5% of size, capped at 32GB + input_buffer = min(int(total_bytes * 0.05), 32 * 1024 * 1024 * 1024) + overhead = 4 * 1024 * 1024 * 1024 # 4GB for large sequences else: - estimated_ram = max(base_ram, int(total_bytes * compression_factor)) - estimated_ram = min(estimated_ram, max_ram_per_job) + # Smaller sequences: use 15% of size, capped at 2GB + input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024) + overhead = 1 * 1024 * 1024 * 1024 # 1GB for smaller sequences + + # Total RAM estimate + estimated_ram = dict_ram + input_buffer + overhead return estimated_ram else: @@ -245,7 +267,7 @@ def max_workers( # If no work items provided, return CPU-based limit if work_items is None or len(work_items) == 0: - return (cpu_limit, None) + return (cpu_limit, {}) # Try to calculate RAM-based limit available_ram = get_available_ram() @@ -254,7 +276,7 @@ def max_workers( # RAM detection failed, fall back to CPU limit if verbose: log("zip", "RAM detection failed, using CPU-based worker limit", verbose_only=True, verbose=verbose) - return (cpu_limit, None) + return (cpu_limit, {}) # For 7z: use fixed dictionary size and calculate workers if ZIPPER_TYPE == "7z": @@ -272,6 +294,12 @@ def max_workers( if requested and requested > 0: final_limit = min(final_limit, requested) + # Create RAM limits dict (all use fixed dict size, but return as dict for consistency) + ram_limits_dict: dict[Path, int] = {} + if work_items: + for seq_dir, _, _, _ in work_items: + ram_limits_dict[seq_dir] = fixed_dict_size_bytes + if verbose: log( "zip", @@ -281,45 +309,97 @@ def max_workers( verbose=verbose ) - return (final_limit, fixed_dict_size_bytes) + return (final_limit, ram_limits_dict) # Auto-calculate based on RAM if Max7zInst not configured - # "Balls-to-the-walls" mode: use maximum resources + # Use bin-packing algorithm with size-aware RAM estimation if available_ram is not None: - # 7z uses ~2-3x dictionary size in RAM, use 3x for aggressive mode - # This is more realistic and allows more concurrent workers - FIXED_RAM_PER_JOB = FIXED_DICT_SIZE_MB * 3 * 1024 * 1024 # 3GB per job - # available_ram is already 80% of total (20% reserved for system) - # Use 95% of available RAM for compression jobs (aggressive mode) + # Use 95% of available RAM for compression jobs compression_ram = int(available_ram * 0.95) - # Calculate worker limit based on fixed per-job RAM - ram_limit = max(1, compression_ram // FIXED_RAM_PER_JOB) + # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item) + work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = [] + ram_limits_dict: dict[Path, int] = {} + + for seq_dir, zip_path, state_path, seq_state in work_items: + try: + estimated_ram = estimate_ram_per_job(seq_dir, seq_state) + work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state))) + ram_limits_dict[seq_dir] = estimated_ram + except Exception: + # If estimation fails, use a safe default (12GB minimum for 1GB dict) + default_ram = 12 * 1024 * 1024 * 1024 # 12GB + work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state))) + ram_limits_dict[seq_dir] = default_ram + + # Sort by estimated RAM (largest first) for bin-packing + work_items_with_ram.sort(key=lambda x: x[1], reverse=True) + + # Bin-packing algorithm: pack largest items first + bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = [] + bin_remaining: list[int] = [] + + for seq_dir, estimated_ram, work_item in work_items_with_ram: + # Try to fit in existing bin + placed = False + for i, remaining in enumerate(bin_remaining): + if remaining >= estimated_ram: + bins[i].append((seq_dir, estimated_ram, work_item)) + bin_remaining[i] -= estimated_ram + placed = True + break + + # If doesn't fit, create new bin + if not placed: + bins.append([(seq_dir, estimated_ram, work_item)]) + bin_remaining.append(compression_ram - estimated_ram) + + # Worker count is number of bins + worker_count = len(bins) # Cap at number of actual work items (can't have more workers than jobs) num_work_items = len(work_items) if work_items else 0 if num_work_items > 0: - ram_limit = min(ram_limit, num_work_items) + worker_count = min(worker_count, num_work_items) - # Use RAM limit directly (no CPU limit) - final_limit = ram_limit + # Respect user's --jobs if provided if requested and requested > 0: - final_limit = min(final_limit, requested) + worker_count = min(worker_count, requested) if verbose: ram_gb = available_ram / (1024 ** 3) compression_ram_gb = compression_ram / (1024 ** 3) - ram_per_job_gb = FIXED_RAM_PER_JOB / (1024 ** 3) + total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3) log( "zip", - f"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%), {ram_per_job_gb:.1f}GB per job (dict: {FIXED_DICT_SIZE_MB}MB) → " - f"RAM limit: {ram_limit}, work items: {num_work_items}, requested: {requested}, final: {final_limit}", + f"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)", + verbose_only=True, + verbose=verbose + ) + log( + "zip", + f"Estimated RAM per sequence: {total_estimated_gb:.1f}GB total across {num_work_items} sequences", + verbose_only=True, + verbose=verbose + ) + if len(bins) > 0: + bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins] + log( + "zip", + f"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}", + verbose_only=True, + verbose=verbose + ) + log( + "zip", + f"Final worker count: {worker_count} (requested: {requested})", verbose_only=True, verbose=verbose ) - return (final_limit, fixed_dict_size_bytes) + # Return worker count and RAM limits dict + return (worker_count, ram_limits_dict) # RAM detection failed, use a safe default (no CPU limit) default_limit = 4 @@ -328,6 +408,14 @@ def max_workers( default_limit = min(default_limit, num_work_items) if requested and requested > 0: default_limit = min(default_limit, requested) + + # Create RAM limits dict with safe defaults (12GB per job for 1GB dict) + ram_limits_dict: dict[Path, int] = {} + if work_items: + default_ram = 12 * 1024 * 1024 * 1024 # 12GB default + for seq_dir, _, _, _ in work_items: + ram_limits_dict[seq_dir] = default_ram + if verbose: log( "zip", @@ -336,21 +424,25 @@ def max_workers( verbose_only=True, verbose=verbose ) - return (default_limit, fixed_dict_size_bytes) + return (default_limit, ram_limits_dict) # For zip compression, use existing estimation-based approach # Estimate RAM per job for each work item ram_estimates = [] + ram_limits_dict: dict[Path, int] = {} for seq_dir, zip_path, state_path, seq_state in work_items: try: estimated_ram = estimate_ram_per_job(seq_dir, seq_state) ram_estimates.append(estimated_ram) + ram_limits_dict[seq_dir] = estimated_ram except Exception: # If estimation fails, use fallback estimate - ram_estimates.append(1024 * 1024 * 1024) # 1GB fallback for zip + fallback_ram = 1024 * 1024 * 1024 # 1GB fallback for zip + ram_estimates.append(fallback_ram) + ram_limits_dict[seq_dir] = fallback_ram if not ram_estimates: - return (cpu_limit, None) + return (cpu_limit, {}) max_ram_per_job = max(ram_estimates) ram_limit = max(1, available_ram // max_ram_per_job) @@ -368,13 +460,7 @@ def max_workers( verbose=verbose ) - return (final_limit, None) - - -def log(mode: str, message: str, *, verbose_only: bool = False, verbose: bool = False) -> None: - if verbose_only and not verbose: - return - print(f"[{mode}] {message}") + return (final_limit, ram_limits_dict) def is_archive_path(path: Path) -> bool: @@ -516,11 +602,11 @@ def zip_sequence(seq_dir: Path, zip_path: Path, per_job_memory_limit: int | None "-t7z", # Use 7z format, not zip ] - # Add fixed dictionary size if specified (7z memory usage is controlled by dictionary size) - if per_job_memory_limit is not None: - # per_job_memory_limit is actually the fixed dictionary size in bytes - dict_size_mb = per_job_memory_limit // (1024 * 1024) - cmd.append(f"-md={dict_size_mb}m") + # Always use fixed dictionary size: 1GB (1024MB) + # The per_job_memory_limit parameter is the estimated RAM usage (for logging/info only) + # We keep dictionary at 1GB for best compression regardless of RAM estimate + FIXED_DICT_SIZE_MB = 1024 + cmd.append(f"-md={FIXED_DICT_SIZE_MB}m") cmd.extend([ str(temp_zip_abs), @@ -655,9 +741,20 @@ def process_expand(zip_path: Path, state: dict, *, verbose: bool) -> None: def run_zip(requested_workers: int | None, *, verbose: bool) -> int: work_items: list[tuple[Path, Path, Path, dict]] = [] + log("init", f"Scanning sequences under {RENDER_ROOT.resolve()}") + total_scanned = 0 + quick_skipped = 0 + state_skipped = 0 + empty_dirs = 0 + queued = 0 if RENDER_ROOT.exists(): for seq_dir in find_sequence_dirs(RENDER_ROOT): + total_scanned += 1 + rel = seq_dir.relative_to(RENDER_ROOT) + if total_scanned <= 5 or total_scanned % 10 == 0: + log("scan", f"[{total_scanned}] Inspecting {rel}") + # Get the target archive path (will be .7z if ZIPPER_TYPE is "7z") zip_path = archive_path_for(seq_dir) state_path = state_path_for(zip_path) @@ -685,6 +782,9 @@ def run_zip(requested_workers: int | None, *, verbose: bool) -> int: archive_mtime = zip_path.stat().st_mtime_ns # If directory wasn't modified since archive was created, skip state computation if dir_mtime <= archive_mtime: + quick_skipped += 1 + if quick_skipped <= 5: + log("scan", f"Skipping {rel} (unchanged since archive)") # Still need to check for old .zip cleanup (we have .7z, so .zip is obsolete) if old_zip_path and old_zip_path.exists(): old_zip_path.unlink(missing_ok=True) @@ -699,11 +799,17 @@ def run_zip(requested_workers: int | None, *, verbose: bool) -> int: # Compute current state only if we need to seq_state = compute_state(seq_dir) if not seq_state["files"]: + empty_dirs += 1 + if empty_dirs <= 5: + log("scan", f"{rel} has no files; skipping") continue # Check if state changed if stored_state is not None and not state_changed(seq_state, stored_state): # Metadata matches stored state + state_skipped += 1 + if state_skipped <= 5: + log("scan", f"{rel} metadata unchanged; archive up to date") if zip_path.exists(): # .7z exists and is up to date, clean up old .zip if it exists if old_zip_path and old_zip_path.exists(): @@ -720,16 +826,30 @@ def run_zip(requested_workers: int | None, *, verbose: bool) -> int: continue work_items.append((seq_dir, zip_path, state_path, seq_state)) + queued += 1 + if queued <= 5 or queued % 5 == 0: + total_bytes = sum(entry.get("size", 0) for entry in seq_state.get("files", [])) + size_gb = total_bytes / (1024 ** 3) + log("scan", f"Queued {rel} for compression (~{size_gb:.2f}GB) [{queued} total]") if not work_items: if not RENDER_ROOT.exists(): log("zip", "Render root 'Renders' not found; nothing to zip.") else: log("zip", "Archives already up to date; no sequences needed zipping.") + log( + "scan", + f"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, " + f"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}", + ) return 0 # Calculate RAM-aware worker count based on work items - worker_count, per_job_memory_limit = max_workers(requested_workers, work_items, verbose=verbose) + worker_count, ram_limits_dict = max_workers(requested_workers, work_items, verbose=verbose) + log( + "init", + f"Preparing to compress {len(work_items)} sequence(s) with {worker_count} worker(s)", + ) updated_paths: list[Path] = [] @@ -738,7 +858,7 @@ def run_zip(requested_workers: int | None, *, verbose: bool) -> int: with ThreadPoolExecutor(max_workers=worker_count) as executor: future_map = { - executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, per_job_memory_limit, verbose=verbose): seq_dir + executor.submit(process_zip, seq_dir, zip_path, state_path, seq_state, ram_limits_dict.get(seq_dir), verbose=verbose): seq_dir for seq_dir, zip_path, state_path, seq_state in work_items } @@ -758,6 +878,11 @@ def run_zip(requested_workers: int | None, *, verbose: bool) -> int: verbose_only=True, verbose=verbose, ) + log( + "scan", + f"Summary: scanned {total_scanned}, quick-skipped {quick_skipped}, " + f"state-skipped {state_skipped}, empty {empty_dirs}, queued {queued}", + ) removed = cleanup_orphan_archives(verbose=verbose) if removed: @@ -851,6 +976,13 @@ def cleanup_orphan_archives(*, verbose: bool) -> int: def main() -> int: args = parse_args() + log("init", "zip_sequences starting up...") + log("init", f"Working directory: {Path.cwd()}") + log("init", f"Mode: {args.mode}, zipper: {ZIPPER_TYPE}, jobs arg: {args.jobs or 'auto'}") + if ZIPPER_TYPE == "7z": + exe = SEVEN_Z_EXE or "not found" + max_inst = MAX_7Z_INSTANCES if MAX_7Z_INSTANCES is not None else "auto" + log("init", f"7z executable: {exe}, Max7zInst: {max_inst}") if args.mode == "expand": # For expand mode, use simple CPU-based worker calculation From 6c20b2de52a3752495cd1e4b60d1c0620fe07350 Mon Sep 17 00:00:00 2001 From: Nathan Date: Wed, 12 Nov 2025 09:49:40 -0700 Subject: [PATCH 3/4] work config --- config.json | 4 ++-- 1 file changed, 2 insertions(+), 2 deletions(-) diff --git a/config.json b/config.json index a326862..a08a26c 100644 --- a/config.json +++ b/config.json @@ -1,6 +1,6 @@ { - "dailyFormat": "YYYY-MM-DD", - "structDir": "R:\\Creative\\artsy\\maya\\0 ProjectStructure", + "dailyFormat": "daily_YYMMDD", + "structDir": "A:\\1 Amazon_Active_Projects\\3 ProjectStructure", "zipper": "7z", "compression": 9, "Max7zInst": 0 From 2fd5023816a7e9def1a19aaabe3514c828273d4b Mon Sep 17 00:00:00 2001 From: Nathan Date: Wed, 12 Nov 2025 10:10:31 -0700 Subject: [PATCH 4/4] 7zinst fix bin-packing vs concurrent behavior for max CPU and RAM allocation --- ..._16-59Z-change-compression-method-to-7z.md | 837 +++++++++++++++++- zip_sequences.py | 107 +-- 2 files changed, 879 insertions(+), 65 deletions(-) diff --git a/.specstory/history/2025-11-10_16-59Z-change-compression-method-to-7z.md b/.specstory/history/2025-11-10_16-59Z-change-compression-method-to-7z.md index ddbfce5..66ac8f0 100644 --- a/.specstory/history/2025-11-10_16-59Z-change-compression-method-to-7z.md +++ b/.specstory/history/2025-11-10_16-59Z-change-compression-method-to-7z.md @@ -19562,7 +19562,6 @@ _**Agent (model default, mode Agent)**_ --- - Updating the logic to cap workers at the number of sequences to zip. Checking how `max_workers` is called: @@ -19599,8 +19598,6 @@ Output mode: content - - --- @@ -19617,15 +19614,12 @@ Output mode: content - - --- --- - Updating `max_workers` to cap workers at the number of work items: @@ -19643,7 +19637,6 @@ Updating `max_workers` to cap workers at the number of work items: --- - Capping workers at the number of work items: @@ -19692,7 +19685,6 @@ Lines added: 1, lines removed: 1 --- - Updating the configured `MAX_7Z_INSTANCES` case to also cap at the number of work items: @@ -19742,7 +19734,6 @@ Lines added: 1, lines removed: 1 --- - Updating the default case when RAM detection fails: @@ -19809,15 +19800,12 @@ Lint results - - --- --- - Updated the code to cap worker count at the number of sequences to zip. Changes: 1. **Auto-calculate mode (`Max7zInst=0`)**: Caps workers at the number of work items @@ -19832,3 +19820,828 @@ The script still uses aggressive RAM allocation when there are many sequences, b --- +_**User (2025-11-12 16:48Z)**_ + +pulled from HOME again.@2025-11-12_01-02Z-compression-failure-and-memory-allocation-issues.md the RAM estimate is far higher than the actual result. + + + +PS P:\250827_FestivalTurf\Renders> & P:\250827_FestivalTurf\Renders\ZipSeqArchv.bat + + + +[init] Loading configuration sources... + +[init] Reading project config at P:\250827_FestivalTurf\.config\config.json + +[init] Configuration loaded from project + +[init] zip_sequences starting up... + +[init] Working directory: P:\250827_FestivalTurf + +[init] Mode: zip, zipper: 7z, jobs arg: auto + +[init] 7z executable: C:\ProgramData\chocolatey\bin\7z.EXE, Max7zInst: auto + +[init] Scanning sequences under \\NEXUS\proj\250827_FestivalTurf\Renders + +[scan] [1] Inspecting 01 Develop Your Turf Plan\01_Blueprint + +[scan] 01 Develop Your Turf Plan\01_Blueprint metadata unchanged; archive up to date + +[scan] [2] Inspecting 01 Develop Your Turf Plan\01_Blueprint_insert + +[scan] 01 Develop Your Turf Plan\01_Blueprint_insert metadata unchanged; archive up to date + +[scan] [3] Inspecting 01 Develop Your Turf Plan\02_Roll Sizes + +[scan] 01 Develop Your Turf Plan\02_Roll Sizes metadata unchanged; archive up to date + +[scan] [4] Inspecting 01 Develop Your Turf Plan\03_Window + +[scan] 01 Develop Your Turf Plan\03_Window metadata unchanged; archive up to date + +[scan] [5] Inspecting 01 Develop Your Turf Plan\04_Dog + +[scan] 01 Develop Your Turf Plan\04_Dog metadata unchanged; archive up to date + +[scan] [10] Inspecting 02 Preparing the Base\01_intro + +[scan] [20] Inspecting 02 Preparing the Base\10_FT_Talking + +[scan] [30] Inspecting 03 Roll Out And Stretch\05_diagram + +[scan] Skipping 04 Securing Your Seam\02_FT talking (unchanged since archive) + +[scan] Skipping 04 Securing Your Seam\02_FT talking_Pt2 (unchanged since archive) + +[scan] [40] Inspecting 04 Securing Your Seam\02_S seam insert + +[scan] Skipping 04 Securing Your Seam\04_holding nails (unchanged since archive) + +[scan] [50] Inspecting 04 Securing Your Seam\Nail_dimpling_example + +[scan] Queued 05 Stretch Cut Nail\01_intro for compression (~1.10GB) [1 total] + +[scan] Skipping 05 Stretch Cut Nail\02_kicker insert (unchanged since archive) + +[scan] Queued 05 Stretch Cut Nail\02_talking for compression (~0.81GB) [2 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle for compression (~0.70GB) [3 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle_dance_only for compression (~0.38GB) [4 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle_Intro for compression (~0.46GB) [5 total] + +[scan] [60] Inspecting 05 Stretch Cut Nail\Visual 10 + +[scan] Queued 05 Stretch Cut Nail\Visual 11 for compression (~1.17GB) [10 total] + +[scan] Queued 05 Stretch Cut Nail\Visual 9 for compression (~0.37GB) [15 total] + +[zip] RAM: 102.2GB available (80% of total), 97.1GB for compression (95%) + +[zip] Estimated RAM per sequence: 181.6GB total across 15 sequences + +[zip] Bin-packing: 2 workers, bin sizes: ['97.1GB', '84.5GB'] + +[zip] Final worker count: 2 (requested: None) + +[init] Preparing to compress 15 sequence(s) with 2 worker(s) + +[zip] Renders\05 Stretch Cut Nail\01_intro -> Renders\_zipped\05 Stretch Cut Nail\01_intro.7z + +[zip] Renders\05 Stretch Cut Nail\02_talking -> Renders\_zipped\05 Stretch Cut Nail\02_talking.7z + +[zip] Renders\05 Stretch Cut Nail\03_FT Shuffle -> Renders\_zipped\05 Stretch Cut Nail\03_FT Shuffle.7z + +[zip] 1/15 05 Stretch Cut Nail\02_talking + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +The RAM estimate is too high. The image shows 7z processes using ~7–10GB each, but the estimate is ~12GB per sequence. Updating the estimation to match actual usage: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + + + +--- + + + +--- + + +Updating the RAM estimate to match actual usage (~7–10GB per 7z process). The current estimate is too high: + + +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 12, lines removed: 17 + +```diff +@@ -214,23 +214,18 @@ + FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024 + +- # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations) +- # This is the main memory consumer for 7z LZMA compression +- dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary ++ # Dictionary RAM: ~8x dictionary size (1GB dict = 8GB RAM) ++ # Based on actual observed usage: 7z processes use ~7-10GB with 1GB dictionary ++ dict_ram = FIXED_DICT_SIZE_BYTES * 8 # 8GB for 1GB dictionary + +- # Input buffer: 7z processes in chunks, but for very large sequences needs more RAM +- # For sequences >100GB, use a larger buffer factor to handle file metadata and processing +- if total_bytes > 500 * 1024 * 1024 * 1024: # >500GB (extremely large) +- # Extremely large sequences: use 8% of size, capped at 64GB +- # This accounts for file metadata, directory structures, and processing overhead +- input_buffer = min(int(total_bytes * 0.08), 64 * 1024 * 1024 * 1024) +- overhead = 8 * 1024 * 1024 * 1024 # 8GB overhead for extremely large sequences +- elif total_bytes > 100 * 1024 * 1024 * 1024: # >100GB +- # Very large sequences: use 5% of size, capped at 32GB +- input_buffer = min(int(total_bytes * 0.05), 32 * 1024 * 1024 * 1024) +- overhead = 4 * 1024 * 1024 * 1024 # 4GB for large sequences ++ # Input buffer: 7z processes files in chunks, minimal buffer needed ++ # For most sequences, a small fixed buffer is sufficient ++ if total_bytes > 100 * 1024 * 1024 * 1024: # >100GB ++ # Very large sequences: use 1% of size, capped at 4GB ++ input_buffer = min(int(total_bytes * 0.01), 4 * 1024 * 1024 * 1024) ++ overhead = 1 * 1024 * 1024 * 1024 # 1GB overhead + else: +- # Smaller sequences: use 15% of size, capped at 2GB +- input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024) +- overhead = 1 * 1024 * 1024 * 1024 # 1GB for smaller sequences ++ # Normal sequences: use small fixed buffer ++ input_buffer = 512 * 1024 * 1024 # 512MB buffer ++ overhead = 512 * 1024 * 1024 # 512MB overhead + + # Total RAM estimate +``` + +
+ +
+ +--- + + + +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + + + +--- + + + +--- + + +Updated the RAM estimation to match observed usage. Changes: + +1. **Reduced dictionary RAM multiplier**: From 11x to 8x (8GB instead of 11GB for a 1GB dictionary), matching observed 7–10GB usage +2. **Reduced input buffer**: From 15% of sequence size (capped at 2GB) to a fixed 512MB for normal sequences +3. **Reduced overhead**: From 1GB to 512MB for normal sequences + +**New estimate for a 1GB sequence**: 8GB + 512MB + 512MB = **9GB** (down from ~12GB) + +This aligns with observed usage and allows more concurrent workers since the bin-packing algorithm can fit more jobs into the available RAM. For your 15 sequences totaling ~12GB, the estimate should be around 135GB total (15 × 9GB) instead of 181.6GB, allowing more workers to run concurrently. + +--- + +_**User (2025-11-12 16:48Z)**_ + +It's still only giving 2 instances that are allocating around 2gb. We should be more aggressive or tighten our estimation. + +PS P:\250827_FestivalTurf\Renders> & P:\250827_FestivalTurf\Renders\ZipSeqArchv.bat + +[init] Loading configuration sources... + +[init] Reading project config at P:\250827_FestivalTurf\.config\config.json + +[init] Configuration loaded from project + +[init] zip_sequences starting up... + +[init] Working directory: P:\250827_FestivalTurf + +[init] Mode: zip, zipper: 7z, jobs arg: auto + +[init] 7z executable: C:\ProgramData\chocolatey\bin\7z.EXE, Max7zInst: auto + +[init] Scanning sequences under \\NEXUS\proj\250827_FestivalTurf\Renders + +[scan] [1] Inspecting 01 Develop Your Turf Plan\01_Blueprint + +[scan] 01 Develop Your Turf Plan\01_Blueprint metadata unchanged; archive up to date + +[scan] [2] Inspecting 01 Develop Your Turf Plan\01_Blueprint_insert + +[scan] 01 Develop Your Turf Plan\01_Blueprint_insert metadata unchanged; archive up to date + +[scan] [3] Inspecting 01 Develop Your Turf Plan\02_Roll Sizes + +[scan] 01 Develop Your Turf Plan\02_Roll Sizes metadata unchanged; archive up to date + +[scan] [4] Inspecting 01 Develop Your Turf Plan\03_Window + +[scan] 01 Develop Your Turf Plan\03_Window metadata unchanged; archive up to date + +[scan] [5] Inspecting 01 Develop Your Turf Plan\04_Dog + +[scan] 01 Develop Your Turf Plan\04_Dog metadata unchanged; archive up to date + +[scan] [10] Inspecting 02 Preparing the Base\01_intro + +[scan] [20] Inspecting 02 Preparing the Base\10_FT_Talking + +[scan] [30] Inspecting 03 Roll Out And Stretch\05_diagram + +[scan] Skipping 04 Securing Your Seam\02_FT talking (unchanged since archive) + +[scan] Skipping 04 Securing Your Seam\02_FT talking_Pt2 (unchanged since archive) + +[scan] [40] Inspecting 04 Securing Your Seam\02_S seam insert + +[scan] Skipping 04 Securing Your Seam\04_holding nails (unchanged since archive) + +[scan] [50] Inspecting 04 Securing Your Seam\Nail_dimpling_example + +[scan] Queued 05 Stretch Cut Nail\01_intro for compression (~1.10GB) [1 total] + +[scan] Queued 05 Stretch Cut Nail\02_kicker insert for compression (~0.24GB) [2 total] + +[scan] Queued 05 Stretch Cut Nail\02_talking for compression (~0.81GB) [3 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle for compression (~0.70GB) [4 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle_dance_only for compression (~0.38GB) [5 total] + +[scan] [60] Inspecting 05 Stretch Cut Nail\Visual 10 + +[scan] Queued 05 Stretch Cut Nail\Visual 10 for compression (~1.28GB) [10 total] + +[scan] Queued 05 Stretch Cut Nail\Visual 8 for compression (~0.94GB) [15 total] + +[zip] RAM: 102.2GB available (80% of total), 97.1GB for compression (95%) + +[zip] Estimated RAM per sequence: 144.0GB total across 16 sequences + +[zip] Bin-packing: 2 workers, bin sizes: ['90.0GB', '54.0GB'] + +[zip] Final worker count: 2 (requested: None) + +[init] Preparing to compress 16 sequence(s) with 2 worker(s) + +[zip] Renders\05 Stretch Cut Nail\01_intro -> Renders\_zipped\05 Stretch Cut Nail\01_intro.7z + +[zip] Renders\05 Stretch Cut Nail\02_kicker insert -> Renders\_zipped\05 Stretch Cut Nail\02_kicker insert.7z + +[zip] Renders\05 Stretch Cut Nail\02_talking -> Renders\_zipped\05 Stretch Cut Nail\02_talking.7z + +[zip] 1/16 05 Stretch Cut Nail\02_kicker insert + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +Updating the RAM estimate to match actual usage (~2GB per process) so we can run more workers: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +Tightening the RAM estimate to match actual usage (~2GB per process): + + +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 10, lines removed: 19 + +```diff +@@ -211,24 +211,15 @@ + if ZIPPER_TYPE == "7z": + # Fixed dictionary size: 1GB (1024MB) +- FIXED_DICT_SIZE_MB = 1024 +- FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024 +- +- # Dictionary RAM: ~8x dictionary size (1GB dict = 8GB RAM) +- # Based on actual observed usage: 7z processes use ~7-10GB with 1GB dictionary +- dict_ram = FIXED_DICT_SIZE_BYTES * 8 # 8GB for 1GB dictionary +- +- # Input buffer: 7z processes files in chunks, minimal buffer needed +- # For most sequences, a small fixed buffer is sufficient +- if total_bytes > 100 * 1024 * 1024 * 1024: # >100GB +- # Very large sequences: use 1% of size, capped at 4GB +- input_buffer = min(int(total_bytes * 0.01), 4 * 1024 * 1024 * 1024) +- overhead = 1 * 1024 * 1024 * 1024 # 1GB overhead ++ # Actual observed usage: ~2GB per process regardless of sequence size ++ # Use a tight estimate to allow maximum concurrency ++ # Estimate 3GB per job (50% safety margin over observed ~2GB) ++ base_ram = 3 * 1024 * 1024 * 1024 # 3GB base estimate ++ ++ # For very large sequences (>50GB), add small buffer ++ if total_bytes > 50 * 1024 * 1024 * 1024: # >50GB ++ # Add 1GB for very large sequences ++ estimated_ram = base_ram + (1 * 1024 * 1024 * 1024) + else: +- # Normal sequences: use small fixed buffer +- input_buffer = 512 * 1024 * 1024 # 512MB buffer +- overhead = 512 * 1024 * 1024 # 512MB overhead +- +- # Total RAM estimate +- estimated_ram = dict_ram + input_buffer + overhead ++ estimated_ram = base_ram + + return estimated_ram +``` + +
+ +
+ +--- + + + +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + + + +--- + + + +--- + + +Updated the RAM estimate to match actual usage: + +**Changes:** +1. **Reduced estimate from 9GB to 3GB per job** — based on observed ~2GB usage with a 50% safety margin +2. **Simplified calculation** — removed the dictionary multiplier; using a fixed 3GB base estimate +3. **Only add buffer for very large sequences** — sequences >50GB get +1GB + +**Impact:** +- **Before**: 16 sequences × 9GB = 144GB estimated → 2 workers +- **After**: 16 sequences × 3GB = 48GB estimated → ~32 workers possible + +With 97GB available for compression and 3GB per job, bin-packing should allow many more concurrent workers. The estimate is tighter while still leaving headroom for actual usage variations. + +--- + +_**User (2025-11-12 16:48Z)**_ + +with this estimate, it should be able to work on all of them concurrently. why is it only doing one? + +PS P:\250827_FestivalTurf\Renders> & P:\250827_FestivalTurf\Renders\ZipSeqArchv.bat + +[init] Loading configuration sources... + +[init] Reading project config at P:\250827_FestivalTurf\.config\config.json + +[init] Configuration loaded from project + +[init] zip_sequences starting up... + +[init] Working directory: P:\250827_FestivalTurf + +[init] Mode: zip, zipper: 7z, jobs arg: auto + +[init] 7z executable: C:\ProgramData\chocolatey\bin\7z.EXE, Max7zInst: auto + +[init] Scanning sequences under \\NEXUS\proj\250827_FestivalTurf\Renders + +[scan] [1] Inspecting 01 Develop Your Turf Plan\01_Blueprint + +[scan] 01 Develop Your Turf Plan\01_Blueprint metadata unchanged; archive up to date + +[scan] [2] Inspecting 01 Develop Your Turf Plan\01_Blueprint_insert + +[scan] 01 Develop Your Turf Plan\01_Blueprint_insert metadata unchanged; archive up to date + +[scan] [3] Inspecting 01 Develop Your Turf Plan\02_Roll Sizes + +[scan] 01 Develop Your Turf Plan\02_Roll Sizes metadata unchanged; archive up to date + +[scan] [4] Inspecting 01 Develop Your Turf Plan\03_Window + +[scan] 01 Develop Your Turf Plan\03_Window metadata unchanged; archive up to date + +[scan] [5] Inspecting 01 Develop Your Turf Plan\04_Dog + +[scan] 01 Develop Your Turf Plan\04_Dog metadata unchanged; archive up to date + +[scan] [10] Inspecting 02 Preparing the Base\01_intro + +[scan] [20] Inspecting 02 Preparing the Base\10_FT_Talking + +[scan] [30] Inspecting 03 Roll Out And Stretch\05_diagram + +[scan] Skipping 04 Securing Your Seam\02_FT talking (unchanged since archive) + +[scan] Skipping 04 Securing Your Seam\02_FT talking_Pt2 (unchanged since archive) + +[scan] [40] Inspecting 04 Securing Your Seam\02_S seam insert + +[scan] Skipping 04 Securing Your Seam\04_holding nails (unchanged since archive) + +[scan] [50] Inspecting 04 Securing Your Seam\Nail_dimpling_example + +[scan] Queued 05 Stretch Cut Nail\01_intro for compression (~1.10GB) [1 total] + +[scan] Skipping 05 Stretch Cut Nail\02_kicker insert (unchanged since archive) + +[scan] Queued 05 Stretch Cut Nail\02_talking for compression (~0.81GB) [2 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle for compression (~0.70GB) [3 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle_dance_only for compression (~0.38GB) [4 total] + +[scan] Queued 05 Stretch Cut Nail\03_FT Shuffle_Intro for compression (~0.46GB) [5 total] + +[scan] [60] Inspecting 05 Stretch Cut Nail\Visual 10 + +[scan] Queued 05 Stretch Cut Nail\Visual 11 for compression (~1.17GB) [10 total] + +[scan] Queued 05 Stretch Cut Nail\Visual 9 for compression (~0.37GB) [15 total] + +[zip] RAM: 102.2GB available (80% of total), 97.1GB for compression (95%) + +[zip] Estimated RAM per sequence: 45.0GB total across 15 sequences + +[zip] Bin-packing: 1 workers, bin sizes: ['45.0GB'] + +[zip] Final worker count: 1 (requested: None) + +[init] Preparing to compress 15 sequence(s) with 1 worker(s) + +[zip] Renders\05 Stretch Cut Nail\01_intro -> Renders\_zipped\05 Stretch Cut Nail\01_intro.7z + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +The bin-packing algorithm is packing all sequences into a single bin. With 97GB available and 3GB per sequence, we should run all 15 concurrently. Checking the bin-packing logic: + + +--- + + +
Tool use: **read_file** • Read file: zip_sequences.py + +
+
+ +--- + + + +--- + + +The bin-packing minimizes bins (workers), so it packs all sequences into one bin. For maximum concurrency, we should run one worker per sequence when they all fit. Updating the logic: + + +--- + + + +
Tool use: **code_edit** • Edit file: zip_sequences.py + +**Chunk 1** +Lines added: 2, lines removed: 2 + +```diff +@@ -299,11 +299,11 @@ + + # Auto-calculate based on RAM if Max7zInst not configured +- # Use bin-packing algorithm with size-aware RAM estimation ++ # Prioritize maximum concurrency: one worker per sequence when possible + if available_ram is not None: + # available_ram is already 80% of total (20% reserved for system) + # Use 95% of available RAM for compression jobs + compression_ram = int(available_ram * 0.95) + +- # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item) ++ # Estimate RAM for each work item + work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = [] + ram_limits_dict: dict[Path, int] = {} +``` + +**Chunk 2** +Lines added: 36, lines removed: 27 + +```diff +@@ -315,36 +315,45 @@ + ram_limits_dict[seq_dir] = estimated_ram + except Exception: +- # If estimation fails, use a safe default (12GB minimum for 1GB dict) +- default_ram = 12 * 1024 * 1024 * 1024 # 12GB ++ # If estimation fails, use a safe default (3GB) ++ default_ram = 3 * 1024 * 1024 * 1024 # 3GB + work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state))) + ram_limits_dict[seq_dir] = default_ram + +- # Sort by estimated RAM (largest first) for bin-packing +- work_items_with_ram.sort(key=lambda x: x[1], reverse=True) +- +- # Bin-packing algorithm: pack largest items first +- bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = [] +- bin_remaining: list[int] = [] +- +- for seq_dir, estimated_ram, work_item in work_items_with_ram: +- # Try to fit in existing bin +- placed = False +- for i, remaining in enumerate(bin_remaining): +- if remaining >= estimated_ram: +- bins[i].append((seq_dir, estimated_ram, work_item)) +- bin_remaining[i] -= estimated_ram +- placed = True +- break +- +- # If doesn't fit, create new bin +- if not placed: +- bins.append([(seq_dir, estimated_ram, work_item)]) +- bin_remaining.append(compression_ram - estimated_ram) +- +- # Worker count is number of bins +- worker_count = len(bins) ++ num_work_items = len(work_items) if work_items else 0 ++ ++ # Calculate total estimated RAM ++ total_estimated_ram = sum(ram for _, ram, _ in work_items_with_ram) ++ ++ # If all sequences fit in available RAM, use one worker per sequence (maximum concurrency) ++ if total_estimated_ram <= compression_ram: ++ worker_count = num_work_items ++ else: ++ # Not all fit - use bin-packing to minimize workers ++ # Sort by estimated RAM (largest first) for bin-packing ++ work_items_with_ram.sort(key=lambda x: x[1], reverse=True) ++ ++ # Bin-packing algorithm: pack largest items first ++ bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = [] ++ bin_remaining: list[int] = [] ++ ++ for seq_dir, estimated_ram, work_item in work_items_with_ram: ++ # Try to fit in existing bin ++ placed = False ++ for i, remaining in enumerate(bin_remaining): ++ if remaining >= estimated_ram: ++ bins[i].append((seq_dir, estimated_ram, work_item)) ++ bin_remaining[i] -= estimated_ram ++ placed = True ++ break ++ ++ # If doesn't fit, create new bin ++ if not placed: ++ bins.append([(seq_dir, estimated_ram, work_item)]) ++ bin_remaining.append(compression_ram - estimated_ram) ++ ++ # Worker count is number of bins ++ worker_count = len(bins) + + # Cap at number of actual work items (can't have more workers than jobs) +- num_work_items = len(work_items) if work_items else 0 + if num_work_items > 0: + worker_count = min(worker_count, num_work_items) +``` + +**Chunk 3** +Lines added: 1, lines removed: 1 + +```diff +@@ -357,5 +366,5 @@ + ram_gb = available_ram / (1024 ** 3) + compression_ram_gb = compression_ram / (1024 ** 3) +- total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3) ++ total_estimated_gb = total_estimated_ram / (1024 ** 3) + log( + "zip", +``` + +**Chunk 4** +Lines added: 9, lines removed: 3 + +```diff +@@ -370,12 +379,18 @@ + verbose=verbose + ) +- if len(bins) > 0: +- bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins] ++ if total_estimated_ram <= compression_ram: + log( + "zip", +- f"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}", ++ f"All sequences fit in RAM → using {worker_count} workers (one per sequence)", + verbose_only=True, + verbose=verbose + ) ++ else: ++ log( ++ "zip", ++ f"Using bin-packing: {worker_count} workers needed", ++ verbose_only=True, ++ verbose=verbose ++ ) + log( + "zip", +``` + +
+ +
+ +--- + + + +--- + + +
+ Tool use: **read_lints** • Read lints for 1 file + +Lint paths: + +- `zip_sequences.py` + +Lint results + + +**No lint errors found** +
+
+ +--- + + + + + +--- + + + +--- + + +Updated the logic to prioritize maximum concurrency. Changes: + +1. **Check if all sequences fit**: If total estimated RAM (45GB) ≤ available compression RAM (97GB), use one worker per sequence. +2. **Use bin-packing only when needed**: Only when sequences don't all fit in RAM. + +**Result:** +- **Before**: Bin-packing minimized bins → 1 worker for all 15 sequences +- **After**: All sequences fit → 15 workers (one per sequence), all running concurrently + +With 45GB total estimated RAM and 97GB available, all 15 sequences will run concurrently instead of sequentially. + +--- + +_**User (2025-11-12 16:48Z)**_ + +what is bin packing? + +--- + +_**Agent (model default, mode Agent)**_ + + + +--- + + +**Bin packing** is an optimization problem: given items of different sizes and bins of fixed capacity, pack all items using as few bins as possible. + +## In Your Code Context + +In the compression script, bin packing is used to: +- **Items**: Sequences to compress (each estimated at ~3GB RAM) +- **Bins**: Workers (each can use up to 97GB RAM) +- **Goal**: Minimize the number of workers needed + +### Example: +If you have 15 sequences (each ~3GB) and 97GB available per worker: +- **Without bin packing**: Could create 15 workers (one per sequence) +- **With bin packing**: Packs sequences into as few workers as possible + - Worker 1: Sequences 1-32 (96GB total) + - Worker 2: Sequences 33-64 (96GB total) + - etc. + +## Why It Was a Problem + +Bin packing minimizes the number of workers, which can reduce concurrency. With 15 sequences totaling 45GB and 97GB available, bin packing put all 15 into one worker, so they ran sequentially. + +## The Fix + +The code now checks if all sequences fit in available RAM: +- If yes: Use one worker per sequence (maximum concurrency) +- If no: Use bin packing to minimize workers + +This prioritizes speed when possible, and efficiency when needed. + +--- + diff --git a/zip_sequences.py b/zip_sequences.py index a621b1c..7612ad5 100644 --- a/zip_sequences.py +++ b/zip_sequences.py @@ -210,31 +210,17 @@ def estimate_ram_per_job(seq_dir: Path, seq_state: dict) -> int: if ZIPPER_TYPE == "7z": # Fixed dictionary size: 1GB (1024MB) - FIXED_DICT_SIZE_MB = 1024 - FIXED_DICT_SIZE_BYTES = FIXED_DICT_SIZE_MB * 1024 * 1024 + # Actual observed usage: ~2GB per process regardless of sequence size + # Use a tight estimate to allow maximum concurrency + # Estimate 3GB per job (50% safety margin over observed ~2GB) + base_ram = 3 * 1024 * 1024 * 1024 # 3GB base estimate - # Dictionary RAM: ~11x dictionary size (1GB dict = 11GB RAM for dictionary operations) - # This is the main memory consumer for 7z LZMA compression - dict_ram = FIXED_DICT_SIZE_BYTES * 11 # 11GB for 1GB dictionary - - # Input buffer: 7z processes in chunks, but for very large sequences needs more RAM - # For sequences >100GB, use a larger buffer factor to handle file metadata and processing - if total_bytes > 500 * 1024 * 1024 * 1024: # >500GB (extremely large) - # Extremely large sequences: use 8% of size, capped at 64GB - # This accounts for file metadata, directory structures, and processing overhead - input_buffer = min(int(total_bytes * 0.08), 64 * 1024 * 1024 * 1024) - overhead = 8 * 1024 * 1024 * 1024 # 8GB overhead for extremely large sequences - elif total_bytes > 100 * 1024 * 1024 * 1024: # >100GB - # Very large sequences: use 5% of size, capped at 32GB - input_buffer = min(int(total_bytes * 0.05), 32 * 1024 * 1024 * 1024) - overhead = 4 * 1024 * 1024 * 1024 # 4GB for large sequences + # For very large sequences (>50GB), add small buffer + if total_bytes > 50 * 1024 * 1024 * 1024: # >50GB + # Add 1GB for very large sequences + estimated_ram = base_ram + (1 * 1024 * 1024 * 1024) else: - # Smaller sequences: use 15% of size, capped at 2GB - input_buffer = min(int(total_bytes * 0.15), 2 * 1024 * 1024 * 1024) - overhead = 1 * 1024 * 1024 * 1024 # 1GB for smaller sequences - - # Total RAM estimate - estimated_ram = dict_ram + input_buffer + overhead + estimated_ram = base_ram return estimated_ram else: @@ -312,13 +298,13 @@ def max_workers( return (final_limit, ram_limits_dict) # Auto-calculate based on RAM if Max7zInst not configured - # Use bin-packing algorithm with size-aware RAM estimation + # Prioritize maximum concurrency: one worker per sequence when possible if available_ram is not None: # available_ram is already 80% of total (20% reserved for system) # Use 95% of available RAM for compression jobs compression_ram = int(available_ram * 0.95) - # Estimate RAM for each work item and create list with (seq_dir, estimated_ram, work_item) + # Estimate RAM for each work item work_items_with_ram: list[tuple[Path, int, tuple[Path, Path, Path, dict]]] = [] ram_limits_dict: dict[Path, int] = {} @@ -328,38 +314,47 @@ def max_workers( work_items_with_ram.append((seq_dir, estimated_ram, (seq_dir, zip_path, state_path, seq_state))) ram_limits_dict[seq_dir] = estimated_ram except Exception: - # If estimation fails, use a safe default (12GB minimum for 1GB dict) - default_ram = 12 * 1024 * 1024 * 1024 # 12GB + # If estimation fails, use a safe default (3GB) + default_ram = 3 * 1024 * 1024 * 1024 # 3GB work_items_with_ram.append((seq_dir, default_ram, (seq_dir, zip_path, state_path, seq_state))) ram_limits_dict[seq_dir] = default_ram - # Sort by estimated RAM (largest first) for bin-packing - work_items_with_ram.sort(key=lambda x: x[1], reverse=True) + num_work_items = len(work_items) if work_items else 0 - # Bin-packing algorithm: pack largest items first - bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = [] - bin_remaining: list[int] = [] + # Calculate total estimated RAM + total_estimated_ram = sum(ram for _, ram, _ in work_items_with_ram) - for seq_dir, estimated_ram, work_item in work_items_with_ram: - # Try to fit in existing bin - placed = False - for i, remaining in enumerate(bin_remaining): - if remaining >= estimated_ram: - bins[i].append((seq_dir, estimated_ram, work_item)) - bin_remaining[i] -= estimated_ram - placed = True - break + # If all sequences fit in available RAM, use one worker per sequence (maximum concurrency) + if total_estimated_ram <= compression_ram: + worker_count = num_work_items + else: + # Not all fit - use bin-packing to minimize workers + # Sort by estimated RAM (largest first) for bin-packing + work_items_with_ram.sort(key=lambda x: x[1], reverse=True) - # If doesn't fit, create new bin - if not placed: - bins.append([(seq_dir, estimated_ram, work_item)]) - bin_remaining.append(compression_ram - estimated_ram) - - # Worker count is number of bins - worker_count = len(bins) + # Bin-packing algorithm: pack largest items first + bins: list[list[tuple[Path, int, tuple[Path, Path, Path, dict]]]] = [] + bin_remaining: list[int] = [] + + for seq_dir, estimated_ram, work_item in work_items_with_ram: + # Try to fit in existing bin + placed = False + for i, remaining in enumerate(bin_remaining): + if remaining >= estimated_ram: + bins[i].append((seq_dir, estimated_ram, work_item)) + bin_remaining[i] -= estimated_ram + placed = True + break + + # If doesn't fit, create new bin + if not placed: + bins.append([(seq_dir, estimated_ram, work_item)]) + bin_remaining.append(compression_ram - estimated_ram) + + # Worker count is number of bins + worker_count = len(bins) # Cap at number of actual work items (can't have more workers than jobs) - num_work_items = len(work_items) if work_items else 0 if num_work_items > 0: worker_count = min(worker_count, num_work_items) @@ -370,7 +365,7 @@ def max_workers( if verbose: ram_gb = available_ram / (1024 ** 3) compression_ram_gb = compression_ram / (1024 ** 3) - total_estimated_gb = sum(ram for _, ram, _ in work_items_with_ram) / (1024 ** 3) + total_estimated_gb = total_estimated_ram / (1024 ** 3) log( "zip", f"RAM: {ram_gb:.1f}GB available (80% of total), {compression_ram_gb:.1f}GB for compression (95%)", @@ -383,11 +378,17 @@ def max_workers( verbose_only=True, verbose=verbose ) - if len(bins) > 0: - bin_sizes = [sum(ram for _, ram, _ in bin_items) / (1024 ** 3) for bin_items in bins] + if total_estimated_ram <= compression_ram: log( "zip", - f"Bin-packing: {worker_count} workers, bin sizes: {[f'{s:.1f}GB' for s in bin_sizes[:5]]}{'...' if len(bin_sizes) > 5 else ''}", + f"All sequences fit in RAM → using {worker_count} workers (one per sequence)", + verbose_only=True, + verbose=verbose + ) + else: + log( + "zip", + f"Using bin-packing: {worker_count} workers needed", verbose_only=True, verbose=verbose )